Merge branch 'main' into refactor-text-generate-item

.claude/skills/frontend-testing/CHECKLIST.md

@@ -0,0 +1,205 @@
+# Test Generation Checklist
+
+Use this checklist when generating or reviewing tests for Dify frontend components.
+
+## Pre-Generation
+
+- [ ] Read the component source code completely
+- [ ] Identify component type (component, hook, utility, page)
+- [ ] Run `pnpm analyze-component <path>` if available
+- [ ] Note complexity score and features detected
+- [ ] Check for existing tests in the same directory
+- [ ] **Identify ALL files in the directory** that need testing (not just index)
+
+## Testing Strategy
+
+### ⚠️ Incremental Workflow (CRITICAL for Multi-File)
+
+- [ ] **NEVER generate all tests at once** - process one file at a time
+- [ ] Order files by complexity: utilities → hooks → simple → complex → integration
+- [ ] Create a todo list to track progress before starting
+- [ ] For EACH file: write → run test → verify pass → then next
+- [ ] **DO NOT proceed** to next file until current one passes
+
+### Path-Level Coverage
+
+- [ ] **Test ALL files** in the assigned directory/path
+- [ ] List all components, hooks, utilities that need coverage
+- [ ] Decide: single spec file (integration) or multiple spec files (unit)
+
+### Complexity Assessment
+
+- [ ] Run `pnpm analyze-component <path>` for complexity score
+- [ ] **Complexity > 50**: Consider refactoring before testing
+- [ ] **500+ lines**: Consider splitting before testing
+- [ ] **30-50 complexity**: Use multiple describe blocks, organized structure
+
+### Integration vs Mocking
+
+- [ ] **DO NOT mock base components** (`Loading`, `Button`, `Tooltip`, etc.)
+- [ ] Import real project components instead of mocking
+- [ ] Only mock: API calls, complex context providers, third-party libs with side effects
+- [ ] Prefer integration testing when using single spec file
+
+## Required Test Sections
+
+### All Components MUST Have
+
+- [ ] **Rendering tests** - Component renders without crashing
+- [ ] **Props tests** - Required props, optional props, default values
+- [ ] **Edge cases** - null, undefined, empty values, boundaries
+
+### Conditional Sections (Add When Feature Present)
+
+| Feature | Add Tests For |
+|---------|---------------|
+| `useState` | Initial state, transitions, cleanup |
+| `useEffect` | Execution, dependencies, cleanup |
+| Event handlers | onClick, onChange, onSubmit, keyboard |
+| API calls | Loading, success, error states |
+| Routing | Navigation, params, query strings |
+| `useCallback`/`useMemo` | Referential equality |
+| Context | Provider values, consumer behavior |
+| Forms | Validation, submission, error display |
+
+## Code Quality Checklist
+
+### Structure
+
+- [ ] Uses `describe` blocks to group related tests
+- [ ] Test names follow `should <behavior> when <condition>` pattern
+- [ ] AAA pattern (Arrange-Act-Assert) is clear
+- [ ] Comments explain complex test scenarios
+
+### Mocks
+
+- [ ] **DO NOT mock base components** (`@/app/components/base/*`)
+- [ ] `jest.clearAllMocks()` in `beforeEach` (not `afterEach`)
+- [ ] Shared mock state reset in `beforeEach`
+- [ ] i18n uses shared mock (auto-loaded); only override locally for custom translations
+- [ ] Router mocks match actual Next.js API
+- [ ] Mocks reflect actual component conditional behavior
+- [ ] Only mock: API services, complex context providers, third-party libs
+
+### Queries
+
+- [ ] Prefer semantic queries (`getByRole`, `getByLabelText`)
+- [ ] Use `queryBy*` for absence assertions
+- [ ] Use `findBy*` for async elements
+- [ ] `getByTestId` only as last resort
+
+### Async
+
+- [ ] All async tests use `async/await`
+- [ ] `waitFor` wraps async assertions
+- [ ] Fake timers properly setup/teardown
+- [ ] No floating promises
+
+### TypeScript
+
+- [ ] No `any` types without justification
+- [ ] Mock data uses actual types from source
+- [ ] Factory functions have proper return types
+
+## Coverage Goals (Per File)
+
+For the current file being tested:
+
+- [ ] 100% function coverage
+- [ ] 100% statement coverage
+- [ ] >95% branch coverage
+- [ ] >95% line coverage
+
+## Post-Generation (Per File)
+
+**Run these checks after EACH test file, not just at the end:**
+
+- [ ] Run `pnpm test -- path/to/file.spec.tsx` - **MUST PASS before next file**
+- [ ] Fix any failures immediately
+- [ ] Mark file as complete in todo list
+- [ ] Only then proceed to next file
+
+### After All Files Complete
+
+- [ ] Run full directory test: `pnpm test -- path/to/directory/`
+- [ ] Check coverage report: `pnpm test -- --coverage`
+- [ ] Run `pnpm lint:fix` on all test files
+- [ ] Run `pnpm type-check:tsgo`
+
+## Common Issues to Watch
+
+### False Positives
+
+```typescript
+// ❌ Mock doesn't match actual behavior
+jest.mock('./Component', () => () => <div>Mocked</div>)
+
+// ✅ Mock matches actual conditional logic
+jest.mock('./Component', () => ({ isOpen }: any) =>
+  isOpen ? <div>Content</div> : null
+)
+```
+
+### State Leakage
+
+```typescript
+// ❌ Shared state not reset
+let mockState = false
+jest.mock('./useHook', () => () => mockState)
+
+// ✅ Reset in beforeEach
+beforeEach(() => {
+  mockState = false
+})
+```
+
+### Async Race Conditions
+
+```typescript
+// ❌ Not awaited
+it('loads data', () => {
+  render(<Component />)
+  expect(screen.getByText('Data')).toBeInTheDocument()
+})
+
+// ✅ Properly awaited
+it('loads data', async () => {
+  render(<Component />)
+  await waitFor(() => {
+    expect(screen.getByText('Data')).toBeInTheDocument()
+  })
+})
+```
+
+### Missing Edge Cases
+
+Always test these scenarios:
+
+- `null` / `undefined` inputs
+- Empty strings / arrays / objects
+- Boundary values (0, -1, MAX_INT)
+- Error states
+- Loading states
+- Disabled states
+
+## Quick Commands
+
+```bash
+# Run specific test
+pnpm test -- path/to/file.spec.tsx
+
+# Run with coverage
+pnpm test -- --coverage path/to/file.spec.tsx
+
+# Watch mode
+pnpm test -- --watch path/to/file.spec.tsx
+
+# Update snapshots (use sparingly)
+pnpm test -- -u path/to/file.spec.tsx
+
+# Analyze component
+pnpm analyze-component path/to/component.tsx
+
+# Review existing test
+pnpm analyze-component path/to/component.tsx --review
+```

.claude/skills/frontend-testing/SKILL.md

@@ -0,0 +1,321 @@
+---
+name: Dify Frontend Testing
+description: Generate Jest + React Testing Library tests for Dify frontend components, hooks, and utilities. Triggers on testing, spec files, coverage, Jest, RTL, unit tests, integration tests, or write/review test requests.
+---
+
+# Dify Frontend Testing Skill
+
+This skill enables Claude to generate high-quality, comprehensive frontend tests for the Dify project following established conventions and best practices.
+
+> **⚠️ Authoritative Source**: This skill is derived from `web/testing/testing.md`. When in doubt, always refer to that document as the canonical specification.
+
+## When to Apply This Skill
+
+Apply this skill when the user:
+
+- Asks to **write tests** for a component, hook, or utility
+- Asks to **review existing tests** for completeness
+- Mentions **Jest**, **React Testing Library**, **RTL**, or **spec files**
+- Requests **test coverage** improvement
+- Uses `pnpm analyze-component` output as context
+- Mentions **testing**, **unit tests**, or **integration tests** for frontend code
+- Wants to understand **testing patterns** in the Dify codebase
+
+**Do NOT apply** when:
+
+- User is asking about backend/API tests (Python/pytest)
+- User is asking about E2E tests (Playwright/Cypress)
+- User is only asking conceptual questions without code context
+
+## Quick Reference
+
+### Tech Stack
+
+| Tool | Version | Purpose |
+|------|---------|---------|
+| Jest | 29.7 | Test runner |
+| React Testing Library | 16.0 | Component testing |
+| happy-dom | - | Test environment |
+| nock | 14.0 | HTTP mocking |
+| TypeScript | 5.x | Type safety |
+
+### Key Commands
+
+```bash
+# Run all tests
+pnpm test
+
+# Watch mode
+pnpm test -- --watch
+
+# Run specific file
+pnpm test -- path/to/file.spec.tsx
+
+# Generate coverage report
+pnpm test -- --coverage
+
+# Analyze component complexity
+pnpm analyze-component <path>
+
+# Review existing test
+pnpm analyze-component <path> --review
+```
+
+### File Naming
+
+- Test files: `ComponentName.spec.tsx` (same directory as component)
+- Integration tests: `web/__tests__/` directory
+
+## Test Structure Template
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import Component from './index'
+
+// ✅ Import real project components (DO NOT mock these)
+// import Loading from '@/app/components/base/loading'
+// import { ChildComponent } from './child-component'
+
+// ✅ Mock external dependencies only
+jest.mock('@/service/api')
+jest.mock('next/navigation', () => ({
+  useRouter: () => ({ push: jest.fn() }),
+  usePathname: () => '/test',
+}))
+
+// Shared state for mocks (if needed)
+let mockSharedState = false
+
+describe('ComponentName', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()  // ✅ Reset mocks BEFORE each test
+    mockSharedState = false  // ✅ Reset shared state
+  })
+
+  // Rendering tests (REQUIRED)
+  describe('Rendering', () => {
+    it('should render without crashing', () => {
+      // Arrange
+      const props = { title: 'Test' }
+      
+      // Act
+      render(<Component {...props} />)
+      
+      // Assert
+      expect(screen.getByText('Test')).toBeInTheDocument()
+    })
+  })
+
+  // Props tests (REQUIRED)
+  describe('Props', () => {
+    it('should apply custom className', () => {
+      render(<Component className="custom" />)
+      expect(screen.getByRole('button')).toHaveClass('custom')
+    })
+  })
+
+  // User Interactions
+  describe('User Interactions', () => {
+    it('should handle click events', () => {
+      const handleClick = jest.fn()
+      render(<Component onClick={handleClick} />)
+      
+      fireEvent.click(screen.getByRole('button'))
+      
+      expect(handleClick).toHaveBeenCalledTimes(1)
+    })
+  })
+
+  // Edge Cases (REQUIRED)
+  describe('Edge Cases', () => {
+    it('should handle null data', () => {
+      render(<Component data={null} />)
+      expect(screen.getByText(/no data/i)).toBeInTheDocument()
+    })
+
+    it('should handle empty array', () => {
+      render(<Component items={[]} />)
+      expect(screen.getByText(/empty/i)).toBeInTheDocument()
+    })
+  })
+})
+```
+
+## Testing Workflow (CRITICAL)
+
+### ⚠️ Incremental Approach Required
+
+**NEVER generate all test files at once.** For complex components or multi-file directories:
+
+1. **Analyze & Plan**: List all files, order by complexity (simple → complex)
+1. **Process ONE at a time**: Write test → Run test → Fix if needed → Next
+1. **Verify before proceeding**: Do NOT continue to next file until current passes
+
+```
+For each file:
+  ┌────────────────────────────────────────┐
+  │ 1. Write test                          │
+  │ 2. Run: pnpm test -- <file>.spec.tsx   │
+  │ 3. PASS? → Mark complete, next file    │
+  │    FAIL? → Fix first, then continue    │
+  └────────────────────────────────────────┘
+```
+
+### Complexity-Based Order
+
+Process in this order for multi-file testing:
+
+1. 🟢 Utility functions (simplest)
+1. 🟢 Custom hooks
+1. 🟡 Simple components (presentational)
+1. 🟡 Medium components (state, effects)
+1. 🔴 Complex components (API, routing)
+1. 🔴 Integration tests (index files - last)
+
+### When to Refactor First
+
+- **Complexity > 50**: Break into smaller pieces before testing
+- **500+ lines**: Consider splitting before testing
+- **Many dependencies**: Extract logic into hooks first
+
+> 📖 See `guides/workflow.md` for complete workflow details and todo list format.
+
+## Testing Strategy
+
+### Path-Level Testing (Directory Testing)
+
+When assigned to test a directory/path, test **ALL content** within that path:
+
+- Test all components, hooks, utilities in the directory (not just `index` file)
+- Use incremental approach: one file at a time, verify each before proceeding
+- Goal: 100% coverage of ALL files in the directory
+
+### Integration Testing First
+
+**Prefer integration testing** when writing tests for a directory:
+
+- ✅ **Import real project components** directly (including base components and siblings)
+- ✅ **Only mock**: API services (`@/service/*`), `next/navigation`, complex context providers
+- ❌ **DO NOT mock** base components (`@/app/components/base/*`)
+- ❌ **DO NOT mock** sibling/child components in the same directory
+
+> See [Test Structure Template](#test-structure-template) for correct import/mock patterns.
+
+## Core Principles
+
+### 1. AAA Pattern (Arrange-Act-Assert)
+
+Every test should clearly separate:
+
+- **Arrange**: Setup test data and render component
+- **Act**: Perform user actions
+- **Assert**: Verify expected outcomes
+
+### 2. Black-Box Testing
+
+- Test observable behavior, not implementation details
+- Use semantic queries (getByRole, getByLabelText)
+- Avoid testing internal state directly
+- **Prefer pattern matching over hardcoded strings** in assertions:
+
+```typescript
+// ❌ Avoid: hardcoded text assertions
+expect(screen.getByText('Loading...')).toBeInTheDocument()
+
+// ✅ Better: role-based queries
+expect(screen.getByRole('status')).toBeInTheDocument()
+
+// ✅ Better: pattern matching
+expect(screen.getByText(/loading/i)).toBeInTheDocument()
+```
+
+### 3. Single Behavior Per Test
+
+Each test verifies ONE user-observable behavior:
+
+```typescript
+// ✅ Good: One behavior
+it('should disable button when loading', () => {
+  render(<Button loading />)
+  expect(screen.getByRole('button')).toBeDisabled()
+})
+
+// ❌ Bad: Multiple behaviors
+it('should handle loading state', () => {
+  render(<Button loading />)
+  expect(screen.getByRole('button')).toBeDisabled()
+  expect(screen.getByText('Loading...')).toBeInTheDocument()
+  expect(screen.getByRole('button')).toHaveClass('loading')
+})
+```
+
+### 4. Semantic Naming
+
+Use `should <behavior> when <condition>`:
+
+```typescript
+it('should show error message when validation fails')
+it('should call onSubmit when form is valid')
+it('should disable input when isReadOnly is true')
+```
+
+## Required Test Scenarios
+
+### Always Required (All Components)
+
+1. **Rendering**: Component renders without crashing
+1. **Props**: Required props, optional props, default values
+1. **Edge Cases**: null, undefined, empty values, boundary conditions
+
+### Conditional (When Present)
+
+| Feature | Test Focus |
+|---------|-----------|
+| `useState` | Initial state, transitions, cleanup |
+| `useEffect` | Execution, dependencies, cleanup |
+| Event handlers | All onClick, onChange, onSubmit, keyboard |
+| API calls | Loading, success, error states |
+| Routing | Navigation, params, query strings |
+| `useCallback`/`useMemo` | Referential equality |
+| Context | Provider values, consumer behavior |
+| Forms | Validation, submission, error display |
+
+## Coverage Goals (Per File)
+
+For each test file generated, aim for:
+
+- ✅ **100%** function coverage
+- ✅ **100%** statement coverage
+- ✅ **>95%** branch coverage
+- ✅ **>95%** line coverage
+
+> **Note**: For multi-file directories, process one file at a time with full coverage each. See `guides/workflow.md`.
+
+## Detailed Guides
+
+For more detailed information, refer to:
+
+- `guides/workflow.md` - **Incremental testing workflow** (MUST READ for multi-file testing)
+- `guides/mocking.md` - Mock patterns and best practices
+- `guides/async-testing.md` - Async operations and API calls
+- `guides/domain-components.md` - Workflow, Dataset, Configuration testing
+- `guides/common-patterns.md` - Frequently used testing patterns
+
+## Authoritative References
+
+### Primary Specification (MUST follow)
+
+- **`web/testing/testing.md`** - The canonical testing specification. This skill is derived from this document.
+
+### Reference Examples in Codebase
+
+- `web/utils/classnames.spec.ts` - Utility function tests
+- `web/app/components/base/button/index.spec.tsx` - Component tests
+- `web/__mocks__/provider-context.ts` - Mock factory example
+
+### Project Configuration
+
+- `web/jest.config.ts` - Jest configuration
+- `web/jest.setup.ts` - Test environment setup
+- `web/testing/analyze-component.js` - Component analysis tool
+- `web/__mocks__/react-i18next.ts` - Shared i18n mock (auto-loaded by Jest, no explicit mock needed; override locally only for custom translations)

.claude/skills/frontend-testing/guides/async-testing.md

@@ -0,0 +1,345 @@
+# Async Testing Guide
+
+## Core Async Patterns
+
+### 1. waitFor - Wait for Condition
+
+```typescript
+import { render, screen, waitFor } from '@testing-library/react'
+
+it('should load and display data', async () => {
+  render(<DataComponent />)
+  
+  // Wait for element to appear
+  await waitFor(() => {
+    expect(screen.getByText('Loaded Data')).toBeInTheDocument()
+  })
+})
+
+it('should hide loading spinner after load', async () => {
+  render(<DataComponent />)
+  
+  // Wait for element to disappear
+  await waitFor(() => {
+    expect(screen.queryByText('Loading...')).not.toBeInTheDocument()
+  })
+})
+```
+
+### 2. findBy\* - Async Queries
+
+```typescript
+it('should show user name after fetch', async () => {
+  render(<UserProfile />)
+  
+  // findBy returns a promise, auto-waits up to 1000ms
+  const userName = await screen.findByText('John Doe')
+  expect(userName).toBeInTheDocument()
+  
+  // findByRole with options
+  const button = await screen.findByRole('button', { name: /submit/i })
+  expect(button).toBeEnabled()
+})
+```
+
+### 3. userEvent for Async Interactions
+
+```typescript
+import userEvent from '@testing-library/user-event'
+
+it('should submit form', async () => {
+  const user = userEvent.setup()
+  const onSubmit = jest.fn()
+  
+  render(<Form onSubmit={onSubmit} />)
+  
+  // userEvent methods are async
+  await user.type(screen.getByLabelText('Email'), 'test@example.com')
+  await user.click(screen.getByRole('button', { name: /submit/i }))
+  
+  await waitFor(() => {
+    expect(onSubmit).toHaveBeenCalledWith({ email: 'test@example.com' })
+  })
+})
+```
+
+## Fake Timers
+
+### When to Use Fake Timers
+
+- Testing components with `setTimeout`/`setInterval`
+- Testing debounce/throttle behavior
+- Testing animations or delayed transitions
+- Testing polling or retry logic
+
+### Basic Fake Timer Setup
+
+```typescript
+describe('Debounced Search', () => {
+  beforeEach(() => {
+    jest.useFakeTimers()
+  })
+
+  afterEach(() => {
+    jest.useRealTimers()
+  })
+
+  it('should debounce search input', async () => {
+    const onSearch = jest.fn()
+    render(<SearchInput onSearch={onSearch} debounceMs={300} />)
+    
+    // Type in the input
+    fireEvent.change(screen.getByRole('textbox'), { target: { value: 'query' } })
+    
+    // Search not called immediately
+    expect(onSearch).not.toHaveBeenCalled()
+    
+    // Advance timers
+    jest.advanceTimersByTime(300)
+    
+    // Now search is called
+    expect(onSearch).toHaveBeenCalledWith('query')
+  })
+})
+```
+
+### Fake Timers with Async Code
+
+```typescript
+it('should retry on failure', async () => {
+  jest.useFakeTimers()
+  const fetchData = jest.fn()
+    .mockRejectedValueOnce(new Error('Network error'))
+    .mockResolvedValueOnce({ data: 'success' })
+  
+  render(<RetryComponent fetchData={fetchData} retryDelayMs={1000} />)
+  
+  // First call fails
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledTimes(1)
+  })
+  
+  // Advance timer for retry
+  jest.advanceTimersByTime(1000)
+  
+  // Second call succeeds
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledTimes(2)
+    expect(screen.getByText('success')).toBeInTheDocument()
+  })
+  
+  jest.useRealTimers()
+})
+```
+
+### Common Fake Timer Utilities
+
+```typescript
+// Run all pending timers
+jest.runAllTimers()
+
+// Run only pending timers (not new ones created during execution)
+jest.runOnlyPendingTimers()
+
+// Advance by specific time
+jest.advanceTimersByTime(1000)
+
+// Get current fake time
+jest.now()
+
+// Clear all timers
+jest.clearAllTimers()
+```
+
+## API Testing Patterns
+
+### Loading → Success → Error States
+
+```typescript
+describe('DataFetcher', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()
+  })
+
+  it('should show loading state', () => {
+    mockedApi.fetchData.mockImplementation(() => new Promise(() => {})) // Never resolves
+    
+    render(<DataFetcher />)
+    
+    expect(screen.getByTestId('loading-spinner')).toBeInTheDocument()
+  })
+
+  it('should show data on success', async () => {
+    mockedApi.fetchData.mockResolvedValue({ items: ['Item 1', 'Item 2'] })
+    
+    render(<DataFetcher />)
+    
+    // Use findBy* for multiple async elements (better error messages than waitFor with multiple assertions)
+    const item1 = await screen.findByText('Item 1')
+    const item2 = await screen.findByText('Item 2')
+    expect(item1).toBeInTheDocument()
+    expect(item2).toBeInTheDocument()
+    
+    expect(screen.queryByTestId('loading-spinner')).not.toBeInTheDocument()
+  })
+
+  it('should show error on failure', async () => {
+    mockedApi.fetchData.mockRejectedValue(new Error('Failed to fetch'))
+    
+    render(<DataFetcher />)
+    
+    await waitFor(() => {
+      expect(screen.getByText(/failed to fetch/i)).toBeInTheDocument()
+    })
+  })
+
+  it('should retry on error', async () => {
+    mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+    
+    render(<DataFetcher />)
+    
+    await waitFor(() => {
+      expect(screen.getByRole('button', { name: /retry/i })).toBeInTheDocument()
+    })
+    
+    mockedApi.fetchData.mockResolvedValue({ items: ['Item 1'] })
+    fireEvent.click(screen.getByRole('button', { name: /retry/i }))
+    
+    await waitFor(() => {
+      expect(screen.getByText('Item 1')).toBeInTheDocument()
+    })
+  })
+})
+```
+
+### Testing Mutations
+
+```typescript
+it('should submit form and show success', async () => {
+  const user = userEvent.setup()
+  mockedApi.createItem.mockResolvedValue({ id: '1', name: 'New Item' })
+  
+  render(<CreateItemForm />)
+  
+  await user.type(screen.getByLabelText('Name'), 'New Item')
+  await user.click(screen.getByRole('button', { name: /create/i }))
+  
+  // Button should be disabled during submission
+  expect(screen.getByRole('button', { name: /creating/i })).toBeDisabled()
+  
+  await waitFor(() => {
+    expect(screen.getByText(/created successfully/i)).toBeInTheDocument()
+  })
+  
+  expect(mockedApi.createItem).toHaveBeenCalledWith({ name: 'New Item' })
+})
+```
+
+## useEffect Testing
+
+### Testing Effect Execution
+
+```typescript
+it('should fetch data on mount', async () => {
+  const fetchData = jest.fn().mockResolvedValue({ data: 'test' })
+  
+  render(<ComponentWithEffect fetchData={fetchData} />)
+  
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledTimes(1)
+  })
+})
+```
+
+### Testing Effect Dependencies
+
+```typescript
+it('should refetch when id changes', async () => {
+  const fetchData = jest.fn().mockResolvedValue({ data: 'test' })
+  
+  const { rerender } = render(<ComponentWithEffect id="1" fetchData={fetchData} />)
+  
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledWith('1')
+  })
+  
+  rerender(<ComponentWithEffect id="2" fetchData={fetchData} />)
+  
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledWith('2')
+    expect(fetchData).toHaveBeenCalledTimes(2)
+  })
+})
+```
+
+### Testing Effect Cleanup
+
+```typescript
+it('should cleanup subscription on unmount', () => {
+  const subscribe = jest.fn()
+  const unsubscribe = jest.fn()
+  subscribe.mockReturnValue(unsubscribe)
+  
+  const { unmount } = render(<SubscriptionComponent subscribe={subscribe} />)
+  
+  expect(subscribe).toHaveBeenCalledTimes(1)
+  
+  unmount()
+  
+  expect(unsubscribe).toHaveBeenCalledTimes(1)
+})
+```
+
+## Common Async Pitfalls
+
+### ❌ Don't: Forget to await
+
+```typescript
+// Bad - test may pass even if assertion fails
+it('should load data', () => {
+  render(<Component />)
+  waitFor(() => {
+    expect(screen.getByText('Data')).toBeInTheDocument()
+  })
+})
+
+// Good - properly awaited
+it('should load data', async () => {
+  render(<Component />)
+  await waitFor(() => {
+    expect(screen.getByText('Data')).toBeInTheDocument()
+  })
+})
+```
+
+### ❌ Don't: Use multiple assertions in single waitFor
+
+```typescript
+// Bad - if first assertion fails, won't know about second
+await waitFor(() => {
+  expect(screen.getByText('Title')).toBeInTheDocument()
+  expect(screen.getByText('Description')).toBeInTheDocument()
+})
+
+// Good - separate waitFor or use findBy
+const title = await screen.findByText('Title')
+const description = await screen.findByText('Description')
+expect(title).toBeInTheDocument()
+expect(description).toBeInTheDocument()
+```
+
+### ❌ Don't: Mix fake timers with real async
+
+```typescript
+// Bad - fake timers don't work well with real Promises
+jest.useFakeTimers()
+await waitFor(() => {
+  expect(screen.getByText('Data')).toBeInTheDocument()
+}) // May timeout!
+
+// Good - use runAllTimers or advanceTimersByTime
+jest.useFakeTimers()
+render(<Component />)
+jest.runAllTimers()
+expect(screen.getByText('Data')).toBeInTheDocument()
+```

.claude/skills/frontend-testing/guides/common-patterns.md

@@ -0,0 +1,449 @@
+# Common Testing Patterns
+
+## Query Priority
+
+Use queries in this order (most to least preferred):
+
+```typescript
+// 1. getByRole - Most recommended (accessibility)
+screen.getByRole('button', { name: /submit/i })
+screen.getByRole('textbox', { name: /email/i })
+screen.getByRole('heading', { level: 1 })
+
+// 2. getByLabelText - Form fields
+screen.getByLabelText('Email address')
+screen.getByLabelText(/password/i)
+
+// 3. getByPlaceholderText - When no label
+screen.getByPlaceholderText('Search...')
+
+// 4. getByText - Non-interactive elements
+screen.getByText('Welcome to Dify')
+screen.getByText(/loading/i)
+
+// 5. getByDisplayValue - Current input value
+screen.getByDisplayValue('current value')
+
+// 6. getByAltText - Images
+screen.getByAltText('Company logo')
+
+// 7. getByTitle - Tooltip elements
+screen.getByTitle('Close')
+
+// 8. getByTestId - Last resort only!
+screen.getByTestId('custom-element')
+```
+
+## Event Handling Patterns
+
+### Click Events
+
+```typescript
+// Basic click
+fireEvent.click(screen.getByRole('button'))
+
+// With userEvent (preferred for realistic interaction)
+const user = userEvent.setup()
+await user.click(screen.getByRole('button'))
+
+// Double click
+await user.dblClick(screen.getByRole('button'))
+
+// Right click
+await user.pointer({ keys: '[MouseRight]', target: screen.getByRole('button') })
+```
+
+### Form Input
+
+```typescript
+const user = userEvent.setup()
+
+// Type in input
+await user.type(screen.getByRole('textbox'), 'Hello World')
+
+// Clear and type
+await user.clear(screen.getByRole('textbox'))
+await user.type(screen.getByRole('textbox'), 'New value')
+
+// Select option
+await user.selectOptions(screen.getByRole('combobox'), 'option-value')
+
+// Check checkbox
+await user.click(screen.getByRole('checkbox'))
+
+// Upload file
+const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+await user.upload(screen.getByLabelText(/upload/i), file)
+```
+
+### Keyboard Events
+
+```typescript
+const user = userEvent.setup()
+
+// Press Enter
+await user.keyboard('{Enter}')
+
+// Press Escape
+await user.keyboard('{Escape}')
+
+// Keyboard shortcut
+await user.keyboard('{Control>}a{/Control}') // Ctrl+A
+
+// Tab navigation
+await user.tab()
+
+// Arrow keys
+await user.keyboard('{ArrowDown}')
+await user.keyboard('{ArrowUp}')
+```
+
+## Component State Testing
+
+### Testing State Transitions
+
+```typescript
+describe('Counter', () => {
+  it('should increment count', async () => {
+    const user = userEvent.setup()
+    render(<Counter initialCount={0} />)
+    
+    // Initial state
+    expect(screen.getByText('Count: 0')).toBeInTheDocument()
+    
+    // Trigger transition
+    await user.click(screen.getByRole('button', { name: /increment/i }))
+    
+    // New state
+    expect(screen.getByText('Count: 1')).toBeInTheDocument()
+  })
+})
+```
+
+### Testing Controlled Components
+
+```typescript
+describe('ControlledInput', () => {
+  it('should call onChange with new value', async () => {
+    const user = userEvent.setup()
+    const handleChange = jest.fn()
+    
+    render(<ControlledInput value="" onChange={handleChange} />)
+    
+    await user.type(screen.getByRole('textbox'), 'a')
+    
+    expect(handleChange).toHaveBeenCalledWith('a')
+  })
+
+  it('should display controlled value', () => {
+    render(<ControlledInput value="controlled" onChange={jest.fn()} />)
+    
+    expect(screen.getByRole('textbox')).toHaveValue('controlled')
+  })
+})
+```
+
+## Conditional Rendering Testing
+
+```typescript
+describe('ConditionalComponent', () => {
+  it('should show loading state', () => {
+    render(<DataDisplay isLoading={true} data={null} />)
+    
+    expect(screen.getByText(/loading/i)).toBeInTheDocument()
+    expect(screen.queryByTestId('data-content')).not.toBeInTheDocument()
+  })
+
+  it('should show error state', () => {
+    render(<DataDisplay isLoading={false} data={null} error="Failed to load" />)
+    
+    expect(screen.getByText(/failed to load/i)).toBeInTheDocument()
+  })
+
+  it('should show data when loaded', () => {
+    render(<DataDisplay isLoading={false} data={{ name: 'Test' }} />)
+    
+    expect(screen.getByText('Test')).toBeInTheDocument()
+  })
+
+  it('should show empty state when no data', () => {
+    render(<DataDisplay isLoading={false} data={[]} />)
+    
+    expect(screen.getByText(/no data/i)).toBeInTheDocument()
+  })
+})
+```
+
+## List Rendering Testing
+
+```typescript
+describe('ItemList', () => {
+  const items = [
+    { id: '1', name: 'Item 1' },
+    { id: '2', name: 'Item 2' },
+    { id: '3', name: 'Item 3' },
+  ]
+
+  it('should render all items', () => {
+    render(<ItemList items={items} />)
+    
+    expect(screen.getAllByRole('listitem')).toHaveLength(3)
+    items.forEach(item => {
+      expect(screen.getByText(item.name)).toBeInTheDocument()
+    })
+  })
+
+  it('should handle item selection', async () => {
+    const user = userEvent.setup()
+    const onSelect = jest.fn()
+    
+    render(<ItemList items={items} onSelect={onSelect} />)
+    
+    await user.click(screen.getByText('Item 2'))
+    
+    expect(onSelect).toHaveBeenCalledWith(items[1])
+  })
+
+  it('should handle empty list', () => {
+    render(<ItemList items={[]} />)
+    
+    expect(screen.getByText(/no items/i)).toBeInTheDocument()
+  })
+})
+```
+
+## Modal/Dialog Testing
+
+```typescript
+describe('Modal', () => {
+  it('should not render when closed', () => {
+    render(<Modal isOpen={false} onClose={jest.fn()} />)
+    
+    expect(screen.queryByRole('dialog')).not.toBeInTheDocument()
+  })
+
+  it('should render when open', () => {
+    render(<Modal isOpen={true} onClose={jest.fn()} />)
+    
+    expect(screen.getByRole('dialog')).toBeInTheDocument()
+  })
+
+  it('should call onClose when clicking overlay', async () => {
+    const user = userEvent.setup()
+    const handleClose = jest.fn()
+    
+    render(<Modal isOpen={true} onClose={handleClose} />)
+    
+    await user.click(screen.getByTestId('modal-overlay'))
+    
+    expect(handleClose).toHaveBeenCalled()
+  })
+
+  it('should call onClose when pressing Escape', async () => {
+    const user = userEvent.setup()
+    const handleClose = jest.fn()
+    
+    render(<Modal isOpen={true} onClose={handleClose} />)
+    
+    await user.keyboard('{Escape}')
+    
+    expect(handleClose).toHaveBeenCalled()
+  })
+
+  it('should trap focus inside modal', async () => {
+    const user = userEvent.setup()
+    
+    render(
+      <Modal isOpen={true} onClose={jest.fn()}>
+        <button>First</button>
+        <button>Second</button>
+      </Modal>
+    )
+    
+    // Focus should cycle within modal
+    await user.tab()
+    expect(screen.getByText('First')).toHaveFocus()
+    
+    await user.tab()
+    expect(screen.getByText('Second')).toHaveFocus()
+    
+    await user.tab()
+    expect(screen.getByText('First')).toHaveFocus() // Cycles back
+  })
+})
+```
+
+## Form Testing
+
+```typescript
+describe('LoginForm', () => {
+  it('should submit valid form', async () => {
+    const user = userEvent.setup()
+    const onSubmit = jest.fn()
+    
+    render(<LoginForm onSubmit={onSubmit} />)
+    
+    await user.type(screen.getByLabelText(/email/i), 'test@example.com')
+    await user.type(screen.getByLabelText(/password/i), 'password123')
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(onSubmit).toHaveBeenCalledWith({
+      email: 'test@example.com',
+      password: 'password123',
+    })
+  })
+
+  it('should show validation errors', async () => {
+    const user = userEvent.setup()
+    
+    render(<LoginForm onSubmit={jest.fn()} />)
+    
+    // Submit empty form
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(screen.getByText(/email is required/i)).toBeInTheDocument()
+    expect(screen.getByText(/password is required/i)).toBeInTheDocument()
+  })
+
+  it('should validate email format', async () => {
+    const user = userEvent.setup()
+    
+    render(<LoginForm onSubmit={jest.fn()} />)
+    
+    await user.type(screen.getByLabelText(/email/i), 'invalid-email')
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(screen.getByText(/invalid email/i)).toBeInTheDocument()
+  })
+
+  it('should disable submit button while submitting', async () => {
+    const user = userEvent.setup()
+    const onSubmit = jest.fn(() => new Promise(resolve => setTimeout(resolve, 100)))
+    
+    render(<LoginForm onSubmit={onSubmit} />)
+    
+    await user.type(screen.getByLabelText(/email/i), 'test@example.com')
+    await user.type(screen.getByLabelText(/password/i), 'password123')
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(screen.getByRole('button', { name: /signing in/i })).toBeDisabled()
+    
+    await waitFor(() => {
+      expect(screen.getByRole('button', { name: /sign in/i })).toBeEnabled()
+    })
+  })
+})
+```
+
+## Data-Driven Tests with test.each
+
+```typescript
+describe('StatusBadge', () => {
+  test.each([
+    ['success', 'bg-green-500'],
+    ['warning', 'bg-yellow-500'],
+    ['error', 'bg-red-500'],
+    ['info', 'bg-blue-500'],
+  ])('should apply correct class for %s status', (status, expectedClass) => {
+    render(<StatusBadge status={status} />)
+    
+    expect(screen.getByTestId('status-badge')).toHaveClass(expectedClass)
+  })
+
+  test.each([
+    { input: null, expected: 'Unknown' },
+    { input: undefined, expected: 'Unknown' },
+    { input: '', expected: 'Unknown' },
+    { input: 'invalid', expected: 'Unknown' },
+  ])('should show "Unknown" for invalid input: $input', ({ input, expected }) => {
+    render(<StatusBadge status={input} />)
+    
+    expect(screen.getByText(expected)).toBeInTheDocument()
+  })
+})
+```
+
+## Debugging Tips
+
+```typescript
+// Print entire DOM
+screen.debug()
+
+// Print specific element
+screen.debug(screen.getByRole('button'))
+
+// Log testing playground URL
+screen.logTestingPlaygroundURL()
+
+// Pretty print DOM
+import { prettyDOM } from '@testing-library/react'
+console.log(prettyDOM(screen.getByRole('dialog')))
+
+// Check available roles
+import { getRoles } from '@testing-library/react'
+console.log(getRoles(container))
+```
+
+## Common Mistakes to Avoid
+
+### ❌ Don't Use Implementation Details
+
+```typescript
+// Bad - testing implementation
+expect(component.state.isOpen).toBe(true)
+expect(wrapper.find('.internal-class').length).toBe(1)
+
+// Good - testing behavior
+expect(screen.getByRole('dialog')).toBeInTheDocument()
+```
+
+### ❌ Don't Forget Cleanup
+
+```typescript
+// Bad - may leak state between tests
+it('test 1', () => {
+  render(<Component />)
+})
+
+// Good - cleanup is automatic with RTL, but reset mocks
+beforeEach(() => {
+  jest.clearAllMocks()
+})
+```
+
+### ❌ Don't Use Exact String Matching (Prefer Black-Box Assertions)
+
+```typescript
+// ❌ Bad - hardcoded strings are brittle
+expect(screen.getByText('Submit Form')).toBeInTheDocument()
+expect(screen.getByText('Loading...')).toBeInTheDocument()
+
+// ✅ Good - role-based queries (most semantic)
+expect(screen.getByRole('button', { name: /submit/i })).toBeInTheDocument()
+expect(screen.getByRole('status')).toBeInTheDocument()
+
+// ✅ Good - pattern matching (flexible)
+expect(screen.getByText(/submit/i)).toBeInTheDocument()
+expect(screen.getByText(/loading/i)).toBeInTheDocument()
+
+// ✅ Good - test behavior, not exact UI text
+expect(screen.getByRole('button')).toBeDisabled()
+expect(screen.getByRole('alert')).toBeInTheDocument()
+```
+
+**Why prefer black-box assertions?**
+
+- Text content may change (i18n, copy updates)
+- Role-based queries test accessibility
+- Pattern matching is resilient to minor changes
+- Tests focus on behavior, not implementation details
+
+### ❌ Don't Assert on Absence Without Query
+
+```typescript
+// Bad - throws if not found
+expect(screen.getByText('Error')).not.toBeInTheDocument() // Error!
+
+// Good - use queryBy for absence assertions
+expect(screen.queryByText('Error')).not.toBeInTheDocument()
+```

.claude/skills/frontend-testing/guides/domain-components.md

@@ -0,0 +1,523 @@
+# Domain-Specific Component Testing
+
+This guide covers testing patterns for Dify's domain-specific components.
+
+## Workflow Components (`workflow/`)
+
+Workflow components handle node configuration, data flow, and graph operations.
+
+### Key Test Areas
+
+1. **Node Configuration**
+1. **Data Validation**
+1. **Variable Passing**
+1. **Edge Connections**
+1. **Error Handling**
+
+### Example: Node Configuration Panel
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+import NodeConfigPanel from './node-config-panel'
+import { createMockNode, createMockWorkflowContext } from '@/__mocks__/workflow'
+
+// Mock workflow context
+jest.mock('@/app/components/workflow/hooks', () => ({
+  useWorkflowStore: () => mockWorkflowStore,
+  useNodesInteractions: () => mockNodesInteractions,
+}))
+
+let mockWorkflowStore = {
+  nodes: [],
+  edges: [],
+  updateNode: jest.fn(),
+}
+
+let mockNodesInteractions = {
+  handleNodeSelect: jest.fn(),
+  handleNodeDelete: jest.fn(),
+}
+
+describe('NodeConfigPanel', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()
+    mockWorkflowStore = {
+      nodes: [],
+      edges: [],
+      updateNode: jest.fn(),
+    }
+  })
+
+  describe('Node Configuration', () => {
+    it('should render node type selector', () => {
+      const node = createMockNode({ type: 'llm' })
+      render(<NodeConfigPanel node={node} />)
+      
+      expect(screen.getByLabelText(/model/i)).toBeInTheDocument()
+    })
+
+    it('should update node config on change', async () => {
+      const user = userEvent.setup()
+      const node = createMockNode({ type: 'llm' })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      await user.selectOptions(screen.getByLabelText(/model/i), 'gpt-4')
+      
+      expect(mockWorkflowStore.updateNode).toHaveBeenCalledWith(
+        node.id,
+        expect.objectContaining({ model: 'gpt-4' })
+      )
+    })
+  })
+
+  describe('Data Validation', () => {
+    it('should show error for invalid input', async () => {
+      const user = userEvent.setup()
+      const node = createMockNode({ type: 'code' })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      // Enter invalid code
+      const codeInput = screen.getByLabelText(/code/i)
+      await user.clear(codeInput)
+      await user.type(codeInput, 'invalid syntax {{{')
+      
+      await waitFor(() => {
+        expect(screen.getByText(/syntax error/i)).toBeInTheDocument()
+      })
+    })
+
+    it('should validate required fields', async () => {
+      const node = createMockNode({ type: 'http', data: { url: '' } })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      fireEvent.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText(/url is required/i)).toBeInTheDocument()
+      })
+    })
+  })
+
+  describe('Variable Passing', () => {
+    it('should display available variables from upstream nodes', () => {
+      const upstreamNode = createMockNode({
+        id: 'node-1',
+        type: 'start',
+        data: { outputs: [{ name: 'user_input', type: 'string' }] },
+      })
+      const currentNode = createMockNode({
+        id: 'node-2',
+        type: 'llm',
+      })
+      
+      mockWorkflowStore.nodes = [upstreamNode, currentNode]
+      mockWorkflowStore.edges = [{ source: 'node-1', target: 'node-2' }]
+      
+      render(<NodeConfigPanel node={currentNode} />)
+      
+      // Variable selector should show upstream variables
+      fireEvent.click(screen.getByRole('button', { name: /add variable/i }))
+      
+      expect(screen.getByText('user_input')).toBeInTheDocument()
+    })
+
+    it('should insert variable into prompt template', async () => {
+      const user = userEvent.setup()
+      const node = createMockNode({ type: 'llm' })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      // Click variable button
+      await user.click(screen.getByRole('button', { name: /insert variable/i }))
+      await user.click(screen.getByText('user_input'))
+      
+      const promptInput = screen.getByLabelText(/prompt/i)
+      expect(promptInput).toHaveValue(expect.stringContaining('{{user_input}}'))
+    })
+  })
+})
+```
+
+## Dataset Components (`dataset/`)
+
+Dataset components handle file uploads, data display, and search/filter operations.
+
+### Key Test Areas
+
+1. **File Upload**
+1. **File Type Validation**
+1. **Pagination**
+1. **Search & Filtering**
+1. **Data Format Handling**
+
+### Example: Document Uploader
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+import DocumentUploader from './document-uploader'
+
+jest.mock('@/service/datasets', () => ({
+  uploadDocument: jest.fn(),
+  parseDocument: jest.fn(),
+}))
+
+import * as datasetService from '@/service/datasets'
+const mockedService = datasetService as jest.Mocked<typeof datasetService>
+
+describe('DocumentUploader', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()
+  })
+
+  describe('File Upload', () => {
+    it('should accept valid file types', async () => {
+      const user = userEvent.setup()
+      const onUpload = jest.fn()
+      mockedService.uploadDocument.mockResolvedValue({ id: 'doc-1' })
+      
+      render(<DocumentUploader onUpload={onUpload} />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      const input = screen.getByLabelText(/upload/i)
+      
+      await user.upload(input, file)
+      
+      await waitFor(() => {
+        expect(mockedService.uploadDocument).toHaveBeenCalledWith(
+          expect.any(FormData)
+        )
+      })
+    })
+
+    it('should reject invalid file types', async () => {
+      const user = userEvent.setup()
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.exe', { type: 'application/x-msdownload' })
+      const input = screen.getByLabelText(/upload/i)
+      
+      await user.upload(input, file)
+      
+      expect(screen.getByText(/unsupported file type/i)).toBeInTheDocument()
+      expect(mockedService.uploadDocument).not.toHaveBeenCalled()
+    })
+
+    it('should show upload progress', async () => {
+      const user = userEvent.setup()
+      
+      // Mock upload with progress
+      mockedService.uploadDocument.mockImplementation(() => {
+        return new Promise((resolve) => {
+          setTimeout(() => resolve({ id: 'doc-1' }), 100)
+        })
+      })
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      await user.upload(screen.getByLabelText(/upload/i), file)
+      
+      expect(screen.getByRole('progressbar')).toBeInTheDocument()
+      
+      await waitFor(() => {
+        expect(screen.queryByRole('progressbar')).not.toBeInTheDocument()
+      })
+    })
+  })
+
+  describe('Error Handling', () => {
+    it('should handle upload failure', async () => {
+      const user = userEvent.setup()
+      mockedService.uploadDocument.mockRejectedValue(new Error('Upload failed'))
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      await user.upload(screen.getByLabelText(/upload/i), file)
+      
+      await waitFor(() => {
+        expect(screen.getByText(/upload failed/i)).toBeInTheDocument()
+      })
+    })
+
+    it('should allow retry after failure', async () => {
+      const user = userEvent.setup()
+      mockedService.uploadDocument
+        .mockRejectedValueOnce(new Error('Network error'))
+        .mockResolvedValueOnce({ id: 'doc-1' })
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      await user.upload(screen.getByLabelText(/upload/i), file)
+      
+      await waitFor(() => {
+        expect(screen.getByRole('button', { name: /retry/i })).toBeInTheDocument()
+      })
+      
+      await user.click(screen.getByRole('button', { name: /retry/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText(/uploaded successfully/i)).toBeInTheDocument()
+      })
+    })
+  })
+})
+```
+
+### Example: Document List with Pagination
+
+```typescript
+describe('DocumentList', () => {
+  describe('Pagination', () => {
+    it('should load first page on mount', async () => {
+      mockedService.getDocuments.mockResolvedValue({
+        data: [{ id: '1', name: 'Doc 1' }],
+        total: 50,
+        page: 1,
+        pageSize: 10,
+      })
+      
+      render(<DocumentList datasetId="ds-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByText('Doc 1')).toBeInTheDocument()
+      })
+      
+      expect(mockedService.getDocuments).toHaveBeenCalledWith('ds-1', { page: 1 })
+    })
+
+    it('should navigate to next page', async () => {
+      const user = userEvent.setup()
+      mockedService.getDocuments.mockResolvedValue({
+        data: [{ id: '1', name: 'Doc 1' }],
+        total: 50,
+        page: 1,
+        pageSize: 10,
+      })
+      
+      render(<DocumentList datasetId="ds-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByText('Doc 1')).toBeInTheDocument()
+      })
+      
+      mockedService.getDocuments.mockResolvedValue({
+        data: [{ id: '11', name: 'Doc 11' }],
+        total: 50,
+        page: 2,
+        pageSize: 10,
+      })
+      
+      await user.click(screen.getByRole('button', { name: /next/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText('Doc 11')).toBeInTheDocument()
+      })
+    })
+  })
+
+  describe('Search & Filtering', () => {
+    it('should filter by search query', async () => {
+      const user = userEvent.setup()
+      jest.useFakeTimers()
+      
+      render(<DocumentList datasetId="ds-1" />)
+      
+      await user.type(screen.getByPlaceholderText(/search/i), 'test query')
+      
+      // Debounce
+      jest.advanceTimersByTime(300)
+      
+      await waitFor(() => {
+        expect(mockedService.getDocuments).toHaveBeenCalledWith(
+          'ds-1',
+          expect.objectContaining({ search: 'test query' })
+        )
+      })
+      
+      jest.useRealTimers()
+    })
+  })
+})
+```
+
+## Configuration Components (`app/configuration/`, `config/`)
+
+Configuration components handle forms, validation, and data persistence.
+
+### Key Test Areas
+
+1. **Form Validation**
+1. **Save/Reset**
+1. **Required vs Optional Fields**
+1. **Configuration Persistence**
+1. **Error Feedback**
+
+### Example: App Configuration Form
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+import AppConfigForm from './app-config-form'
+
+jest.mock('@/service/apps', () => ({
+  updateAppConfig: jest.fn(),
+  getAppConfig: jest.fn(),
+}))
+
+import * as appService from '@/service/apps'
+const mockedService = appService as jest.Mocked<typeof appService>
+
+describe('AppConfigForm', () => {
+  const defaultConfig = {
+    name: 'My App',
+    description: '',
+    icon: 'default',
+    openingStatement: '',
+  }
+
+  beforeEach(() => {
+    jest.clearAllMocks()
+    mockedService.getAppConfig.mockResolvedValue(defaultConfig)
+  })
+
+  describe('Form Validation', () => {
+    it('should require app name', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Clear name field
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      expect(screen.getByText(/name is required/i)).toBeInTheDocument()
+      expect(mockedService.updateAppConfig).not.toHaveBeenCalled()
+    })
+
+    it('should validate name length', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toBeInTheDocument()
+      })
+      
+      // Enter very long name
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.type(screen.getByLabelText(/name/i), 'a'.repeat(101))
+      
+      expect(screen.getByText(/name must be less than 100 characters/i)).toBeInTheDocument()
+    })
+
+    it('should allow empty optional fields', async () => {
+      const user = userEvent.setup()
+      mockedService.updateAppConfig.mockResolvedValue({ success: true })
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Leave description empty (optional)
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(mockedService.updateAppConfig).toHaveBeenCalled()
+      })
+    })
+  })
+
+  describe('Save/Reset Functionality', () => {
+    it('should save configuration', async () => {
+      const user = userEvent.setup()
+      mockedService.updateAppConfig.mockResolvedValue({ success: true })
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.type(screen.getByLabelText(/name/i), 'Updated App')
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(mockedService.updateAppConfig).toHaveBeenCalledWith(
+          'app-1',
+          expect.objectContaining({ name: 'Updated App' })
+        )
+      })
+      
+      expect(screen.getByText(/saved successfully/i)).toBeInTheDocument()
+    })
+
+    it('should reset to default values', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Make changes
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.type(screen.getByLabelText(/name/i), 'Changed Name')
+      
+      // Reset
+      await user.click(screen.getByRole('button', { name: /reset/i }))
+      
+      expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+    })
+
+    it('should show unsaved changes warning', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Make changes
+      await user.type(screen.getByLabelText(/name/i), ' Updated')
+      
+      expect(screen.getByText(/unsaved changes/i)).toBeInTheDocument()
+    })
+  })
+
+  describe('Error Handling', () => {
+    it('should show error on save failure', async () => {
+      const user = userEvent.setup()
+      mockedService.updateAppConfig.mockRejectedValue(new Error('Server error'))
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText(/failed to save/i)).toBeInTheDocument()
+      })
+    })
+  })
+})
+```

.claude/skills/frontend-testing/guides/mocking.md

@@ -0,0 +1,363 @@
+# Mocking Guide for Dify Frontend Tests
+
+## ⚠️ Important: What NOT to Mock
+
+### DO NOT Mock Base Components
+
+**Never mock components from `@/app/components/base/`** such as:
+
+- `Loading`, `Spinner`
+- `Button`, `Input`, `Select`
+- `Tooltip`, `Modal`, `Dropdown`
+- `Icon`, `Badge`, `Tag`
+
+**Why?**
+
+- Base components will have their own dedicated tests
+- Mocking them creates false positives (tests pass but real integration fails)
+- Using real components tests actual integration behavior
+
+```typescript
+// ❌ WRONG: Don't mock base components
+jest.mock('@/app/components/base/loading', () => () => <div>Loading</div>)
+jest.mock('@/app/components/base/button', () => ({ children }: any) => <button>{children}</button>)
+
+// ✅ CORRECT: Import and use real base components
+import Loading from '@/app/components/base/loading'
+import Button from '@/app/components/base/button'
+// They will render normally in tests
+```
+
+### What TO Mock
+
+Only mock these categories:
+
+1. **API services** (`@/service/*`) - Network calls
+1. **Complex context providers** - When setup is too difficult
+1. **Third-party libraries with side effects** - `next/navigation`, external SDKs
+1. **i18n** - Always mock to return keys
+
+## Mock Placement
+
+| Location | Purpose |
+|----------|---------|
+| `web/__mocks__/` | Reusable mocks shared across multiple test files |
+| Test file | Test-specific mocks, inline with `jest.mock()` |
+
+## Essential Mocks
+
+### 1. i18n (Auto-loaded via Shared Mock)
+
+A shared mock is available at `web/__mocks__/react-i18next.ts` and is auto-loaded by Jest.
+**No explicit mock needed** for most tests - it returns translation keys as-is.
+
+For tests requiring custom translations, override the mock:
+
+```typescript
+jest.mock('react-i18next', () => ({
+  useTranslation: () => ({
+    t: (key: string) => {
+      const translations: Record<string, string> = {
+        'my.custom.key': 'Custom translation',
+      }
+      return translations[key] || key
+    },
+  }),
+}))
+```
+
+### 2. Next.js Router
+
+```typescript
+const mockPush = jest.fn()
+const mockReplace = jest.fn()
+
+jest.mock('next/navigation', () => ({
+  useRouter: () => ({
+    push: mockPush,
+    replace: mockReplace,
+    back: jest.fn(),
+    prefetch: jest.fn(),
+  }),
+  usePathname: () => '/current-path',
+  useSearchParams: () => new URLSearchParams('?key=value'),
+}))
+
+describe('Component', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()
+  })
+
+  it('should navigate on click', () => {
+    render(<Component />)
+    fireEvent.click(screen.getByRole('button'))
+    expect(mockPush).toHaveBeenCalledWith('/expected-path')
+  })
+})
+```
+
+### 3. Portal Components (with Shared State)
+
+```typescript
+// ⚠️ Important: Use shared state for components that depend on each other
+let mockPortalOpenState = false
+
+jest.mock('@/app/components/base/portal-to-follow-elem', () => ({
+  PortalToFollowElem: ({ children, open, ...props }: any) => {
+    mockPortalOpenState = open || false  // Update shared state
+    return <div data-testid="portal" data-open={open}>{children}</div>
+  },
+  PortalToFollowElemContent: ({ children }: any) => {
+    // ✅ Matches actual: returns null when portal is closed
+    if (!mockPortalOpenState) return null
+    return <div data-testid="portal-content">{children}</div>
+  },
+  PortalToFollowElemTrigger: ({ children }: any) => (
+    <div data-testid="portal-trigger">{children}</div>
+  ),
+}))
+
+describe('Component', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()
+    mockPortalOpenState = false  // ✅ Reset shared state
+  })
+})
+```
+
+### 4. API Service Mocks
+
+```typescript
+import * as api from '@/service/api'
+
+jest.mock('@/service/api')
+
+const mockedApi = api as jest.Mocked<typeof api>
+
+describe('Component', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()
+    
+    // Setup default mock implementation
+    mockedApi.fetchData.mockResolvedValue({ data: [] })
+  })
+
+  it('should show data on success', async () => {
+    mockedApi.fetchData.mockResolvedValue({ data: [{ id: 1 }] })
+    
+    render(<Component />)
+    
+    await waitFor(() => {
+      expect(screen.getByText('1')).toBeInTheDocument()
+    })
+  })
+
+  it('should show error on failure', async () => {
+    mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+    
+    render(<Component />)
+    
+    await waitFor(() => {
+      expect(screen.getByText(/error/i)).toBeInTheDocument()
+    })
+  })
+})
+```
+
+### 5. HTTP Mocking with Nock
+
+```typescript
+import nock from 'nock'
+
+const GITHUB_HOST = 'https://api.github.com'
+const GITHUB_PATH = '/repos/owner/repo'
+
+const mockGithubApi = (status: number, body: Record<string, unknown>, delayMs = 0) => {
+  return nock(GITHUB_HOST)
+    .get(GITHUB_PATH)
+    .delay(delayMs)
+    .reply(status, body)
+}
+
+describe('GithubComponent', () => {
+  afterEach(() => {
+    nock.cleanAll()
+  })
+
+  it('should display repo info', async () => {
+    mockGithubApi(200, { name: 'dify', stars: 1000 })
+    
+    render(<GithubComponent />)
+    
+    await waitFor(() => {
+      expect(screen.getByText('dify')).toBeInTheDocument()
+    })
+  })
+
+  it('should handle API error', async () => {
+    mockGithubApi(500, { message: 'Server error' })
+    
+    render(<GithubComponent />)
+    
+    await waitFor(() => {
+      expect(screen.getByText(/error/i)).toBeInTheDocument()
+    })
+  })
+})
+```
+
+### 6. Context Providers
+
+```typescript
+import { ProviderContext } from '@/context/provider-context'
+import { createMockProviderContextValue, createMockPlan } from '@/__mocks__/provider-context'
+
+describe('Component with Context', () => {
+  it('should render for free plan', () => {
+    const mockContext = createMockPlan('sandbox')
+    
+    render(
+      <ProviderContext.Provider value={mockContext}>
+        <Component />
+      </ProviderContext.Provider>
+    )
+    
+    expect(screen.getByText('Upgrade')).toBeInTheDocument()
+  })
+
+  it('should render for pro plan', () => {
+    const mockContext = createMockPlan('professional')
+    
+    render(
+      <ProviderContext.Provider value={mockContext}>
+        <Component />
+      </ProviderContext.Provider>
+    )
+    
+    expect(screen.queryByText('Upgrade')).not.toBeInTheDocument()
+  })
+})
+```
+
+### 7. SWR / React Query
+
+```typescript
+// SWR
+jest.mock('swr', () => ({
+  __esModule: true,
+  default: jest.fn(),
+}))
+
+import useSWR from 'swr'
+const mockedUseSWR = useSWR as jest.Mock
+
+describe('Component with SWR', () => {
+  it('should show loading state', () => {
+    mockedUseSWR.mockReturnValue({
+      data: undefined,
+      error: undefined,
+      isLoading: true,
+    })
+    
+    render(<Component />)
+    expect(screen.getByText(/loading/i)).toBeInTheDocument()
+  })
+})
+
+// React Query
+import { QueryClient, QueryClientProvider } from '@tanstack/react-query'
+
+const createTestQueryClient = () => new QueryClient({
+  defaultOptions: {
+    queries: { retry: false },
+    mutations: { retry: false },
+  },
+})
+
+const renderWithQueryClient = (ui: React.ReactElement) => {
+  const queryClient = createTestQueryClient()
+  return render(
+    <QueryClientProvider client={queryClient}>
+      {ui}
+    </QueryClientProvider>
+  )
+}
+```
+
+## Mock Best Practices
+
+### ✅ DO
+
+1. **Use real base components** - Import from `@/app/components/base/` directly
+1. **Use real project components** - Prefer importing over mocking
+1. **Reset mocks in `beforeEach`**, not `afterEach`
+1. **Match actual component behavior** in mocks (when mocking is necessary)
+1. **Use factory functions** for complex mock data
+1. **Import actual types** for type safety
+1. **Reset shared mock state** in `beforeEach`
+
+### ❌ DON'T
+
+1. **Don't mock base components** (`Loading`, `Button`, `Tooltip`, etc.)
+1. Don't mock components you can import directly
+1. Don't create overly simplified mocks that miss conditional logic
+1. Don't forget to clean up nock after each test
+1. Don't use `any` types in mocks without necessity
+
+### Mock Decision Tree
+
+```
+Need to use a component in test?
+│
+├─ Is it from @/app/components/base/*?
+│  └─ YES → Import real component, DO NOT mock
+│
+├─ Is it a project component?
+│  └─ YES → Prefer importing real component
+│           Only mock if setup is extremely complex
+│
+├─ Is it an API service (@/service/*)?
+│  └─ YES → Mock it
+│
+├─ Is it a third-party lib with side effects?
+│  └─ YES → Mock it (next/navigation, external SDKs)
+│
+└─ Is it i18n?
+   └─ YES → Uses shared mock (auto-loaded). Override only for custom translations
+```
+
+## Factory Function Pattern
+
+```typescript
+// __mocks__/data-factories.ts
+import type { User, Project } from '@/types'
+
+export const createMockUser = (overrides: Partial<User> = {}): User => ({
+  id: 'user-1',
+  name: 'Test User',
+  email: 'test@example.com',
+  role: 'member',
+  createdAt: new Date().toISOString(),
+  ...overrides,
+})
+
+export const createMockProject = (overrides: Partial<Project> = {}): Project => ({
+  id: 'project-1',
+  name: 'Test Project',
+  description: 'A test project',
+  owner: createMockUser(),
+  members: [],
+  createdAt: new Date().toISOString(),
+  ...overrides,
+})
+
+// Usage in tests
+it('should display project owner', () => {
+  const project = createMockProject({
+    owner: createMockUser({ name: 'John Doe' }),
+  })
+  
+  render(<ProjectCard project={project} />)
+  expect(screen.getByText('John Doe')).toBeInTheDocument()
+})
+```

.claude/skills/frontend-testing/guides/workflow.md

@@ -0,0 +1,269 @@
+# Testing Workflow Guide
+
+This guide defines the workflow for generating tests, especially for complex components or directories with multiple files.
+
+## Scope Clarification
+
+This guide addresses **multi-file workflow** (how to process multiple test files). For coverage requirements within a single test file, see `web/testing/testing.md` § Coverage Goals.
+
+| Scope | Rule |
+|-------|------|
+| **Single file** | Complete coverage in one generation (100% function, >95% branch) |
+| **Multi-file directory** | Process one file at a time, verify each before proceeding |
+
+## ⚠️ Critical Rule: Incremental Approach for Multi-File Testing
+
+When testing a **directory with multiple files**, **NEVER generate all test files at once.** Use an incremental, verify-as-you-go approach.
+
+### Why Incremental?
+
+| Batch Approach (❌) | Incremental Approach (✅) |
+|---------------------|---------------------------|
+| Generate 5+ tests at once | Generate 1 test at a time |
+| Run tests only at the end | Run test immediately after each file |
+| Multiple failures compound | Single point of failure, easy to debug |
+| Hard to identify root cause | Clear cause-effect relationship |
+| Mock issues affect many files | Mock issues caught early |
+| Messy git history | Clean, atomic commits possible |
+
+## Single File Workflow
+
+When testing a **single component, hook, or utility**:
+
+```
+1. Read source code completely
+2. Run `pnpm analyze-component <path>` (if available)
+3. Check complexity score and features detected
+4. Write the test file
+5. Run test: `pnpm test -- <file>.spec.tsx`
+6. Fix any failures
+7. Verify coverage meets goals (100% function, >95% branch)
+```
+
+## Directory/Multi-File Workflow (MUST FOLLOW)
+
+When testing a **directory or multiple files**, follow this strict workflow:
+
+### Step 1: Analyze and Plan
+
+1. **List all files** that need tests in the directory
+1. **Categorize by complexity**:
+   - 🟢 **Simple**: Utility functions, simple hooks, presentational components
+   - 🟡 **Medium**: Components with state, effects, or event handlers
+   - 🔴 **Complex**: Components with API calls, routing, or many dependencies
+1. **Order by dependency**: Test dependencies before dependents
+1. **Create a todo list** to track progress
+
+### Step 2: Determine Processing Order
+
+Process files in this recommended order:
+
+```
+1. Utility functions (simplest, no React)
+2. Custom hooks (isolated logic)
+3. Simple presentational components (few/no props)
+4. Medium complexity components (state, effects)
+5. Complex components (API, routing, many deps)
+6. Container/index components (integration tests - last)
+```
+
+**Rationale**:
+
+- Simpler files help establish mock patterns
+- Hooks used by components should be tested first
+- Integration tests (index files) depend on child components working
+
+### Step 3: Process Each File Incrementally
+
+**For EACH file in the ordered list:**
+
+```
+┌─────────────────────────────────────────────┐
+│  1. Write test file                         │
+│  2. Run: pnpm test -- <file>.spec.tsx       │
+│  3. If FAIL → Fix immediately, re-run       │
+│  4. If PASS → Mark complete in todo list    │
+│  5. ONLY THEN proceed to next file          │
+└─────────────────────────────────────────────┘
+```
+
+**DO NOT proceed to the next file until the current one passes.**
+
+### Step 4: Final Verification
+
+After all individual tests pass:
+
+```bash
+# Run all tests in the directory together
+pnpm test -- path/to/directory/
+
+# Check coverage
+pnpm test -- --coverage path/to/directory/
+```
+
+## Component Complexity Guidelines
+
+Use `pnpm analyze-component <path>` to assess complexity before testing.
+
+### 🔴 Very Complex Components (Complexity > 50)
+
+**Consider refactoring BEFORE testing:**
+
+- Break component into smaller, testable pieces
+- Extract complex logic into custom hooks
+- Separate container and presentational layers
+
+**If testing as-is:**
+
+- Use integration tests for complex workflows
+- Use `test.each()` for data-driven testing
+- Multiple `describe` blocks for organization
+- Consider testing major sections separately
+
+### 🟡 Medium Complexity (Complexity 30-50)
+
+- Group related tests in `describe` blocks
+- Test integration scenarios between internal parts
+- Focus on state transitions and side effects
+- Use helper functions to reduce test complexity
+
+### 🟢 Simple Components (Complexity < 30)
+
+- Standard test structure
+- Focus on props, rendering, and edge cases
+- Usually straightforward to test
+
+### 📏 Large Files (500+ lines)
+
+Regardless of complexity score:
+
+- **Strongly consider refactoring** before testing
+- If testing as-is, test major sections separately
+- Create helper functions for test setup
+- May need multiple test files
+
+## Todo List Format
+
+When testing multiple files, use a todo list like this:
+
+```
+Testing: path/to/directory/
+
+Ordered by complexity (simple → complex):
+
+☐ utils/helper.ts           [utility, simple]
+☐ hooks/use-custom-hook.ts  [hook, simple]
+☐ empty-state.tsx           [component, simple]
+☐ item-card.tsx             [component, medium]
+☐ list.tsx                  [component, complex]
+☐ index.tsx                 [integration]
+
+Progress: 0/6 complete
+```
+
+Update status as you complete each:
+
+- ☐ → ⏳ (in progress)
+- ⏳ → ✅ (complete and verified)
+- ⏳ → ❌ (blocked, needs attention)
+
+## When to Stop and Verify
+
+**Always run tests after:**
+
+- Completing a test file
+- Making changes to fix a failure
+- Modifying shared mocks
+- Updating test utilities or helpers
+
+**Signs you should pause:**
+
+- More than 2 consecutive test failures
+- Mock-related errors appearing
+- Unclear why a test is failing
+- Test passing but coverage unexpectedly low
+
+## Common Pitfalls to Avoid
+
+### ❌ Don't: Generate Everything First
+
+```
+# BAD: Writing all files then testing
+Write component-a.spec.tsx
+Write component-b.spec.tsx  
+Write component-c.spec.tsx
+Write component-d.spec.tsx
+Run pnpm test  ← Multiple failures, hard to debug
+```
+
+### ✅ Do: Verify Each Step
+
+```
+# GOOD: Incremental with verification
+Write component-a.spec.tsx
+Run pnpm test -- component-a.spec.tsx ✅
+Write component-b.spec.tsx
+Run pnpm test -- component-b.spec.tsx ✅
+...continue...
+```
+
+### ❌ Don't: Skip Verification for "Simple" Components
+
+Even simple components can have:
+
+- Import errors
+- Missing mock setup
+- Incorrect assumptions about props
+
+**Always verify, regardless of perceived simplicity.**
+
+### ❌ Don't: Continue When Tests Fail
+
+Failing tests compound:
+
+- A mock issue in file A affects files B, C, D
+- Fixing A later requires revisiting all dependent tests
+- Time wasted on debugging cascading failures
+
+**Fix failures immediately before proceeding.**
+
+## Integration with Claude's Todo Feature
+
+When using Claude for multi-file testing:
+
+1. **Ask Claude to create a todo list** before starting
+1. **Request one file at a time** or ensure Claude processes incrementally
+1. **Verify each test passes** before asking for the next
+1. **Mark todos complete** as you progress
+
+Example prompt:
+
+```
+Test all components in `path/to/directory/`.
+First, analyze the directory and create a todo list ordered by complexity.
+Then, process ONE file at a time, waiting for my confirmation that tests pass
+before proceeding to the next.
+```
+
+## Summary Checklist
+
+Before starting multi-file testing:
+
+- [ ] Listed all files needing tests
+- [ ] Ordered by complexity (simple → complex)
+- [ ] Created todo list for tracking
+- [ ] Understand dependencies between files
+
+During testing:
+
+- [ ] Processing ONE file at a time
+- [ ] Running tests after EACH file
+- [ ] Fixing failures BEFORE proceeding
+- [ ] Updating todo list progress
+
+After completion:
+
+- [ ] All individual tests pass
+- [ ] Full directory test run passes
+- [ ] Coverage goals met
+- [ ] Todo list shows all complete

.claude/skills/frontend-testing/templates/component-test.template.tsx

@@ -0,0 +1,296 @@
+/**
+ * Test Template for React Components
+ *
+ * WHY THIS STRUCTURE?
+ * - Organized sections make tests easy to navigate and maintain
+ * - Mocks at top ensure consistent test isolation
+ * - Factory functions reduce duplication and improve readability
+ * - describe blocks group related scenarios for better debugging
+ *
+ * INSTRUCTIONS:
+ * 1. Replace `ComponentName` with your component name
+ * 2. Update import path
+ * 3. Add/remove test sections based on component features (use analyze-component)
+ * 4. Follow AAA pattern: Arrange → Act → Assert
+ *
+ * RUN FIRST: pnpm analyze-component <path> to identify required test scenarios
+ */
+
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+// import ComponentName from './index'
+
+// ============================================================================
+// Mocks
+// ============================================================================
+// WHY: Mocks must be hoisted to top of file (Jest requirement).
+// They run BEFORE imports, so keep them before component imports.
+
+// i18n (automatically mocked)
+// WHY: Shared mock at web/__mocks__/react-i18next.ts is auto-loaded by Jest
+// No explicit mock needed - it returns translation keys as-is
+// Override only if custom translations are required:
+// jest.mock('react-i18next', () => ({
+//   useTranslation: () => ({
+//     t: (key: string) => {
+//       const customTranslations: Record<string, string> = {
+//         'my.custom.key': 'Custom Translation',
+//       }
+//       return customTranslations[key] || key
+//     },
+//   }),
+// }))
+
+// Router (if component uses useRouter, usePathname, useSearchParams)
+// WHY: Isolates tests from Next.js routing, enables testing navigation behavior
+// const mockPush = jest.fn()
+// jest.mock('next/navigation', () => ({
+//   useRouter: () => ({ push: mockPush }),
+//   usePathname: () => '/test-path',
+// }))
+
+// API services (if component fetches data)
+// WHY: Prevents real network calls, enables testing all states (loading/success/error)
+// jest.mock('@/service/api')
+// import * as api from '@/service/api'
+// const mockedApi = api as jest.Mocked<typeof api>
+
+// Shared mock state (for portal/dropdown components)
+// WHY: Portal components like PortalToFollowElem need shared state between
+// parent and child mocks to correctly simulate open/close behavior
+// let mockOpenState = false
+
+// ============================================================================
+// Test Data Factories
+// ============================================================================
+// WHY FACTORIES?
+// - Avoid hard-coded test data scattered across tests
+// - Easy to create variations with overrides
+// - Type-safe when using actual types from source
+// - Single source of truth for default test values
+
+// const createMockProps = (overrides = {}) => ({
+//   // Default props that make component render successfully
+//   ...overrides,
+// })
+
+// const createMockItem = (overrides = {}) => ({
+//   id: 'item-1',
+//   name: 'Test Item',
+//   ...overrides,
+// })
+
+// ============================================================================
+// Test Helpers
+// ============================================================================
+
+// const renderComponent = (props = {}) => {
+//   return render(<ComponentName {...createMockProps(props)} />)
+// }
+
+// ============================================================================
+// Tests
+// ============================================================================
+
+describe('ComponentName', () => {
+  // WHY beforeEach with clearAllMocks?
+  // - Ensures each test starts with clean slate
+  // - Prevents mock call history from leaking between tests
+  // - MUST be beforeEach (not afterEach) to reset BEFORE assertions like toHaveBeenCalledTimes
+  beforeEach(() => {
+    jest.clearAllMocks()
+    // Reset shared mock state if used (CRITICAL for portal/dropdown tests)
+    // mockOpenState = false
+  })
+
+  // --------------------------------------------------------------------------
+  // Rendering Tests (REQUIRED - Every component MUST have these)
+  // --------------------------------------------------------------------------
+  // WHY: Catches import errors, missing providers, and basic render issues
+  describe('Rendering', () => {
+    it('should render without crashing', () => {
+      // Arrange - Setup data and mocks
+      // const props = createMockProps()
+
+      // Act - Render the component
+      // render(<ComponentName {...props} />)
+
+      // Assert - Verify expected output
+      // Prefer getByRole for accessibility; it's what users "see"
+      // expect(screen.getByRole('...')).toBeInTheDocument()
+    })
+
+    it('should render with default props', () => {
+      // WHY: Verifies component works without optional props
+      // render(<ComponentName />)
+      // expect(screen.getByText('...')).toBeInTheDocument()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Props Tests (REQUIRED - Every component MUST test prop behavior)
+  // --------------------------------------------------------------------------
+  // WHY: Props are the component's API contract. Test them thoroughly.
+  describe('Props', () => {
+    it('should apply custom className', () => {
+      // WHY: Common pattern in Dify - components should merge custom classes
+      // render(<ComponentName className="custom-class" />)
+      // expect(screen.getByTestId('component')).toHaveClass('custom-class')
+    })
+
+    it('should use default values for optional props', () => {
+      // WHY: Verifies TypeScript defaults work at runtime
+      // render(<ComponentName />)
+      // expect(screen.getByRole('...')).toHaveAttribute('...', 'default-value')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // User Interactions (if component has event handlers - on*, handle*)
+  // --------------------------------------------------------------------------
+  // WHY: Event handlers are core functionality. Test from user's perspective.
+  describe('User Interactions', () => {
+    it('should call onClick when clicked', async () => {
+      // WHY userEvent over fireEvent?
+      // - userEvent simulates real user behavior (focus, hover, then click)
+      // - fireEvent is lower-level, doesn't trigger all browser events
+      // const user = userEvent.setup()
+      // const handleClick = jest.fn()
+      // render(<ComponentName onClick={handleClick} />)
+      //
+      // await user.click(screen.getByRole('button'))
+      //
+      // expect(handleClick).toHaveBeenCalledTimes(1)
+    })
+
+    it('should call onChange when value changes', async () => {
+      // const user = userEvent.setup()
+      // const handleChange = jest.fn()
+      // render(<ComponentName onChange={handleChange} />)
+      //
+      // await user.type(screen.getByRole('textbox'), 'new value')
+      //
+      // expect(handleChange).toHaveBeenCalled()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // State Management (if component uses useState/useReducer)
+  // --------------------------------------------------------------------------
+  // WHY: Test state through observable UI changes, not internal state values
+  describe('State Management', () => {
+    it('should update state on interaction', async () => {
+      // WHY test via UI, not state?
+      // - State is implementation detail; UI is what users see
+      // - If UI works correctly, state must be correct
+      // const user = userEvent.setup()
+      // render(<ComponentName />)
+      //
+      // // Initial state - verify what user sees
+      // expect(screen.getByText('Initial')).toBeInTheDocument()
+      //
+      // // Trigger state change via user action
+      // await user.click(screen.getByRole('button'))
+      //
+      // // New state - verify UI updated
+      // expect(screen.getByText('Updated')).toBeInTheDocument()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Async Operations (if component fetches data - useSWR, useQuery, fetch)
+  // --------------------------------------------------------------------------
+  // WHY: Async operations have 3 states users experience: loading, success, error
+  describe('Async Operations', () => {
+    it('should show loading state', () => {
+      // WHY never-resolving promise?
+      // - Keeps component in loading state for assertion
+      // - Alternative: use fake timers
+      // mockedApi.fetchData.mockImplementation(() => new Promise(() => {}))
+      // render(<ComponentName />)
+      //
+      // expect(screen.getByText(/loading/i)).toBeInTheDocument()
+    })
+
+    it('should show data on success', async () => {
+      // WHY waitFor?
+      // - Component updates asynchronously after fetch resolves
+      // - waitFor retries assertion until it passes or times out
+      // mockedApi.fetchData.mockResolvedValue({ items: ['Item 1'] })
+      // render(<ComponentName />)
+      //
+      // await waitFor(() => {
+      //   expect(screen.getByText('Item 1')).toBeInTheDocument()
+      // })
+    })
+
+    it('should show error on failure', async () => {
+      // mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+      // render(<ComponentName />)
+      //
+      // await waitFor(() => {
+      //   expect(screen.getByText(/error/i)).toBeInTheDocument()
+      // })
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Edge Cases (REQUIRED - Every component MUST handle edge cases)
+  // --------------------------------------------------------------------------
+  // WHY: Real-world data is messy. Components must handle:
+  // - Null/undefined from API failures or optional fields
+  // - Empty arrays/strings from user clearing data
+  // - Boundary values (0, MAX_INT, special characters)
+  describe('Edge Cases', () => {
+    it('should handle null value', () => {
+      // WHY test null specifically?
+      // - API might return null for missing data
+      // - Prevents "Cannot read property of null" in production
+      // render(<ComponentName value={null} />)
+      // expect(screen.getByText(/no data/i)).toBeInTheDocument()
+    })
+
+    it('should handle undefined value', () => {
+      // WHY test undefined separately from null?
+      // - TypeScript treats them differently
+      // - Optional props are undefined, not null
+      // render(<ComponentName value={undefined} />)
+      // expect(screen.getByText(/no data/i)).toBeInTheDocument()
+    })
+
+    it('should handle empty array', () => {
+      // WHY: Empty state often needs special UI (e.g., "No items yet")
+      // render(<ComponentName items={[]} />)
+      // expect(screen.getByText(/empty/i)).toBeInTheDocument()
+    })
+
+    it('should handle empty string', () => {
+      // WHY: Empty strings are truthy in JS but visually empty
+      // render(<ComponentName text="" />)
+      // expect(screen.getByText(/placeholder/i)).toBeInTheDocument()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Accessibility (optional but recommended for Dify's enterprise users)
+  // --------------------------------------------------------------------------
+  // WHY: Dify has enterprise customers who may require accessibility compliance
+  describe('Accessibility', () => {
+    it('should have accessible name', () => {
+      // WHY getByRole with name?
+      // - Tests that screen readers can identify the element
+      // - Enforces proper labeling practices
+      // render(<ComponentName label="Test Label" />)
+      // expect(screen.getByRole('button', { name: /test label/i })).toBeInTheDocument()
+    })
+
+    it('should support keyboard navigation', async () => {
+      // WHY: Some users can't use a mouse
+      // const user = userEvent.setup()
+      // render(<ComponentName />)
+      //
+      // await user.tab()
+      // expect(screen.getByRole('button')).toHaveFocus()
+    })
+  })
+})

.claude/skills/frontend-testing/templates/hook-test.template.ts

@@ -0,0 +1,207 @@
+/**
+ * Test Template for Custom Hooks
+ *
+ * Instructions:
+ * 1. Replace `useHookName` with your hook name
+ * 2. Update import path
+ * 3. Add/remove test sections based on hook features
+ */
+
+import { renderHook, act, waitFor } from '@testing-library/react'
+// import { useHookName } from './use-hook-name'
+
+// ============================================================================
+// Mocks
+// ============================================================================
+
+// API services (if hook fetches data)
+// jest.mock('@/service/api')
+// import * as api from '@/service/api'
+// const mockedApi = api as jest.Mocked<typeof api>
+
+// ============================================================================
+// Test Helpers
+// ============================================================================
+
+// Wrapper for hooks that need context
+// const createWrapper = (contextValue = {}) => {
+//   return ({ children }: { children: React.ReactNode }) => (
+//     <SomeContext.Provider value={contextValue}>
+//       {children}
+//     </SomeContext.Provider>
+//   )
+// }
+
+// ============================================================================
+// Tests
+// ============================================================================
+
+describe('useHookName', () => {
+  beforeEach(() => {
+    jest.clearAllMocks()
+  })
+
+  // --------------------------------------------------------------------------
+  // Initial State
+  // --------------------------------------------------------------------------
+  describe('Initial State', () => {
+    it('should return initial state', () => {
+      // const { result } = renderHook(() => useHookName())
+      //
+      // expect(result.current.value).toBe(initialValue)
+      // expect(result.current.isLoading).toBe(false)
+    })
+
+    it('should accept initial value from props', () => {
+      // const { result } = renderHook(() => useHookName({ initialValue: 'custom' }))
+      //
+      // expect(result.current.value).toBe('custom')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // State Updates
+  // --------------------------------------------------------------------------
+  describe('State Updates', () => {
+    it('should update value when setValue is called', () => {
+      // const { result } = renderHook(() => useHookName())
+      //
+      // act(() => {
+      //   result.current.setValue('new value')
+      // })
+      //
+      // expect(result.current.value).toBe('new value')
+    })
+
+    it('should reset to initial value', () => {
+      // const { result } = renderHook(() => useHookName({ initialValue: 'initial' }))
+      //
+      // act(() => {
+      //   result.current.setValue('changed')
+      // })
+      // expect(result.current.value).toBe('changed')
+      //
+      // act(() => {
+      //   result.current.reset()
+      // })
+      // expect(result.current.value).toBe('initial')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Async Operations
+  // --------------------------------------------------------------------------
+  describe('Async Operations', () => {
+    it('should fetch data on mount', async () => {
+      // mockedApi.fetchData.mockResolvedValue({ data: 'test' })
+      //
+      // const { result } = renderHook(() => useHookName())
+      //
+      // // Initially loading
+      // expect(result.current.isLoading).toBe(true)
+      //
+      // // Wait for data
+      // await waitFor(() => {
+      //   expect(result.current.isLoading).toBe(false)
+      // })
+      //
+      // expect(result.current.data).toEqual({ data: 'test' })
+    })
+
+    it('should handle fetch error', async () => {
+      // mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+      //
+      // const { result } = renderHook(() => useHookName())
+      //
+      // await waitFor(() => {
+      //   expect(result.current.error).toBeTruthy()
+      // })
+      //
+      // expect(result.current.error?.message).toBe('Network error')
+    })
+
+    it('should refetch when dependency changes', async () => {
+      // mockedApi.fetchData.mockResolvedValue({ data: 'test' })
+      //
+      // const { result, rerender } = renderHook(
+      //   ({ id }) => useHookName(id),
+      //   { initialProps: { id: '1' } }
+      // )
+      //
+      // await waitFor(() => {
+      //   expect(mockedApi.fetchData).toHaveBeenCalledWith('1')
+      // })
+      //
+      // rerender({ id: '2' })
+      //
+      // await waitFor(() => {
+      //   expect(mockedApi.fetchData).toHaveBeenCalledWith('2')
+      // })
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Side Effects
+  // --------------------------------------------------------------------------
+  describe('Side Effects', () => {
+    it('should call callback when value changes', () => {
+      // const callback = jest.fn()
+      // const { result } = renderHook(() => useHookName({ onChange: callback }))
+      //
+      // act(() => {
+      //   result.current.setValue('new value')
+      // })
+      //
+      // expect(callback).toHaveBeenCalledWith('new value')
+    })
+
+    it('should cleanup on unmount', () => {
+      // const cleanup = jest.fn()
+      // jest.spyOn(window, 'addEventListener')
+      // jest.spyOn(window, 'removeEventListener')
+      //
+      // const { unmount } = renderHook(() => useHookName())
+      //
+      // expect(window.addEventListener).toHaveBeenCalled()
+      //
+      // unmount()
+      //
+      // expect(window.removeEventListener).toHaveBeenCalled()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Edge Cases
+  // --------------------------------------------------------------------------
+  describe('Edge Cases', () => {
+    it('should handle null input', () => {
+      // const { result } = renderHook(() => useHookName(null))
+      //
+      // expect(result.current.value).toBeNull()
+    })
+
+    it('should handle rapid updates', () => {
+      // const { result } = renderHook(() => useHookName())
+      //
+      // act(() => {
+      //   result.current.setValue('1')
+      //   result.current.setValue('2')
+      //   result.current.setValue('3')
+      // })
+      //
+      // expect(result.current.value).toBe('3')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // With Context (if hook uses context)
+  // --------------------------------------------------------------------------
+  describe('With Context', () => {
+    it('should use context value', () => {
+      // const wrapper = createWrapper({ someValue: 'context-value' })
+      // const { result } = renderHook(() => useHookName(), { wrapper })
+      //
+      // expect(result.current.contextValue).toBe('context-value')
+    })
+  })
+})

.claude/skills/frontend-testing/templates/utility-test.template.ts

@@ -0,0 +1,154 @@
+/**
+ * Test Template for Utility Functions
+ *
+ * Instructions:
+ * 1. Replace `utilityFunction` with your function name
+ * 2. Update import path
+ * 3. Use test.each for data-driven tests
+ */
+
+// import { utilityFunction } from './utility'
+
+// ============================================================================
+// Tests
+// ============================================================================
+
+describe('utilityFunction', () => {
+  // --------------------------------------------------------------------------
+  // Basic Functionality
+  // --------------------------------------------------------------------------
+  describe('Basic Functionality', () => {
+    it('should return expected result for valid input', () => {
+      // expect(utilityFunction('input')).toBe('expected-output')
+    })
+
+    it('should handle multiple arguments', () => {
+      // expect(utilityFunction('a', 'b', 'c')).toBe('abc')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Data-Driven Tests
+  // --------------------------------------------------------------------------
+  describe('Input/Output Mapping', () => {
+    test.each([
+      // [input, expected]
+      ['input1', 'output1'],
+      ['input2', 'output2'],
+      ['input3', 'output3'],
+    ])('should return %s for input %s', (input, expected) => {
+      // expect(utilityFunction(input)).toBe(expected)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Edge Cases
+  // --------------------------------------------------------------------------
+  describe('Edge Cases', () => {
+    it('should handle empty string', () => {
+      // expect(utilityFunction('')).toBe('')
+    })
+
+    it('should handle null', () => {
+      // expect(utilityFunction(null)).toBe(null)
+      // or
+      // expect(() => utilityFunction(null)).toThrow()
+    })
+
+    it('should handle undefined', () => {
+      // expect(utilityFunction(undefined)).toBe(undefined)
+      // or
+      // expect(() => utilityFunction(undefined)).toThrow()
+    })
+
+    it('should handle empty array', () => {
+      // expect(utilityFunction([])).toEqual([])
+    })
+
+    it('should handle empty object', () => {
+      // expect(utilityFunction({})).toEqual({})
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Boundary Conditions
+  // --------------------------------------------------------------------------
+  describe('Boundary Conditions', () => {
+    it('should handle minimum value', () => {
+      // expect(utilityFunction(0)).toBe(0)
+    })
+
+    it('should handle maximum value', () => {
+      // expect(utilityFunction(Number.MAX_SAFE_INTEGER)).toBe(...)
+    })
+
+    it('should handle negative numbers', () => {
+      // expect(utilityFunction(-1)).toBe(...)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Type Coercion (if applicable)
+  // --------------------------------------------------------------------------
+  describe('Type Handling', () => {
+    it('should handle numeric string', () => {
+      // expect(utilityFunction('123')).toBe(123)
+    })
+
+    it('should handle boolean', () => {
+      // expect(utilityFunction(true)).toBe(...)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Error Cases
+  // --------------------------------------------------------------------------
+  describe('Error Handling', () => {
+    it('should throw for invalid input', () => {
+      // expect(() => utilityFunction('invalid')).toThrow('Error message')
+    })
+
+    it('should throw with specific error type', () => {
+      // expect(() => utilityFunction('invalid')).toThrow(ValidationError)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Complex Objects (if applicable)
+  // --------------------------------------------------------------------------
+  describe('Object Handling', () => {
+    it('should preserve object structure', () => {
+      // const input = { a: 1, b: 2 }
+      // expect(utilityFunction(input)).toEqual({ a: 1, b: 2 })
+    })
+
+    it('should handle nested objects', () => {
+      // const input = { nested: { deep: 'value' } }
+      // expect(utilityFunction(input)).toEqual({ nested: { deep: 'transformed' } })
+    })
+
+    it('should not mutate input', () => {
+      // const input = { a: 1 }
+      // const inputCopy = { ...input }
+      // utilityFunction(input)
+      // expect(input).toEqual(inputCopy)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Array Handling (if applicable)
+  // --------------------------------------------------------------------------
+  describe('Array Handling', () => {
+    it('should process all elements', () => {
+      // expect(utilityFunction([1, 2, 3])).toEqual([2, 4, 6])
+    })
+
+    it('should handle single element array', () => {
+      // expect(utilityFunction([1])).toEqual([2])
+    })
+
+    it('should preserve order', () => {
+      // expect(utilityFunction(['c', 'a', 'b'])).toEqual(['c', 'a', 'b'])
+    })
+  })
+})

.coveragerc

@@ -0,0 +1,5 @@
+[run]
+omit =
+    api/tests/*
+    api/migrations/*
+    api/core/rag/datasource/vdb/*

.devcontainer/post_create_command.sh

@@ -6,7 +6,7 @@ cd web && pnpm install
 pipx install uv
 
 echo "alias start-api=\"cd $WORKSPACE_ROOT/api && uv run python -m flask run --host 0.0.0.0 --port=5001 --debug\"" >> ~/.bashrc
-echo "alias start-worker=\"cd $WORKSPACE_ROOT/api && uv run python -m celery -A app.celery worker -P threads -c 1 --loglevel INFO -Q dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor\"" >> ~/.bashrc
+echo "alias start-worker=\"cd $WORKSPACE_ROOT/api && uv run python -m celery -A app.celery worker -P threads -c 1 --loglevel INFO -Q dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor,retention\"" >> ~/.bashrc
 echo "alias start-web=\"cd $WORKSPACE_ROOT/web && pnpm dev\"" >> ~/.bashrc
 echo "alias start-web-prod=\"cd $WORKSPACE_ROOT/web && pnpm build && pnpm start\"" >> ~/.bashrc
 echo "alias start-containers=\"cd $WORKSPACE_ROOT/docker && docker-compose -f docker-compose.middleware.yaml -p dify --env-file middleware.env up -d\"" >> ~/.bashrc

.github/CODEOWNERS

@@ -6,6 +6,12 @@
 
 * @crazywoola @laipz8200 @Yeuoly
 
+# CODEOWNERS file
+.github/CODEOWNERS @laipz8200 @crazywoola
+
+# Docs
+docs/ @crazywoola
+
 # Backend (default owner, more specific rules below will override)
 api/ @QuantumGhost
 
@@ -116,7 +122,7 @@ api/controllers/console/feature.py @GarfieldDai @GareArc
 api/controllers/web/feature.py @GarfieldDai @GareArc
 
 # Backend - Database Migrations
-api/migrations/ @snakevash @laipz8200
+api/migrations/ @snakevash @laipz8200 @MRZHUH
 
 # Frontend
 web/ @iamjoel

.github/copilot-instructions.md

@@ -1,12 +0,0 @@
-# Copilot Instructions
-
-GitHub Copilot must follow the unified frontend testing requirements documented in `web/testing/testing.md`.
-
-Key reminders:
-
-- Generate tests using the mandated tech stack, naming, and code style (AAA pattern, `fireEvent`, descriptive test names, cleans up mocks).
-- Cover rendering, prop combinations, and edge cases by default; extend coverage for hooks, routing, async flows, and domain-specific components when applicable.
-- Target >95% line and branch coverage and 100% function/statement coverage.
-- Apply the project's mocking conventions for i18n, toast notifications, and Next.js utilities.
-
-Any suggestions from Copilot that conflict with `web/testing/testing.md` should be revised before acceptance.

.github/workflows/api-tests.yml

@@ -71,18 +71,18 @@ jobs:
         run: |
           cp api/tests/integration_tests/.env.example api/tests/integration_tests/.env
 
-      - name: Run Workflow
-        run: uv run --project api bash dev/pytest/pytest_workflow.sh
-
-      - name: Run Tool
-        run: uv run --project api bash dev/pytest/pytest_tools.sh
-
-      - name: Run TestContainers
-        run: uv run --project api bash dev/pytest/pytest_testcontainers.sh
-
-      - name: Run Unit tests
+      - name: Run API Tests
+        env:
+          STORAGE_TYPE: opendal
+          OPENDAL_SCHEME: fs
+          OPENDAL_FS_ROOT: /tmp/dify-storage
         run: |
-          uv run --project api bash dev/pytest/pytest_unit_tests.sh
+          uv run --project api pytest \
+            --timeout "${PYTEST_TIMEOUT:-180}" \
+            api/tests/integration_tests/workflow \
+            api/tests/integration_tests/tools \
+            api/tests/test_containers_integration_tests \
+            api/tests/unit_tests
 
       - name: Coverage Summary
         run: |
@@ -93,5 +93,12 @@ jobs:
           # Create a detailed coverage summary
           echo "### Test Coverage Summary :test_tube:" >> $GITHUB_STEP_SUMMARY
           echo "Total Coverage: ${TOTAL_COVERAGE}%" >> $GITHUB_STEP_SUMMARY
-          uv run --project api coverage report --format=markdown >> $GITHUB_STEP_SUMMARY
-
+          {
+            echo ""
+            echo "<details><summary>File-level coverage (click to expand)</summary>"
+            echo ""
+            echo '```'
+            uv run --project api coverage report -m
+            echo '```'
+            echo "</details>"
+          } >> $GITHUB_STEP_SUMMARY

.github/workflows/autofix.yml

@@ -13,11 +13,12 @@ jobs:
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v4
-
-      # Use uv to ensure we have the same ruff version in CI and locally.
-      - uses: astral-sh/setup-uv@v6
+      - uses: actions/setup-python@v5
         with:
           python-version: "3.11"
+
+      - uses: astral-sh/setup-uv@v6
+
       - run: |
           cd api
           uv sync --dev
@@ -35,10 +36,11 @@ jobs:
 
       - name: ast-grep
         run: |
-          uvx --from ast-grep-cli sg --pattern 'db.session.query($WHATEVER).filter($HERE)' --rewrite 'db.session.query($WHATEVER).where($HERE)' -l py --update-all
-          uvx --from ast-grep-cli sg --pattern 'session.query($WHATEVER).filter($HERE)' --rewrite 'session.query($WHATEVER).where($HERE)' -l py --update-all
-          uvx --from ast-grep-cli sg -p '$A = db.Column($$$B)' -r '$A = mapped_column($$$B)' -l py --update-all
-          uvx --from ast-grep-cli sg -p '$A : $T = db.Column($$$B)' -r '$A : $T = mapped_column($$$B)' -l py --update-all
+          # ast-grep exits 1 if no matches are found; allow idempotent runs.
+          uvx --from ast-grep-cli ast-grep --pattern 'db.session.query($WHATEVER).filter($HERE)' --rewrite 'db.session.query($WHATEVER).where($HERE)' -l py --update-all || true
+          uvx --from ast-grep-cli ast-grep --pattern 'session.query($WHATEVER).filter($HERE)' --rewrite 'session.query($WHATEVER).where($HERE)' -l py --update-all || true
+          uvx --from ast-grep-cli ast-grep -p '$A = db.Column($$$B)' -r '$A = mapped_column($$$B)' -l py --update-all || true
+          uvx --from ast-grep-cli ast-grep -p '$A : $T = db.Column($$$B)' -r '$A : $T = mapped_column($$$B)' -l py --update-all || true
           # Convert Optional[T] to T | None (ignoring quoted types)
           cat > /tmp/optional-rule.yml << 'EOF'
           id: convert-optional-to-union
@@ -56,14 +58,15 @@ jobs:
                     pattern: $T
           fix: $T | None
           EOF
-          uvx --from ast-grep-cli sg scan --inline-rules "$(cat /tmp/optional-rule.yml)" --update-all
+          uvx --from ast-grep-cli ast-grep scan . --inline-rules "$(cat /tmp/optional-rule.yml)" --update-all
           # Fix forward references that were incorrectly converted (Python doesn't support "Type" | None syntax)
           find . -name "*.py" -type f -exec sed -i.bak -E 's/"([^"]+)" \| None/Optional["\1"]/g; s/'"'"'([^'"'"']+)'"'"' \| None/Optional['"'"'\1'"'"']/g' {} \;
           find . -name "*.py.bak" -type f -delete
 
+      # mdformat breaks YAML front matter in markdown files. Add --exclude for directories containing YAML front matter.
       - name: mdformat
         run: |
-          uvx mdformat .
+          uvx --python 3.13 mdformat . --exclude ".claude/skills/**"
 
       - name: Install pnpm
         uses: pnpm/action-setup@v4
@@ -76,7 +79,7 @@ jobs:
         with:
           node-version: 22
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
 
       - name: Web dependencies
         working-directory: ./web
@@ -84,7 +87,6 @@ jobs:
 
       - name: oxlint
         working-directory: ./web
-        run: |
-          pnpx oxlint --fix
+        run: pnpm exec oxlint --config .oxlintrc.json --fix .
 
       - uses: autofix-ci/action@635ffb0c9798bd160680f18fd73371e355b85f27

.github/workflows/style.yml

@@ -90,7 +90,7 @@ jobs:
         with:
           node-version: 22
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
 
       - name: Web dependencies
         if: steps.changed-files.outputs.any_changed == 'true'

.github/workflows/translate-i18n-base-on-english.yml

@@ -55,7 +55,7 @@ jobs:
         with:
           node-version: 'lts/*'
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
 
       - name: Install dependencies
         if: env.FILES_CHANGED == 'true'

.github/workflows/web-tests.yml

@@ -13,6 +13,7 @@ jobs:
     runs-on: ubuntu-latest
     defaults:
       run:
+        shell: bash
         working-directory: ./web
 
     steps:
@@ -21,14 +22,7 @@ jobs:
         with:
           persist-credentials: false
 
-      - name: Check changed files
-        id: changed-files
-        uses: tj-actions/changed-files@v46
-        with:
-          files: web/**
-
       - name: Install pnpm
-        if: steps.changed-files.outputs.any_changed == 'true'
         uses: pnpm/action-setup@v4
         with:
           package_json_file: web/package.json
@@ -36,23 +30,355 @@ jobs:
 
       - name: Setup Node.js
         uses: actions/setup-node@v4
-        if: steps.changed-files.outputs.any_changed == 'true'
         with:
           node-version: 22
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
+
+      - name: Restore Jest cache
+        uses: actions/cache@v4
+        with:
+          path: web/.cache/jest
+          key: ${{ runner.os }}-jest-${{ hashFiles('web/pnpm-lock.yaml') }}
+          restore-keys: |
+            ${{ runner.os }}-jest-
 
       - name: Install dependencies
-        if: steps.changed-files.outputs.any_changed == 'true'
-        working-directory: ./web
         run: pnpm install --frozen-lockfile
 
       - name: Check i18n types synchronization
-        if: steps.changed-files.outputs.any_changed == 'true'
-        working-directory: ./web
         run: pnpm run check:i18n-types
 
       - name: Run tests
-        if: steps.changed-files.outputs.any_changed == 'true'
-        working-directory: ./web
-        run: pnpm test
+        run: |
+          pnpm exec jest \
+            --ci \
+            --maxWorkers=100% \
+            --coverage \
+            --passWithNoTests
+
+      - name: Coverage Summary
+        if: always()
+        id: coverage-summary
+        run: |
+          set -eo pipefail
+
+          COVERAGE_FILE="coverage/coverage-final.json"
+          COVERAGE_SUMMARY_FILE="coverage/coverage-summary.json"
+
+          if [ ! -f "$COVERAGE_FILE" ] && [ ! -f "$COVERAGE_SUMMARY_FILE" ]; then
+            echo "has_coverage=false" >> "$GITHUB_OUTPUT"
+            echo "### 🚨 Test Coverage Report :test_tube:" >> "$GITHUB_STEP_SUMMARY"
+            echo "Coverage data not found. Ensure Jest runs with coverage enabled." >> "$GITHUB_STEP_SUMMARY"
+            exit 0
+          fi
+
+          echo "has_coverage=true" >> "$GITHUB_OUTPUT"
+
+          node <<'NODE' >> "$GITHUB_STEP_SUMMARY"
+          const fs = require('fs');
+          const path = require('path');
+          let libCoverage = null;
+
+          try {
+            libCoverage = require('istanbul-lib-coverage');
+          } catch (error) {
+            libCoverage = null;
+          }
+
+          const summaryPath = path.join('coverage', 'coverage-summary.json');
+          const finalPath = path.join('coverage', 'coverage-final.json');
+
+          const hasSummary = fs.existsSync(summaryPath);
+          const hasFinal = fs.existsSync(finalPath);
+
+          if (!hasSummary && !hasFinal) {
+            console.log('### Test Coverage Summary :test_tube:');
+            console.log('');
+            console.log('No coverage data found.');
+            process.exit(0);
+          }
+
+          const summary = hasSummary
+            ? JSON.parse(fs.readFileSync(summaryPath, 'utf8'))
+            : null;
+          const coverage = hasFinal
+            ? JSON.parse(fs.readFileSync(finalPath, 'utf8'))
+            : null;
+
+          const getLineCoverageFromStatements = (statementMap, statementHits) => {
+            const lineHits = {};
+
+            if (!statementMap || !statementHits) {
+              return lineHits;
+            }
+
+            Object.entries(statementMap).forEach(([key, statement]) => {
+              const line = statement?.start?.line;
+              if (!line) {
+                return;
+              }
+              const hits = statementHits[key] ?? 0;
+              const previous = lineHits[line];
+              lineHits[line] = previous === undefined ? hits : Math.max(previous, hits);
+            });
+
+            return lineHits;
+          };
+
+          const getFileCoverage = (entry) => (
+            libCoverage ? libCoverage.createFileCoverage(entry) : null
+          );
+
+          const getLineHits = (entry, fileCoverage) => {
+            const lineHits = entry.l ?? {};
+            if (Object.keys(lineHits).length > 0) {
+              return lineHits;
+            }
+            if (fileCoverage) {
+              return fileCoverage.getLineCoverage();
+            }
+            return getLineCoverageFromStatements(entry.statementMap ?? {}, entry.s ?? {});
+          };
+
+          const getUncoveredLines = (entry, fileCoverage, lineHits) => {
+            if (lineHits && Object.keys(lineHits).length > 0) {
+              return Object.entries(lineHits)
+                .filter(([, count]) => count === 0)
+                .map(([line]) => Number(line))
+                .sort((a, b) => a - b);
+            }
+            if (fileCoverage) {
+              return fileCoverage.getUncoveredLines();
+            }
+            return [];
+          };
+
+          const totals = {
+            lines: { covered: 0, total: 0 },
+            statements: { covered: 0, total: 0 },
+            branches: { covered: 0, total: 0 },
+            functions: { covered: 0, total: 0 },
+          };
+          const fileSummaries = [];
+
+          if (summary) {
+            const totalEntry = summary.total ?? {};
+            ['lines', 'statements', 'branches', 'functions'].forEach((key) => {
+              if (totalEntry[key]) {
+                totals[key].covered = totalEntry[key].covered ?? 0;
+                totals[key].total = totalEntry[key].total ?? 0;
+              }
+            });
+
+            Object.entries(summary)
+              .filter(([file]) => file !== 'total')
+              .forEach(([file, data]) => {
+                fileSummaries.push({
+                  file,
+                  pct: data.lines?.pct ?? data.statements?.pct ?? 0,
+                  lines: {
+                    covered: data.lines?.covered ?? 0,
+                    total: data.lines?.total ?? 0,
+                  },
+                });
+              });
+          } else if (coverage) {
+            Object.entries(coverage).forEach(([file, entry]) => {
+              const fileCoverage = getFileCoverage(entry);
+              const lineHits = getLineHits(entry, fileCoverage);
+              const statementHits = entry.s ?? {};
+              const branchHits = entry.b ?? {};
+              const functionHits = entry.f ?? {};
+
+              const lineTotal = Object.keys(lineHits).length;
+              const lineCovered = Object.values(lineHits).filter((n) => n > 0).length;
+
+              const statementTotal = Object.keys(statementHits).length;
+              const statementCovered = Object.values(statementHits).filter((n) => n > 0).length;
+
+              const branchTotal = Object.values(branchHits).reduce((acc, branches) => acc + branches.length, 0);
+              const branchCovered = Object.values(branchHits).reduce(
+                (acc, branches) => acc + branches.filter((n) => n > 0).length,
+                0,
+              );
+
+              const functionTotal = Object.keys(functionHits).length;
+              const functionCovered = Object.values(functionHits).filter((n) => n > 0).length;
+
+              totals.lines.total += lineTotal;
+              totals.lines.covered += lineCovered;
+              totals.statements.total += statementTotal;
+              totals.statements.covered += statementCovered;
+              totals.branches.total += branchTotal;
+              totals.branches.covered += branchCovered;
+              totals.functions.total += functionTotal;
+              totals.functions.covered += functionCovered;
+
+              const pct = (covered, tot) => (tot > 0 ? (covered / tot) * 100 : 0);
+
+              fileSummaries.push({
+                file,
+                pct: pct(lineCovered || statementCovered, lineTotal || statementTotal),
+                lines: {
+                  covered: lineCovered || statementCovered,
+                  total: lineTotal || statementTotal,
+                },
+              });
+            });
+          }
+
+          const pct = (covered, tot) => (tot > 0 ? ((covered / tot) * 100).toFixed(2) : '0.00');
+
+          console.log('### Test Coverage Summary :test_tube:');
+          console.log('');
+          console.log('| Metric | Coverage | Covered / Total |');
+          console.log('|--------|----------|-----------------|');
+          console.log(`| Lines | ${pct(totals.lines.covered, totals.lines.total)}% | ${totals.lines.covered} / ${totals.lines.total} |`);
+          console.log(`| Statements | ${pct(totals.statements.covered, totals.statements.total)}% | ${totals.statements.covered} / ${totals.statements.total} |`);
+          console.log(`| Branches | ${pct(totals.branches.covered, totals.branches.total)}% | ${totals.branches.covered} / ${totals.branches.total} |`);
+          console.log(`| Functions | ${pct(totals.functions.covered, totals.functions.total)}% | ${totals.functions.covered} / ${totals.functions.total} |`);
+
+          console.log('');
+          console.log('<details><summary>File coverage (lowest lines first)</summary>');
+          console.log('');
+          console.log('```');
+          fileSummaries
+            .sort((a, b) => (a.pct - b.pct) || (b.lines.total - a.lines.total))
+            .slice(0, 25)
+            .forEach(({ file, pct, lines }) => {
+              console.log(`${pct.toFixed(2)}%\t${lines.covered}/${lines.total}\t${file}`);
+            });
+          console.log('```');
+          console.log('</details>');
+
+          if (coverage) {
+            const pctValue = (covered, tot) => {
+              if (tot === 0) {
+                return '0';
+              }
+              return ((covered / tot) * 100)
+                .toFixed(2)
+                .replace(/\.?0+$/, '');
+            };
+
+            const formatLineRanges = (lines) => {
+              if (lines.length === 0) {
+                return '';
+              }
+              const ranges = [];
+              let start = lines[0];
+              let end = lines[0];
+
+              for (let i = 1; i < lines.length; i += 1) {
+                const current = lines[i];
+                if (current === end + 1) {
+                  end = current;
+                  continue;
+                }
+                ranges.push(start === end ? `${start}` : `${start}-${end}`);
+                start = current;
+                end = current;
+              }
+              ranges.push(start === end ? `${start}` : `${start}-${end}`);
+              return ranges.join(',');
+            };
+
+            const tableTotals = {
+              statements: { covered: 0, total: 0 },
+              branches: { covered: 0, total: 0 },
+              functions: { covered: 0, total: 0 },
+              lines: { covered: 0, total: 0 },
+            };
+            const tableRows = Object.entries(coverage)
+              .map(([file, entry]) => {
+                const fileCoverage = getFileCoverage(entry);
+                const lineHits = getLineHits(entry, fileCoverage);
+                const statementHits = entry.s ?? {};
+                const branchHits = entry.b ?? {};
+                const functionHits = entry.f ?? {};
+
+                const lineTotal = Object.keys(lineHits).length;
+                const lineCovered = Object.values(lineHits).filter((n) => n > 0).length;
+                const statementTotal = Object.keys(statementHits).length;
+                const statementCovered = Object.values(statementHits).filter((n) => n > 0).length;
+                const branchTotal = Object.values(branchHits).reduce((acc, branches) => acc + branches.length, 0);
+                const branchCovered = Object.values(branchHits).reduce(
+                  (acc, branches) => acc + branches.filter((n) => n > 0).length,
+                  0,
+                );
+                const functionTotal = Object.keys(functionHits).length;
+                const functionCovered = Object.values(functionHits).filter((n) => n > 0).length;
+
+                tableTotals.lines.total += lineTotal;
+                tableTotals.lines.covered += lineCovered;
+                tableTotals.statements.total += statementTotal;
+                tableTotals.statements.covered += statementCovered;
+                tableTotals.branches.total += branchTotal;
+                tableTotals.branches.covered += branchCovered;
+                tableTotals.functions.total += functionTotal;
+                tableTotals.functions.covered += functionCovered;
+
+                const uncoveredLines = getUncoveredLines(entry, fileCoverage, lineHits);
+
+                const filePath = entry.path ?? file;
+                const relativePath = path.isAbsolute(filePath)
+                  ? path.relative(process.cwd(), filePath)
+                  : filePath;
+
+                return {
+                  file: relativePath || file,
+                  statements: pctValue(statementCovered, statementTotal),
+                  branches: pctValue(branchCovered, branchTotal),
+                  functions: pctValue(functionCovered, functionTotal),
+                  lines: pctValue(lineCovered, lineTotal),
+                  uncovered: formatLineRanges(uncoveredLines),
+                };
+              })
+              .sort((a, b) => a.file.localeCompare(b.file));
+
+            const columns = [
+              { key: 'file', header: 'File', align: 'left' },
+              { key: 'statements', header: '% Stmts', align: 'right' },
+              { key: 'branches', header: '% Branch', align: 'right' },
+              { key: 'functions', header: '% Funcs', align: 'right' },
+              { key: 'lines', header: '% Lines', align: 'right' },
+              { key: 'uncovered', header: 'Uncovered Line #s', align: 'left' },
+            ];
+
+            const allFilesRow = {
+              file: 'All files',
+              statements: pctValue(tableTotals.statements.covered, tableTotals.statements.total),
+              branches: pctValue(tableTotals.branches.covered, tableTotals.branches.total),
+              functions: pctValue(tableTotals.functions.covered, tableTotals.functions.total),
+              lines: pctValue(tableTotals.lines.covered, tableTotals.lines.total),
+              uncovered: '',
+            };
+
+            const rowsForOutput = [allFilesRow, ...tableRows];
+            const formatRow = (row) => `| ${columns
+              .map(({ key }) => String(row[key] ?? ''))
+              .join(' | ')} |`;
+            const headerRow = `| ${columns.map(({ header }) => header).join(' | ')} |`;
+            const dividerRow = `| ${columns
+              .map(({ align }) => (align === 'right' ? '---:' : ':---'))
+              .join(' | ')} |`;
+
+            console.log('');
+            console.log('<details><summary>Jest coverage table</summary>');
+            console.log('');
+            console.log(headerRow);
+            console.log(dividerRow);
+            rowsForOutput.forEach((row) => console.log(formatRow(row)));
+            console.log('</details>');
+          }
+          NODE
+
+      - name: Upload Coverage Artifact
+        if: steps.coverage-summary.outputs.has_coverage == 'true'
+        uses: actions/upload-artifact@v4
+        with:
+          name: web-coverage-report
+          path: web/coverage
+          retention-days: 30
+          if-no-files-found: error

.gitignore

@@ -189,6 +189,7 @@ docker/volumes/matrixone/*
 docker/volumes/mysql/*
 docker/volumes/seekdb/*
 !docker/volumes/oceanbase/init.d
+docker/volumes/iris/*
 
 docker/nginx/conf.d/default.conf
 docker/nginx/ssl/*

.vscode/launch.json.template

@@ -37,7 +37,7 @@
                 "-c",
                 "1",
                 "-Q",
-                "dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor",
+                "dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor,retention",
                 "--loglevel",
                 "INFO"
             ],

.windsurf/rules/testing.md

@@ -1,5 +0,0 @@
-# Windsurf Testing Rules
-
-- Use `web/testing/testing.md` as the single source of truth for frontend automated testing.
-- Honor every requirement in that document when generating or accepting tests.
-- When proposing or saving tests, re-read that document and follow every requirement.

api/.env.example

@@ -543,6 +543,25 @@ APP_MAX_EXECUTION_TIME=1200
 APP_DEFAULT_ACTIVE_REQUESTS=0
 APP_MAX_ACTIVE_REQUESTS=0
 
+# Aliyun SLS Logstore Configuration
+# Aliyun Access Key ID
+ALIYUN_SLS_ACCESS_KEY_ID=
+# Aliyun Access Key Secret
+ALIYUN_SLS_ACCESS_KEY_SECRET=
+# Aliyun SLS Endpoint (e.g., cn-hangzhou.log.aliyuncs.com)
+ALIYUN_SLS_ENDPOINT=
+# Aliyun SLS Region (e.g., cn-hangzhou)
+ALIYUN_SLS_REGION=
+# Aliyun SLS Project Name
+ALIYUN_SLS_PROJECT_NAME=
+# Number of days to retain workflow run logs (default: 365 days， 3650 for permanent storage)
+ALIYUN_SLS_LOGSTORE_TTL=365
+# Enable dual-write to both SLS LogStore and SQL database (default: false)
+LOGSTORE_DUAL_WRITE_ENABLED=false
+# Enable dual-read fallback to SQL database when LogStore returns no results (default: true)
+# Useful for migration scenarios where historical data exists only in SQL database
+LOGSTORE_DUAL_READ_ENABLED=true
+
 # Celery beat configuration
 CELERY_BEAT_SCHEDULER_TIME=1
 
@@ -660,3 +679,19 @@ SINGLE_CHUNK_ATTACHMENT_LIMIT=10
 ATTACHMENT_IMAGE_FILE_SIZE_LIMIT=2
 ATTACHMENT_IMAGE_DOWNLOAD_TIMEOUT=60
 IMAGE_FILE_BATCH_LIMIT=10
+
+# Maximum allowed CSV file size for annotation import in megabytes
+ANNOTATION_IMPORT_FILE_SIZE_LIMIT=2
+#Maximum number of annotation records allowed in a single import
+ANNOTATION_IMPORT_MAX_RECORDS=10000
+# Minimum number of annotation records required in a single import
+ANNOTATION_IMPORT_MIN_RECORDS=1
+ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE=5
+ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR=20
+# Maximum number of concurrent annotation import tasks per tenant
+ANNOTATION_IMPORT_MAX_CONCURRENT=5
+
+# Sandbox expired records clean configuration
+SANDBOX_EXPIRED_RECORDS_CLEAN_GRACEFUL_PERIOD=21
+SANDBOX_EXPIRED_RECORDS_CLEAN_BATCH_SIZE=1000
+SANDBOX_EXPIRED_RECORDS_RETENTION_DAYS=30

api/README.md

@@ -84,7 +84,7 @@
 1. If you need to handle and debug the async tasks (e.g. dataset importing and documents indexing), please start the worker service.
 
 ```bash
-uv run celery -A app.celery worker -P threads -c 2 --loglevel INFO -Q dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor
+uv run celery -A app.celery worker -P threads -c 2 --loglevel INFO -Q dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor,retention
 ```
 
 Additionally, if you want to debug the celery scheduled tasks, you can run the following command in another terminal to start the beat service:

api/app_factory.py

@@ -75,6 +75,7 @@ def initialize_extensions(app: DifyApp):
         ext_import_modules,
         ext_logging,
         ext_login,
+        ext_logstore,
         ext_mail,
         ext_migrate,
         ext_orjson,
@@ -83,6 +84,7 @@ def initialize_extensions(app: DifyApp):
         ext_redis,
         ext_request_logging,
         ext_sentry,
+        ext_session_factory,
         ext_set_secretkey,
         ext_storage,
         ext_timezone,
@@ -104,6 +106,7 @@ def initialize_extensions(app: DifyApp):
         ext_migrate,
         ext_redis,
         ext_storage,
+        ext_logstore,  # Initialize logstore after storage, before celery
         ext_celery,
         ext_login,
         ext_mail,
@@ -114,6 +117,7 @@ def initialize_extensions(app: DifyApp):
         ext_commands,
         ext_otel,
         ext_request_logging,
+        ext_session_factory,
     ]
     for ext in extensions:
         short_name = ext.__name__.split(".")[-1]

api/configs/feature/__init__.py

@@ -218,7 +218,7 @@ class PluginConfig(BaseSettings):
 
     PLUGIN_DAEMON_TIMEOUT: PositiveFloat | None = Field(
         description="Timeout in seconds for requests to the plugin daemon (set to None to disable)",
-        default=300.0,
+        default=600.0,
     )
 
     INNER_API_KEY_FOR_PLUGIN: str = Field(description="Inner api key for plugin", default="inner-api-key")
@@ -380,6 +380,37 @@ class FileUploadConfig(BaseSettings):
         default=60,
     )
 
+    # Annotation Import Security Configurations
+    ANNOTATION_IMPORT_FILE_SIZE_LIMIT: NonNegativeInt = Field(
+        description="Maximum allowed CSV file size for annotation import in megabytes",
+        default=2,
+    )
+
+    ANNOTATION_IMPORT_MAX_RECORDS: PositiveInt = Field(
+        description="Maximum number of annotation records allowed in a single import",
+        default=10000,
+    )
+
+    ANNOTATION_IMPORT_MIN_RECORDS: PositiveInt = Field(
+        description="Minimum number of annotation records required in a single import",
+        default=1,
+    )
+
+    ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE: PositiveInt = Field(
+        description="Maximum number of annotation import requests per minute per tenant",
+        default=5,
+    )
+
+    ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR: PositiveInt = Field(
+        description="Maximum number of annotation import requests per hour per tenant",
+        default=20,
+    )
+
+    ANNOTATION_IMPORT_MAX_CONCURRENT: PositiveInt = Field(
+        description="Maximum number of concurrent annotation import tasks per tenant",
+        default=2,
+    )
+
     inner_UPLOAD_FILE_EXTENSION_BLACKLIST: str = Field(
         description=(
             "Comma-separated list of file extensions that are blocked from upload. "
@@ -1239,6 +1270,21 @@ class TenantIsolatedTaskQueueConfig(BaseSettings):
     )
 
 
+class SandboxExpiredRecordsCleanConfig(BaseSettings):
+    SANDBOX_EXPIRED_RECORDS_CLEAN_GRACEFUL_PERIOD: NonNegativeInt = Field(
+        description="Graceful period in days for sandbox records clean after subscription expiration",
+        default=21,
+    )
+    SANDBOX_EXPIRED_RECORDS_CLEAN_BATCH_SIZE: PositiveInt = Field(
+        description="Maximum number of records to process in each batch",
+        default=1000,
+    )
+    SANDBOX_EXPIRED_RECORDS_RETENTION_DAYS: PositiveInt = Field(
+        description="Retention days for sandbox expired workflow_run records and message records",
+        default=30,
+    )
+
+
 class FeatureConfig(
     # place the configs in alphabet order
     AppExecutionConfig,
@@ -1264,6 +1310,7 @@ class FeatureConfig(
     PositionConfig,
     RagEtlConfig,
     RepositoryConfig,
+    SandboxExpiredRecordsCleanConfig,
     SecurityConfig,
     TenantIsolatedTaskQueueConfig,
     ToolConfig,

api/configs/middleware/__init__.py

@@ -26,6 +26,7 @@ from .vdb.clickzetta_config import ClickzettaConfig
 from .vdb.couchbase_config import CouchbaseConfig
 from .vdb.elasticsearch_config import ElasticsearchConfig
 from .vdb.huawei_cloud_config import HuaweiCloudConfig
+from .vdb.iris_config import IrisVectorConfig
 from .vdb.lindorm_config import LindormConfig
 from .vdb.matrixone_config import MatrixoneConfig
 from .vdb.milvus_config import MilvusConfig
@@ -106,7 +107,7 @@ class KeywordStoreConfig(BaseSettings):
 
 class DatabaseConfig(BaseSettings):
     # Database type selector
-    DB_TYPE: Literal["postgresql", "mysql", "oceanbase"] = Field(
+    DB_TYPE: Literal["postgresql", "mysql", "oceanbase", "seekdb"] = Field(
         description="Database type to use. OceanBase is MySQL-compatible.",
         default="postgresql",
     )
@@ -336,6 +337,7 @@ class MiddlewareConfig(
     ChromaConfig,
     ClickzettaConfig,
     HuaweiCloudConfig,
+    IrisVectorConfig,
     MilvusConfig,
     AlibabaCloudMySQLConfig,
     MyScaleConfig,

api/configs/middleware/vdb/iris_config.py

@@ -0,0 +1,91 @@
+"""Configuration for InterSystems IRIS vector database."""
+
+from pydantic import Field, PositiveInt, model_validator
+from pydantic_settings import BaseSettings
+
+
+class IrisVectorConfig(BaseSettings):
+    """Configuration settings for IRIS vector database connection and pooling."""
+
+    IRIS_HOST: str | None = Field(
+        description="Hostname or IP address of the IRIS server.",
+        default="localhost",
+    )
+
+    IRIS_SUPER_SERVER_PORT: PositiveInt | None = Field(
+        description="Port number for IRIS connection.",
+        default=1972,
+    )
+
+    IRIS_USER: str | None = Field(
+        description="Username for IRIS authentication.",
+        default="_SYSTEM",
+    )
+
+    IRIS_PASSWORD: str | None = Field(
+        description="Password for IRIS authentication.",
+        default="Dify@1234",
+    )
+
+    IRIS_SCHEMA: str | None = Field(
+        description="Schema name for IRIS tables.",
+        default="dify",
+    )
+
+    IRIS_DATABASE: str | None = Field(
+        description="Database namespace for IRIS connection.",
+        default="USER",
+    )
+
+    IRIS_CONNECTION_URL: str | None = Field(
+        description="Full connection URL for IRIS (overrides individual fields if provided).",
+        default=None,
+    )
+
+    IRIS_MIN_CONNECTION: PositiveInt = Field(
+        description="Minimum number of connections in the pool.",
+        default=1,
+    )
+
+    IRIS_MAX_CONNECTION: PositiveInt = Field(
+        description="Maximum number of connections in the pool.",
+        default=3,
+    )
+
+    IRIS_TEXT_INDEX: bool = Field(
+        description="Enable full-text search index using %iFind.Index.Basic.",
+        default=True,
+    )
+
+    IRIS_TEXT_INDEX_LANGUAGE: str = Field(
+        description="Language for full-text search index (e.g., 'en', 'ja', 'zh', 'de').",
+        default="en",
+    )
+
+    @model_validator(mode="before")
+    @classmethod
+    def validate_config(cls, values: dict) -> dict:
+        """Validate IRIS configuration values.
+
+        Args:
+            values: Configuration dictionary
+
+        Returns:
+            Validated configuration dictionary
+
+        Raises:
+            ValueError: If required fields are missing or pool settings are invalid
+        """
+        # Only validate required fields if IRIS is being used as the vector store
+        # This allows the config to be loaded even when IRIS is not in use
+
+        # vector_store = os.environ.get("VECTOR_STORE", "")
+        # We rely on Pydantic defaults for required fields if they are missing from env.
+        # Strict existence check is removed to allow defaults to work.
+
+        min_conn = values.get("IRIS_MIN_CONNECTION", 1)
+        max_conn = values.get("IRIS_MAX_CONNECTION", 3)
+        if min_conn > max_conn:
+            raise ValueError("IRIS_MIN_CONNECTION must be less than or equal to IRIS_MAX_CONNECTION")
+
+        return values

api/constants/languages.py

@@ -20,6 +20,7 @@ language_timezone_mapping = {
     "sl-SI": "Europe/Ljubljana",
     "th-TH": "Asia/Bangkok",
     "id-ID": "Asia/Jakarta",
+    "ar-TN": "Africa/Tunis",
 }
 
 languages = list(language_timezone_mapping.keys())

api/controllers/console/admin.py

@@ -6,19 +6,20 @@ from flask import request
 from flask_restx import Resource
 from pydantic import BaseModel, Field, field_validator
 from sqlalchemy import select
-from sqlalchemy.orm import Session
 from werkzeug.exceptions import NotFound, Unauthorized
 
-P = ParamSpec("P")
-R = TypeVar("R")
 from configs import dify_config
 from constants.languages import supported_language
 from controllers.console import console_ns
 from controllers.console.wraps import only_edition_cloud
+from core.db.session_factory import session_factory
 from extensions.ext_database import db
 from libs.token import extract_access_token
 from models.model import App, InstalledApp, RecommendedApp
 
+P = ParamSpec("P")
+R = TypeVar("R")
+
 DEFAULT_REF_TEMPLATE_SWAGGER_2_0 = "#/definitions/{model}"
 
 
@@ -90,7 +91,7 @@ class InsertExploreAppListApi(Resource):
             privacy_policy = site.privacy_policy or payload.privacy_policy or ""
             custom_disclaimer = site.custom_disclaimer or payload.custom_disclaimer or ""
 
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             recommended_app = session.execute(
                 select(RecommendedApp).where(RecommendedApp.app_id == payload.app_id)
             ).scalar_one_or_none()
@@ -138,7 +139,7 @@ class InsertExploreAppApi(Resource):
     @only_edition_cloud
     @admin_required
     def delete(self, app_id):
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             recommended_app = session.execute(
                 select(RecommendedApp).where(RecommendedApp.app_id == str(app_id))
             ).scalar_one_or_none()
@@ -146,13 +147,13 @@ class InsertExploreAppApi(Resource):
         if not recommended_app:
             return {"result": "success"}, 204
 
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             app = session.execute(select(App).where(App.id == recommended_app.app_id)).scalar_one_or_none()
 
         if app:
             app.is_public = False
 
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             installed_apps = (
                 session.execute(
                     select(InstalledApp).where(

api/controllers/console/app/annotation.py

@@ -1,6 +1,6 @@
 from typing import Any, Literal
 
-from flask import request
+from flask import abort, make_response, request
 from flask_restx import Resource, fields, marshal, marshal_with
 from pydantic import BaseModel, Field, field_validator
 
@@ -8,6 +8,8 @@ from controllers.common.errors import NoFileUploadedError, TooManyFilesError
 from controllers.console import console_ns
 from controllers.console.wraps import (
     account_initialization_required,
+    annotation_import_concurrency_limit,
+    annotation_import_rate_limit,
     cloud_edition_billing_resource_check,
     edit_permission_required,
     setup_required,
@@ -257,7 +259,7 @@ class AnnotationApi(Resource):
 @console_ns.route("/apps/<uuid:app_id>/annotations/export")
 class AnnotationExportApi(Resource):
     @console_ns.doc("export_annotations")
-    @console_ns.doc(description="Export all annotations for an app")
+    @console_ns.doc(description="Export all annotations for an app with CSV injection protection")
     @console_ns.doc(params={"app_id": "Application ID"})
     @console_ns.response(
         200,
@@ -272,8 +274,14 @@ class AnnotationExportApi(Resource):
     def get(self, app_id):
         app_id = str(app_id)
         annotation_list = AppAnnotationService.export_annotation_list_by_app_id(app_id)
-        response = {"data": marshal(annotation_list, annotation_fields)}
-        return response, 200
+        response_data = {"data": marshal(annotation_list, annotation_fields)}
+
+        # Create response with secure headers for CSV export
+        response = make_response(response_data, 200)
+        response.headers["Content-Type"] = "application/json; charset=utf-8"
+        response.headers["X-Content-Type-Options"] = "nosniff"
+
+        return response
 
 
 @console_ns.route("/apps/<uuid:app_id>/annotations/<uuid:annotation_id>")
@@ -314,18 +322,25 @@ class AnnotationUpdateDeleteApi(Resource):
 @console_ns.route("/apps/<uuid:app_id>/annotations/batch-import")
 class AnnotationBatchImportApi(Resource):
     @console_ns.doc("batch_import_annotations")
-    @console_ns.doc(description="Batch import annotations from CSV file")
+    @console_ns.doc(description="Batch import annotations from CSV file with rate limiting and security checks")
     @console_ns.doc(params={"app_id": "Application ID"})
     @console_ns.response(200, "Batch import started successfully")
     @console_ns.response(403, "Insufficient permissions")
     @console_ns.response(400, "No file uploaded or too many files")
+    @console_ns.response(413, "File too large")
+    @console_ns.response(429, "Too many requests or concurrent imports")
     @setup_required
     @login_required
     @account_initialization_required
     @cloud_edition_billing_resource_check("annotation")
+    @annotation_import_rate_limit
+    @annotation_import_concurrency_limit
     @edit_permission_required
     def post(self, app_id):
+        from configs import dify_config
+
         app_id = str(app_id)
+
         # check file
         if "file" not in request.files:
             raise NoFileUploadedError()
@@ -335,9 +350,27 @@ class AnnotationBatchImportApi(Resource):
 
         # get file from request
         file = request.files["file"]
+
         # check file type
         if not file.filename or not file.filename.lower().endswith(".csv"):
             raise ValueError("Invalid file type. Only CSV files are allowed")
+
+        # Check file size before processing
+        file.seek(0, 2)  # Seek to end of file
+        file_size = file.tell()
+        file.seek(0)  # Reset to beginning
+
+        max_size_bytes = dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT * 1024 * 1024
+        if file_size > max_size_bytes:
+            abort(
+                413,
+                f"File size exceeds maximum limit of {dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT}MB. "
+                f"Please reduce the file size and try again.",
+            )
+
+        if file_size == 0:
+            raise ValueError("The uploaded file is empty")
+
         return AppAnnotationService.batch_import_app_annotations(app_id, file)
 
 

api/controllers/console/app/workflow_trigger.py

@@ -114,7 +114,7 @@ class AppTriggersApi(Resource):
 
 @console_ns.route("/apps/<uuid:app_id>/trigger-enable")
 class AppTriggerEnableApi(Resource):
-    @console_ns.expect(console_ns.models[ParserEnable.__name__], validate=True)
+    @console_ns.expect(console_ns.models[ParserEnable.__name__])
     @setup_required
     @login_required
     @account_initialization_required

api/controllers/console/auth/login.py

@@ -22,7 +22,12 @@ from controllers.console.error import (
     NotAllowedCreateWorkspace,
     WorkspacesLimitExceeded,
 )
-from controllers.console.wraps import email_password_login_enabled, setup_required
+from controllers.console.wraps import (
+    decrypt_code_field,
+    decrypt_password_field,
+    email_password_login_enabled,
+    setup_required,
+)
 from events.tenant_event import tenant_was_created
 from libs.helper import EmailStr, extract_remote_ip
 from libs.login import current_account_with_tenant
@@ -79,6 +84,7 @@ class LoginApi(Resource):
     @setup_required
     @email_password_login_enabled
     @console_ns.expect(console_ns.models[LoginPayload.__name__])
+    @decrypt_password_field
     def post(self):
         """Authenticate user and login."""
         args = LoginPayload.model_validate(console_ns.payload)
@@ -218,6 +224,7 @@ class EmailCodeLoginSendEmailApi(Resource):
 class EmailCodeLoginApi(Resource):
     @setup_required
     @console_ns.expect(console_ns.models[EmailCodeLoginPayload.__name__])
+    @decrypt_code_field
     def post(self):
         args = EmailCodeLoginPayload.model_validate(console_ns.payload)
 

api/controllers/console/datasets/data_source.py

@@ -140,6 +140,18 @@ class DataSourceNotionListApi(Resource):
         credential_id = request.args.get("credential_id", default=None, type=str)
         if not credential_id:
             raise ValueError("Credential id is required.")
+
+        # Get datasource_parameters from query string (optional, for GitHub and other datasources)
+        datasource_parameters_str = request.args.get("datasource_parameters", default=None, type=str)
+        datasource_parameters = {}
+        if datasource_parameters_str:
+            try:
+                datasource_parameters = json.loads(datasource_parameters_str)
+                if not isinstance(datasource_parameters, dict):
+                    raise ValueError("datasource_parameters must be a JSON object.")
+            except json.JSONDecodeError:
+                raise ValueError("Invalid datasource_parameters JSON format.")
+
         datasource_provider_service = DatasourceProviderService()
         credential = datasource_provider_service.get_datasource_credentials(
             tenant_id=current_tenant_id,
@@ -187,7 +199,7 @@ class DataSourceNotionListApi(Resource):
             online_document_result: Generator[OnlineDocumentPagesMessage, None, None] = (
                 datasource_runtime.get_online_document_pages(
                     user_id=current_user.id,
-                    datasource_parameters={},
+                    datasource_parameters=datasource_parameters,
                     provider_type=datasource_runtime.datasource_provider_type(),
                 )
             )
@@ -218,14 +230,14 @@ class DataSourceNotionListApi(Resource):
 
 
 @console_ns.route(
-    "/notion/workspaces/<uuid:workspace_id>/pages/<uuid:page_id>/<string:page_type>/preview",
+    "/notion/pages/<uuid:page_id>/<string:page_type>/preview",
     "/datasets/notion-indexing-estimate",
 )
 class DataSourceNotionApi(Resource):
     @setup_required
     @login_required
     @account_initialization_required
-    def get(self, workspace_id, page_id, page_type):
+    def get(self, page_id, page_type):
         _, current_tenant_id = current_account_with_tenant()
 
         credential_id = request.args.get("credential_id", default=None, type=str)
@@ -239,11 +251,10 @@ class DataSourceNotionApi(Resource):
             plugin_id="langgenius/notion_datasource",
         )
 
-        workspace_id = str(workspace_id)
         page_id = str(page_id)
 
         extractor = NotionExtractor(
-            notion_workspace_id=workspace_id,
+            notion_workspace_id="",
             notion_obj_id=page_id,
             notion_page_type=page_type,
             notion_access_token=credential.get("integration_secret"),

api/controllers/console/datasets/datasets.py

@@ -146,7 +146,7 @@ class DatasetUpdatePayload(BaseModel):
     embedding_model: str | None = None
     embedding_model_provider: str | None = None
     retrieval_model: dict[str, Any] | None = None
-    partial_member_list: list[str] | None = None
+    partial_member_list: list[dict[str, str]] | None = None
     external_retrieval_model: dict[str, Any] | None = None
     external_knowledge_id: str | None = None
     external_knowledge_api_id: str | None = None
@@ -223,6 +223,7 @@ def _get_retrieval_methods_by_vector_type(vector_type: str | None, is_mock: bool
         VectorType.COUCHBASE,
         VectorType.OPENGAUSS,
         VectorType.OCEANBASE,
+        VectorType.SEEKDB,
         VectorType.TABLESTORE,
         VectorType.HUAWEI_CLOUD,
         VectorType.TENCENT,
@@ -230,6 +231,7 @@ def _get_retrieval_methods_by_vector_type(vector_type: str | None, is_mock: bool
         VectorType.CLICKZETTA,
         VectorType.BAIDU,
         VectorType.ALIBABACLOUD_MYSQL,
+        VectorType.IRIS,
     }
 
     semantic_methods = {"retrieval_method": [RetrievalMethod.SEMANTIC_SEARCH.value]}

api/controllers/console/datasets/rag_pipeline/datasource_content_preview.py

@@ -26,7 +26,7 @@ console_ns.schema_model(Parser.__name__, Parser.model_json_schema(ref_template=D
 
 @console_ns.route("/rag/pipelines/<uuid:pipeline_id>/workflows/published/datasource/nodes/<string:node_id>/preview")
 class DataSourceContentPreviewApi(Resource):
-    @console_ns.expect(console_ns.models[Parser.__name__], validate=True)
+    @console_ns.expect(console_ns.models[Parser.__name__])
     @setup_required
     @login_required
     @account_initialization_required

api/controllers/console/datasets/rag_pipeline/rag_pipeline_workflow.py

@@ -4,7 +4,7 @@ from typing import Any, Literal, cast
 from uuid import UUID
 
 from flask import abort, request
-from flask_restx import Resource, marshal_with  # type: ignore
+from flask_restx import Resource, marshal_with, reqparse  # type: ignore
 from pydantic import BaseModel, Field
 from sqlalchemy.orm import Session
 from werkzeug.exceptions import Forbidden, InternalServerError, NotFound
@@ -975,6 +975,11 @@ class RagPipelineRecommendedPluginApi(Resource):
     @login_required
     @account_initialization_required
     def get(self):
+        parser = reqparse.RequestParser()
+        parser.add_argument("type", type=str, location="args", required=False, default="all")
+        args = parser.parse_args()
+        type = args["type"]
+
         rag_pipeline_service = RagPipelineService()
-        recommended_plugins = rag_pipeline_service.get_recommended_plugins()
+        recommended_plugins = rag_pipeline_service.get_recommended_plugins(type)
         return recommended_plugins

api/controllers/console/explore/completion.py

@@ -40,7 +40,7 @@ from .. import console_ns
 logger = logging.getLogger(__name__)
 
 
-class CompletionMessagePayload(BaseModel):
+class CompletionMessageExplorePayload(BaseModel):
     inputs: dict[str, Any]
     query: str = ""
     files: list[dict[str, Any]] | None = None
@@ -71,7 +71,7 @@ class ChatMessagePayload(BaseModel):
             raise ValueError("must be a valid UUID") from exc
 
 
-register_schema_models(console_ns, CompletionMessagePayload, ChatMessagePayload)
+register_schema_models(console_ns, CompletionMessageExplorePayload, ChatMessagePayload)
 
 
 # define completion api for user
@@ -80,13 +80,13 @@ register_schema_models(console_ns, CompletionMessagePayload, ChatMessagePayload)
     endpoint="installed_app_completion",
 )
 class CompletionApi(InstalledAppResource):
-    @console_ns.expect(console_ns.models[CompletionMessagePayload.__name__])
+    @console_ns.expect(console_ns.models[CompletionMessageExplorePayload.__name__])
     def post(self, installed_app):
         app_model = installed_app.app
         if app_model.mode != AppMode.COMPLETION:
             raise NotCompletionAppError()
 
-        payload = CompletionMessagePayload.model_validate(console_ns.payload or {})
+        payload = CompletionMessageExplorePayload.model_validate(console_ns.payload or {})
         args = payload.model_dump(exclude_none=True)
 
         streaming = payload.response_mode == "streaming"

api/controllers/console/tag/tags.py

@@ -1,31 +1,40 @@
+from typing import Literal
+
 from flask import request
-from flask_restx import Resource, marshal_with, reqparse
+from flask_restx import Resource, marshal_with
+from pydantic import BaseModel, Field
 from werkzeug.exceptions import Forbidden
 
+from controllers.common.schema import register_schema_models
 from controllers.console import console_ns
 from controllers.console.wraps import account_initialization_required, edit_permission_required, setup_required
 from fields.tag_fields import dataset_tag_fields
 from libs.login import current_account_with_tenant, login_required
-from models.model import Tag
 from services.tag_service import TagService
 
 
-def _validate_name(name):
-    if not name or len(name) < 1 or len(name) > 50:
-        raise ValueError("Name must be between 1 to 50 characters.")
-    return name
+class TagBasePayload(BaseModel):
+    name: str = Field(description="Tag name", min_length=1, max_length=50)
+    type: Literal["knowledge", "app"] | None = Field(default=None, description="Tag type")
 
 
-parser_tags = (
-    reqparse.RequestParser()
-    .add_argument(
-        "name",
-        nullable=False,
-        required=True,
-        help="Name must be between 1 to 50 characters.",
-        type=_validate_name,
-    )
-    .add_argument("type", type=str, location="json", choices=Tag.TAG_TYPE_LIST, nullable=True, help="Invalid tag type.")
+class TagBindingPayload(BaseModel):
+    tag_ids: list[str] = Field(description="Tag IDs to bind")
+    target_id: str = Field(description="Target ID to bind tags to")
+    type: Literal["knowledge", "app"] | None = Field(default=None, description="Tag type")
+
+
+class TagBindingRemovePayload(BaseModel):
+    tag_id: str = Field(description="Tag ID to remove")
+    target_id: str = Field(description="Target ID to unbind tag from")
+    type: Literal["knowledge", "app"] | None = Field(default=None, description="Tag type")
+
+
+register_schema_models(
+    console_ns,
+    TagBasePayload,
+    TagBindingPayload,
+    TagBindingRemovePayload,
 )
 
 
@@ -43,7 +52,7 @@ class TagListApi(Resource):
 
         return tags, 200
 
-    @console_ns.expect(parser_tags)
+    @console_ns.expect(console_ns.models[TagBasePayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -53,22 +62,17 @@ class TagListApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_tags.parse_args()
-        tag = TagService.save_tags(args)
+        payload = TagBasePayload.model_validate(console_ns.payload or {})
+        tag = TagService.save_tags(payload.model_dump())
 
         response = {"id": tag.id, "name": tag.name, "type": tag.type, "binding_count": 0}
 
         return response, 200
 
 
-parser_tag_id = reqparse.RequestParser().add_argument(
-    "name", nullable=False, required=True, help="Name must be between 1 to 50 characters.", type=_validate_name
-)
-
-
 @console_ns.route("/tags/<uuid:tag_id>")
 class TagUpdateDeleteApi(Resource):
-    @console_ns.expect(parser_tag_id)
+    @console_ns.expect(console_ns.models[TagBasePayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -79,8 +83,8 @@ class TagUpdateDeleteApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_tag_id.parse_args()
-        tag = TagService.update_tags(args, tag_id)
+        payload = TagBasePayload.model_validate(console_ns.payload or {})
+        tag = TagService.update_tags(payload.model_dump(), tag_id)
 
         binding_count = TagService.get_tag_binding_count(tag_id)
 
@@ -100,17 +104,9 @@ class TagUpdateDeleteApi(Resource):
         return 204
 
 
-parser_create = (
-    reqparse.RequestParser()
-    .add_argument("tag_ids", type=list, nullable=False, required=True, location="json", help="Tag IDs is required.")
-    .add_argument("target_id", type=str, nullable=False, required=True, location="json", help="Target ID is required.")
-    .add_argument("type", type=str, location="json", choices=Tag.TAG_TYPE_LIST, nullable=True, help="Invalid tag type.")
-)
-
-
 @console_ns.route("/tag-bindings/create")
 class TagBindingCreateApi(Resource):
-    @console_ns.expect(parser_create)
+    @console_ns.expect(console_ns.models[TagBindingPayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -120,23 +116,15 @@ class TagBindingCreateApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_create.parse_args()
-        TagService.save_tag_binding(args)
+        payload = TagBindingPayload.model_validate(console_ns.payload or {})
+        TagService.save_tag_binding(payload.model_dump())
 
         return {"result": "success"}, 200
 
 
-parser_remove = (
-    reqparse.RequestParser()
-    .add_argument("tag_id", type=str, nullable=False, required=True, help="Tag ID is required.")
-    .add_argument("target_id", type=str, nullable=False, required=True, help="Target ID is required.")
-    .add_argument("type", type=str, location="json", choices=Tag.TAG_TYPE_LIST, nullable=True, help="Invalid tag type.")
-)
-
-
 @console_ns.route("/tag-bindings/remove")
 class TagBindingDeleteApi(Resource):
-    @console_ns.expect(parser_remove)
+    @console_ns.expect(console_ns.models[TagBindingRemovePayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -146,7 +134,7 @@ class TagBindingDeleteApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_remove.parse_args()
-        TagService.delete_tag_binding(args)
+        payload = TagBindingRemovePayload.model_validate(console_ns.payload or {})
+        TagService.delete_tag_binding(payload.model_dump())
 
         return {"result": "success"}, 200

api/controllers/console/workspace/models.py

@@ -282,9 +282,10 @@ class ModelProviderModelCredentialApi(Resource):
                 tenant_id=tenant_id, provider_name=provider
             )
         else:
-            model_type = args.model_type
+            # Normalize model_type to the origin value stored in DB (e.g., "text-generation" for LLM)
+            normalized_model_type = args.model_type.to_origin_model_type()
             available_credentials = model_provider_service.provider_manager.get_provider_model_available_credentials(
-                tenant_id=tenant_id, provider_name=provider, model_type=model_type, model_name=args.model
+                tenant_id=tenant_id, provider_name=provider, model_type=normalized_model_type, model_name=args.model
             )
 
         return jsonable_encoder(

api/controllers/console/workspace/plugin.py

@@ -46,8 +46,8 @@ class PluginDebuggingKeyApi(Resource):
 
 
 class ParserList(BaseModel):
-    page: int = Field(default=1)
-    page_size: int = Field(default=256)
+    page: int = Field(default=1, ge=1, description="Page number")
+    page_size: int = Field(default=256, ge=1, le=256, description="Page size (1-256)")
 
 
 reg(ParserList)
@@ -106,8 +106,8 @@ class ParserPluginIdentifierQuery(BaseModel):
 
 
 class ParserTasks(BaseModel):
-    page: int
-    page_size: int
+    page: int = Field(default=1, ge=1, description="Page number")
+    page_size: int = Field(default=256, ge=1, le=256, description="Page size (1-256)")
 
 
 class ParserMarketplaceUpgrade(BaseModel):

api/controllers/console/wraps.py

@@ -9,10 +9,12 @@ from typing import ParamSpec, TypeVar
 from flask import abort, request
 
 from configs import dify_config
+from controllers.console.auth.error import AuthenticationFailedError, EmailCodeError
 from controllers.console.workspace.error import AccountNotInitializedError
 from enums.cloud_plan import CloudPlan
 from extensions.ext_database import db
 from extensions.ext_redis import redis_client
+from libs.encryption import FieldEncryption
 from libs.login import current_account_with_tenant
 from models.account import AccountStatus
 from models.dataset import RateLimitLog
@@ -25,6 +27,14 @@ from .error import NotInitValidateError, NotSetupError, UnauthorizedAndForceLogo
 P = ParamSpec("P")
 R = TypeVar("R")
 
+# Field names for decryption
+FIELD_NAME_PASSWORD = "password"
+FIELD_NAME_CODE = "code"
+
+# Error messages for decryption failures
+ERROR_MSG_INVALID_ENCRYPTED_DATA = "Invalid encrypted data"
+ERROR_MSG_INVALID_ENCRYPTED_CODE = "Invalid encrypted code"
+
 
 def account_initialization_required(view: Callable[P, R]):
     @wraps(view)
@@ -331,3 +341,163 @@ def is_admin_or_owner_required(f: Callable[P, R]):
         return f(*args, **kwargs)
 
     return decorated_function
+
+
+def annotation_import_rate_limit(view: Callable[P, R]):
+    """
+    Rate limiting decorator for annotation import operations.
+
+    Implements sliding window rate limiting with two tiers:
+    - Short-term: Configurable requests per minute (default: 5)
+    - Long-term: Configurable requests per hour (default: 20)
+
+    Uses Redis ZSET for distributed rate limiting across multiple instances.
+    """
+
+    @wraps(view)
+    def decorated(*args: P.args, **kwargs: P.kwargs):
+        _, current_tenant_id = current_account_with_tenant()
+        current_time = int(time.time() * 1000)
+
+        # Check per-minute rate limit
+        minute_key = f"annotation_import_rate_limit:{current_tenant_id}:1min"
+        redis_client.zadd(minute_key, {current_time: current_time})
+        redis_client.zremrangebyscore(minute_key, 0, current_time - 60000)
+        minute_count = redis_client.zcard(minute_key)
+        redis_client.expire(minute_key, 120)  # 2 minutes TTL
+
+        if minute_count > dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE:
+            abort(
+                429,
+                f"Too many annotation import requests. Maximum {dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE} "
+                f"requests per minute allowed. Please try again later.",
+            )
+
+        # Check per-hour rate limit
+        hour_key = f"annotation_import_rate_limit:{current_tenant_id}:1hour"
+        redis_client.zadd(hour_key, {current_time: current_time})
+        redis_client.zremrangebyscore(hour_key, 0, current_time - 3600000)
+        hour_count = redis_client.zcard(hour_key)
+        redis_client.expire(hour_key, 7200)  # 2 hours TTL
+
+        if hour_count > dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR:
+            abort(
+                429,
+                f"Too many annotation import requests. Maximum {dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR} "
+                f"requests per hour allowed. Please try again later.",
+            )
+
+        return view(*args, **kwargs)
+
+    return decorated
+
+
+def annotation_import_concurrency_limit(view: Callable[P, R]):
+    """
+    Concurrency control decorator for annotation import operations.
+
+    Limits the number of concurrent import tasks per tenant to prevent
+    resource exhaustion and ensure fair resource allocation.
+
+    Uses Redis ZSET to track active import jobs with automatic cleanup
+    of stale entries (jobs older than 2 minutes).
+    """
+
+    @wraps(view)
+    def decorated(*args: P.args, **kwargs: P.kwargs):
+        _, current_tenant_id = current_account_with_tenant()
+        current_time = int(time.time() * 1000)
+
+        active_jobs_key = f"annotation_import_active:{current_tenant_id}"
+
+        # Clean up stale entries (jobs that should have completed or timed out)
+        stale_threshold = current_time - 120000  # 2 minutes ago
+        redis_client.zremrangebyscore(active_jobs_key, 0, stale_threshold)
+
+        # Check current active job count
+        active_count = redis_client.zcard(active_jobs_key)
+
+        if active_count >= dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT:
+            abort(
+                429,
+                f"Too many concurrent import tasks. Maximum {dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT} "
+                f"concurrent imports allowed per workspace. Please wait for existing imports to complete.",
+            )
+
+        # Allow the request to proceed
+        # The actual job registration will happen in the service layer
+        return view(*args, **kwargs)
+
+    return decorated
+
+
+def _decrypt_field(field_name: str, error_class: type[Exception], error_message: str) -> None:
+    """
+    Helper to decode a Base64 encoded field in the request payload.
+
+    Args:
+        field_name: Name of the field to decode
+        error_class: Exception class to raise on decoding failure
+        error_message: Error message to include in the exception
+    """
+    if not request or not request.is_json:
+        return
+    # Get the payload dict - it's cached and mutable
+    payload = request.get_json()
+    if not payload or field_name not in payload:
+        return
+    encoded_value = payload[field_name]
+    decoded_value = FieldEncryption.decrypt_field(encoded_value)
+
+    # If decoding failed, raise error immediately
+    if decoded_value is None:
+        raise error_class(error_message)
+
+    # Update payload dict in-place with decoded value
+    # Since payload is a mutable dict and get_json() returns the cached reference,
+    # modifying it will affect all subsequent accesses including console_ns.payload
+    payload[field_name] = decoded_value
+
+
+def decrypt_password_field(view: Callable[P, R]):
+    """
+    Decorator to decrypt password field in request payload.
+
+    Automatically decrypts the 'password' field if encryption is enabled.
+    If decryption fails, raises AuthenticationFailedError.
+
+    Usage:
+        @decrypt_password_field
+        def post(self):
+            args = LoginPayload.model_validate(console_ns.payload)
+            # args.password is now decrypted
+    """
+
+    @wraps(view)
+    def decorated(*args: P.args, **kwargs: P.kwargs):
+        _decrypt_field(FIELD_NAME_PASSWORD, AuthenticationFailedError, ERROR_MSG_INVALID_ENCRYPTED_DATA)
+        return view(*args, **kwargs)
+
+    return decorated
+
+
+def decrypt_code_field(view: Callable[P, R]):
+    """
+    Decorator to decrypt verification code field in request payload.
+
+    Automatically decrypts the 'code' field if encryption is enabled.
+    If decryption fails, raises EmailCodeError.
+
+    Usage:
+        @decrypt_code_field
+        def post(self):
+            args = EmailCodeLoginPayload.model_validate(console_ns.payload)
+            # args.code is now decrypted
+    """
+
+    @wraps(view)
+    def decorated(*args: P.args, **kwargs: P.kwargs):
+        _decrypt_field(FIELD_NAME_CODE, EmailCodeError, ERROR_MSG_INVALID_ENCRYPTED_CODE)
+        return view(*args, **kwargs)
+
+    return decorated

api/controllers/service_api/app/completion.py

@@ -61,6 +61,9 @@ class ChatRequestPayload(BaseModel):
     @classmethod
     def normalize_conversation_id(cls, value: str | UUID | None) -> str | None:
         """Allow missing or blank conversation IDs; enforce UUID format when provided."""
+        if isinstance(value, str):
+            value = value.strip()
+
         if not value:
             return None
 

api/controllers/service_api/dataset/dataset.py

@@ -49,7 +49,7 @@ class DatasetUpdatePayload(BaseModel):
     embedding_model: str | None = None
     embedding_model_provider: str | None = None
     retrieval_model: RetrievalModel | None = None
-    partial_member_list: list[str] | None = None
+    partial_member_list: list[dict[str, str]] | None = None
     external_retrieval_model: dict[str, Any] | None = None
     external_knowledge_id: str | None = None
     external_knowledge_api_id: str | None = None

api/controllers/trigger/trigger.py

@@ -33,7 +33,7 @@ def trigger_endpoint(endpoint_id: str):
             if response:
                 break
         if not response:
-            logger.error("Endpoint not found for {endpoint_id}")
+            logger.info("Endpoint not found for %s", endpoint_id)
             return jsonify({"error": "Endpoint not found"}), 404
         return response
     except ValueError as e:

api/controllers/web/audio.py

@@ -1,7 +1,8 @@
 import logging
 
 from flask import request
-from flask_restx import fields, marshal_with, reqparse
+from flask_restx import fields, marshal_with
+from pydantic import BaseModel, field_validator
 from werkzeug.exceptions import InternalServerError
 
 import services
@@ -20,6 +21,7 @@ from controllers.web.error import (
 from controllers.web.wraps import WebApiResource
 from core.errors.error import ModelCurrentlyNotSupportError, ProviderTokenNotInitError, QuotaExceededError
 from core.model_runtime.errors.invoke import InvokeError
+from libs.helper import uuid_value
 from models.model import App
 from services.audio_service import AudioService
 from services.errors.audio import (
@@ -29,6 +31,25 @@ from services.errors.audio import (
     UnsupportedAudioTypeServiceError,
 )
 
+from ..common.schema import register_schema_models
+
+
+class TextToAudioPayload(BaseModel):
+    message_id: str | None = None
+    voice: str | None = None
+    text: str | None = None
+    streaming: bool | None = None
+
+    @field_validator("message_id")
+    @classmethod
+    def validate_message_id(cls, value: str | None) -> str | None:
+        if value is None:
+            return value
+        return uuid_value(value)
+
+
+register_schema_models(web_ns, TextToAudioPayload)
+
 logger = logging.getLogger(__name__)
 
 
@@ -88,6 +109,7 @@ class AudioApi(WebApiResource):
 
 @web_ns.route("/text-to-audio")
 class TextApi(WebApiResource):
+    @web_ns.expect(web_ns.models[TextToAudioPayload.__name__])
     @web_ns.doc("Text to Audio")
     @web_ns.doc(description="Convert text to audio using text-to-speech service.")
     @web_ns.doc(
@@ -102,18 +124,11 @@ class TextApi(WebApiResource):
     def post(self, app_model: App, end_user):
         """Convert text to audio"""
         try:
-            parser = (
-                reqparse.RequestParser()
-                .add_argument("message_id", type=str, required=False, location="json")
-                .add_argument("voice", type=str, location="json")
-                .add_argument("text", type=str, location="json")
-                .add_argument("streaming", type=bool, location="json")
-            )
-            args = parser.parse_args()
+            payload = TextToAudioPayload.model_validate(web_ns.payload or {})
 
-            message_id = args.get("message_id", None)
-            text = args.get("text", None)
-            voice = args.get("voice", None)
+            message_id = payload.message_id
+            text = payload.text
+            voice = payload.voice
             response = AudioService.transcript_tts(
                 app_model=app_model, text=text, voice=voice, end_user=end_user.external_user_id, message_id=message_id
             )

api/controllers/web/completion.py

@@ -1,9 +1,11 @@
 import logging
+from typing import Any, Literal
 
-from flask_restx import reqparse
+from pydantic import BaseModel, Field, field_validator
 from werkzeug.exceptions import InternalServerError, NotFound
 
 import services
+from controllers.common.schema import register_schema_models
 from controllers.web import web_ns
 from controllers.web.error import (
     AppUnavailableError,
@@ -34,25 +36,44 @@ from services.errors.llm import InvokeRateLimitError
 logger = logging.getLogger(__name__)
 
 
+class CompletionMessagePayload(BaseModel):
+    inputs: dict[str, Any] = Field(description="Input variables for the completion")
+    query: str = Field(default="", description="Query text for completion")
+    files: list[dict[str, Any]] | None = Field(default=None, description="Files to be processed")
+    response_mode: Literal["blocking", "streaming"] | None = Field(
+        default=None, description="Response mode: blocking or streaming"
+    )
+    retriever_from: str = Field(default="web_app", description="Source of retriever")
+
+
+class ChatMessagePayload(BaseModel):
+    inputs: dict[str, Any] = Field(description="Input variables for the chat")
+    query: str = Field(description="User query/message")
+    files: list[dict[str, Any]] | None = Field(default=None, description="Files to be processed")
+    response_mode: Literal["blocking", "streaming"] | None = Field(
+        default=None, description="Response mode: blocking or streaming"
+    )
+    conversation_id: str | None = Field(default=None, description="Conversation ID")
+    parent_message_id: str | None = Field(default=None, description="Parent message ID")
+    retriever_from: str = Field(default="web_app", description="Source of retriever")
+
+    @field_validator("conversation_id", "parent_message_id")
+    @classmethod
+    def validate_uuid(cls, value: str | None) -> str | None:
+        if value is None:
+            return value
+        return uuid_value(value)
+
+
+register_schema_models(web_ns, CompletionMessagePayload, ChatMessagePayload)
+
+
 # define completion api for user
 @web_ns.route("/completion-messages")
 class CompletionApi(WebApiResource):
     @web_ns.doc("Create Completion Message")
     @web_ns.doc(description="Create a completion message for text generation applications.")
-    @web_ns.doc(
-        params={
-            "inputs": {"description": "Input variables for the completion", "type": "object", "required": True},
-            "query": {"description": "Query text for completion", "type": "string", "required": False},
-            "files": {"description": "Files to be processed", "type": "array", "required": False},
-            "response_mode": {
-                "description": "Response mode: blocking or streaming",
-                "type": "string",
-                "enum": ["blocking", "streaming"],
-                "required": False,
-            },
-            "retriever_from": {"description": "Source of retriever", "type": "string", "required": False},
-        }
-    )
+    @web_ns.expect(web_ns.models[CompletionMessagePayload.__name__])
     @web_ns.doc(
         responses={
             200: "Success",
@@ -67,18 +88,10 @@ class CompletionApi(WebApiResource):
         if app_model.mode != AppMode.COMPLETION:
             raise NotCompletionAppError()
 
-        parser = (
-            reqparse.RequestParser()
-            .add_argument("inputs", type=dict, required=True, location="json")
-            .add_argument("query", type=str, location="json", default="")
-            .add_argument("files", type=list, required=False, location="json")
-            .add_argument("response_mode", type=str, choices=["blocking", "streaming"], location="json")
-            .add_argument("retriever_from", type=str, required=False, default="web_app", location="json")
-        )
+        payload = CompletionMessagePayload.model_validate(web_ns.payload or {})
+        args = payload.model_dump(exclude_none=True)
 
-        args = parser.parse_args()
-
-        streaming = args["response_mode"] == "streaming"
+        streaming = payload.response_mode == "streaming"
         args["auto_generate_name"] = False
 
         try:
@@ -142,22 +155,7 @@ class CompletionStopApi(WebApiResource):
 class ChatApi(WebApiResource):
     @web_ns.doc("Create Chat Message")
     @web_ns.doc(description="Create a chat message for conversational applications.")
-    @web_ns.doc(
-        params={
-            "inputs": {"description": "Input variables for the chat", "type": "object", "required": True},
-            "query": {"description": "User query/message", "type": "string", "required": True},
-            "files": {"description": "Files to be processed", "type": "array", "required": False},
-            "response_mode": {
-                "description": "Response mode: blocking or streaming",
-                "type": "string",
-                "enum": ["blocking", "streaming"],
-                "required": False,
-            },
-            "conversation_id": {"description": "Conversation UUID", "type": "string", "required": False},
-            "parent_message_id": {"description": "Parent message UUID", "type": "string", "required": False},
-            "retriever_from": {"description": "Source of retriever", "type": "string", "required": False},
-        }
-    )
+    @web_ns.expect(web_ns.models[ChatMessagePayload.__name__])
     @web_ns.doc(
         responses={
             200: "Success",
@@ -173,20 +171,10 @@ class ChatApi(WebApiResource):
         if app_mode not in {AppMode.CHAT, AppMode.AGENT_CHAT, AppMode.ADVANCED_CHAT}:
             raise NotChatAppError()
 
-        parser = (
-            reqparse.RequestParser()
-            .add_argument("inputs", type=dict, required=True, location="json")
-            .add_argument("query", type=str, required=True, location="json")
-            .add_argument("files", type=list, required=False, location="json")
-            .add_argument("response_mode", type=str, choices=["blocking", "streaming"], location="json")
-            .add_argument("conversation_id", type=uuid_value, location="json")
-            .add_argument("parent_message_id", type=uuid_value, required=False, location="json")
-            .add_argument("retriever_from", type=str, required=False, default="web_app", location="json")
-        )
+        payload = ChatMessagePayload.model_validate(web_ns.payload or {})
+        args = payload.model_dump(exclude_none=True)
 
-        args = parser.parse_args()
-
-        streaming = args["response_mode"] == "streaming"
+        streaming = payload.response_mode == "streaming"
         args["auto_generate_name"] = False
 
         try:

api/core/app/app_config/entities.py

@@ -1,3 +1,4 @@
+import json
 from collections.abc import Sequence
 from enum import StrEnum, auto
 from typing import Any, Literal
@@ -120,7 +121,7 @@ class VariableEntity(BaseModel):
     allowed_file_types: Sequence[FileType] | None = Field(default_factory=list)
     allowed_file_extensions: Sequence[str] | None = Field(default_factory=list)
     allowed_file_upload_methods: Sequence[FileTransferMethod] | None = Field(default_factory=list)
-    json_schema: dict[str, Any] | None = Field(default=None)
+    json_schema: str | None = Field(default=None)
 
     @field_validator("description", mode="before")
     @classmethod
@@ -134,11 +135,17 @@ class VariableEntity(BaseModel):
 
     @field_validator("json_schema")
     @classmethod
-    def validate_json_schema(cls, schema: dict[str, Any] | None) -> dict[str, Any] | None:
+    def validate_json_schema(cls, schema: str | None) -> str | None:
         if schema is None:
             return None
+
         try:
-            Draft7Validator.check_schema(schema)
+            json_schema = json.loads(schema)
+        except json.JSONDecodeError:
+            raise ValueError(f"invalid json_schema value {schema}")
+
+        try:
+            Draft7Validator.check_schema(json_schema)
         except SchemaError as e:
             raise ValueError(f"Invalid JSON schema: {e.message}")
         return schema

api/core/app/apps/base_app_generator.py

@@ -1,3 +1,4 @@
+import json
 from collections.abc import Generator, Mapping, Sequence
 from typing import TYPE_CHECKING, Any, Union, final
 
@@ -175,6 +176,13 @@ class BaseAppGenerator:
                         value = True
                     elif value == 0:
                         value = False
+            case VariableEntityType.JSON_OBJECT:
+                if not isinstance(value, str):
+                    raise ValueError(f"{variable_entity.variable} in input form must be a string")
+                try:
+                    json.loads(value)
+                except json.JSONDecodeError:
+                    raise ValueError(f"{variable_entity.variable} in input form must be a valid JSON object")
             case _:
                 raise AssertionError("this statement should be unreachable.")
 

api/core/app/task_pipeline/easy_ui_based_generate_task_pipeline.py

@@ -342,9 +342,11 @@ class EasyUIBasedGenerateTaskPipeline(BasedGenerateTaskPipeline):
                 self._task_state.llm_result.message.content = current_content
 
                 if isinstance(event, QueueLLMChunkEvent):
+                    event_type = self._message_cycle_manager.get_message_event_type(message_id=self._message_id)
                     yield self._message_cycle_manager.message_to_stream_response(
                         answer=cast(str, delta_text),
                         message_id=self._message_id,
+                        event_type=event_type,
                     )
                 else:
                     yield self._agent_message_to_stream_response(

api/core/app/task_pipeline/message_cycle_manager.py

@@ -5,7 +5,7 @@ from threading import Thread
 from typing import Union
 
 from flask import Flask, current_app
-from sqlalchemy import select
+from sqlalchemy import exists, select
 from sqlalchemy.orm import Session
 
 from configs import dify_config
@@ -54,6 +54,20 @@ class MessageCycleManager:
     ):
         self._application_generate_entity = application_generate_entity
         self._task_state = task_state
+        self._message_has_file: set[str] = set()
+
+    def get_message_event_type(self, message_id: str) -> StreamEvent:
+        if message_id in self._message_has_file:
+            return StreamEvent.MESSAGE_FILE
+
+        with Session(db.engine, expire_on_commit=False) as session:
+            has_file = session.query(exists().where(MessageFile.message_id == message_id)).scalar()
+
+        if has_file:
+            self._message_has_file.add(message_id)
+            return StreamEvent.MESSAGE_FILE
+
+        return StreamEvent.MESSAGE
 
     def generate_conversation_name(self, *, conversation_id: str, query: str) -> Thread | None:
         """
@@ -214,7 +228,11 @@ class MessageCycleManager:
         return None
 
     def message_to_stream_response(
-        self, answer: str, message_id: str, from_variable_selector: list[str] | None = None
+        self,
+        answer: str,
+        message_id: str,
+        from_variable_selector: list[str] | None = None,
+        event_type: StreamEvent | None = None,
     ) -> MessageStreamResponse:
         """
         Message to stream response.
@@ -222,16 +240,12 @@ class MessageCycleManager:
         :param message_id: message id
         :return:
         """
-        with Session(db.engine, expire_on_commit=False) as session:
-            message_file = session.scalar(select(MessageFile).where(MessageFile.id == message_id))
-        event_type = StreamEvent.MESSAGE_FILE if message_file else StreamEvent.MESSAGE
-
         return MessageStreamResponse(
             task_id=self._application_generate_entity.task_id,
             id=message_id,
             answer=answer,
             from_variable_selector=from_variable_selector,
-            event=event_type,
+            event=event_type or StreamEvent.MESSAGE,
         )
 
     def message_replace_to_stream_response(self, answer: str, reason: str = "") -> MessageReplaceStreamResponse:

api/core/db/session_factory.py

@@ -0,0 +1,38 @@
+from sqlalchemy import Engine
+from sqlalchemy.orm import Session, sessionmaker
+
+_session_maker: sessionmaker | None = None
+
+
+def configure_session_factory(engine: Engine, expire_on_commit: bool = False):
+    """Configure the global session factory"""
+    global _session_maker
+    _session_maker = sessionmaker(bind=engine, expire_on_commit=expire_on_commit)
+
+
+def get_session_maker() -> sessionmaker:
+    if _session_maker is None:
+        raise RuntimeError("Session factory not configured. Call configure_session_factory() first.")
+    return _session_maker
+
+
+def create_session() -> Session:
+    return get_session_maker()()
+
+
+# Class wrapper for convenience
+class SessionFactory:
+    @staticmethod
+    def configure(engine: Engine, expire_on_commit: bool = False):
+        configure_session_factory(engine, expire_on_commit)
+
+    @staticmethod
+    def get_session_maker() -> sessionmaker:
+        return get_session_maker()
+
+    @staticmethod
+    def create_session() -> Session:
+        return create_session()
+
+
+session_factory = SessionFactory()

api/core/entities/knowledge_entities.py

@@ -1,4 +1,4 @@
-from pydantic import BaseModel, Field
+from pydantic import BaseModel, Field, field_validator
 
 
 class PreviewDetail(BaseModel):
@@ -20,9 +20,17 @@ class IndexingEstimate(BaseModel):
 class PipelineDataset(BaseModel):
     id: str
     name: str
-    description: str | None = Field(default="", description="knowledge dataset description")
+    description: str = Field(default="", description="knowledge dataset description")
     chunk_structure: str
 
+    @field_validator("description", mode="before")
+    @classmethod
+    def normalize_description(cls, value: str | None) -> str:
+        """Coerce None to empty string so description is always a string."""
+        if value is None:
+            return ""
+        return value
+
 
 class PipelineDocument(BaseModel):
     id: str

api/core/entities/mcp_provider.py

@@ -213,12 +213,23 @@ class MCPProviderEntity(BaseModel):
         return None
 
     def retrieve_tokens(self) -> OAuthTokens | None:
-        """OAuth tokens if available"""
+        """Retrieve OAuth tokens if authentication is complete.
+
+        Returns:
+            OAuthTokens if the provider has been authenticated, None otherwise.
+        """
         if not self.credentials:
             return None
         credentials = self.decrypt_credentials()
+        access_token = credentials.get("access_token", "")
+        # Return None if access_token is empty to avoid generating invalid "Authorization: Bearer " header.
+        # Note: We don't check for whitespace-only strings here because:
+        # 1. OAuth servers don't return whitespace-only access tokens in practice
+        # 2. Even if they did, the server would return 401, triggering the OAuth flow correctly
+        if not access_token:
+            return None
         return OAuthTokens(
-            access_token=credentials.get("access_token", ""),
+            access_token=access_token,
             token_type=credentials.get("token_type", DEFAULT_TOKEN_TYPE),
             expires_in=int(credentials.get("expires_in", str(DEFAULT_EXPIRES_IN)) or DEFAULT_EXPIRES_IN),
             refresh_token=credentials.get("refresh_token", ""),

api/core/helper/csv_sanitizer.py

@@ -0,0 +1,89 @@
+"""CSV sanitization utilities to prevent formula injection attacks."""
+
+from typing import Any
+
+
+class CSVSanitizer:
+    """
+    Sanitizer for CSV export to prevent formula injection attacks.
+
+    This class provides methods to sanitize data before CSV export by escaping
+    characters that could be interpreted as formulas by spreadsheet applications
+    (Excel, LibreOffice, Google Sheets).
+
+    Formula injection occurs when user-controlled data starting with special
+    characters (=, +, -, @, tab, carriage return) is exported to CSV and opened
+    in a spreadsheet application, potentially executing malicious commands.
+    """
+
+    # Characters that can start a formula in Excel/LibreOffice/Google Sheets
+    FORMULA_CHARS = frozenset({"=", "+", "-", "@", "\t", "\r"})
+
+    @classmethod
+    def sanitize_value(cls, value: Any) -> str:
+        """
+        Sanitize a value for safe CSV export.
+
+        Prefixes formula-initiating characters with a single quote to prevent
+        Excel/LibreOffice/Google Sheets from treating them as formulas.
+
+        Args:
+            value: The value to sanitize (will be converted to string)
+
+        Returns:
+            Sanitized string safe for CSV export
+
+        Examples:
+            >>> CSVSanitizer.sanitize_value("=1+1")
+            "'=1+1"
+            >>> CSVSanitizer.sanitize_value("Hello World")
+            "Hello World"
+            >>> CSVSanitizer.sanitize_value(None)
+            ""
+        """
+        if value is None:
+            return ""
+
+        # Convert to string
+        str_value = str(value)
+
+        # If empty, return as is
+        if not str_value:
+            return ""
+
+        # Check if first character is a formula initiator
+        if str_value[0] in cls.FORMULA_CHARS:
+            # Prefix with single quote to escape
+            return f"'{str_value}"
+
+        return str_value
+
+    @classmethod
+    def sanitize_dict(cls, data: dict[str, Any], fields_to_sanitize: list[str] | None = None) -> dict[str, Any]:
+        """
+        Sanitize specified fields in a dictionary.
+
+        Args:
+            data: Dictionary containing data to sanitize
+            fields_to_sanitize: List of field names to sanitize.
+                               If None, sanitizes all string fields.
+
+        Returns:
+            Dictionary with sanitized values (creates a shallow copy)
+
+        Examples:
+            >>> data = {"question": "=1+1", "answer": "+calc", "id": "123"}
+            >>> CSVSanitizer.sanitize_dict(data, ["question", "answer"])
+            {"question": "'=1+1", "answer": "'+calc", "id": "123"}
+        """
+        sanitized = data.copy()
+
+        if fields_to_sanitize is None:
+            # Sanitize all string fields
+            fields_to_sanitize = [k for k, v in data.items() if isinstance(v, str)]
+
+        for field in fields_to_sanitize:
+            if field in sanitized:
+                sanitized[field] = cls.sanitize_value(sanitized[field])
+
+        return sanitized

api/core/helper/ssrf_proxy.py

@@ -9,6 +9,7 @@ import httpx
 
 from configs import dify_config
 from core.helper.http_client_pooling import get_pooled_http_client
+from core.tools.errors import ToolSSRFError
 
 logger = logging.getLogger(__name__)
 
@@ -93,6 +94,18 @@ def make_request(method, url, max_retries=SSRF_DEFAULT_MAX_RETRIES, **kwargs):
     while retries <= max_retries:
         try:
             response = client.request(method=method, url=url, **kwargs)
+            # Check for SSRF protection by Squid proxy
+            if response.status_code in (401, 403):
+                # Check if this is a Squid SSRF rejection
+                server_header = response.headers.get("server", "").lower()
+                via_header = response.headers.get("via", "").lower()
+
+                # Squid typically identifies itself in Server or Via headers
+                if "squid" in server_header or "squid" in via_header:
+                    raise ToolSSRFError(
+                        f"Access to '{url}' was blocked by SSRF protection. "
+                        f"The URL may point to a private or local network address. "
+                    )
 
             if response.status_code not in STATUS_FORCELIST:
                 return response

api/core/llm_generator/llm_generator.py

@@ -72,15 +72,22 @@ class LLMGenerator:
                 prompt_messages=list(prompts), model_parameters={"max_tokens": 500, "temperature": 1}, stream=False
             )
         answer = cast(str, response.message.content)
-        cleaned_answer = re.sub(r"^.*(\{.*\}).*$", r"\1", answer, flags=re.DOTALL)
-        if cleaned_answer is None:
+        if answer is None:
             return ""
         try:
-            result_dict = json.loads(cleaned_answer)
-            answer = result_dict["Your Output"]
+            result_dict = json.loads(answer)
         except json.JSONDecodeError:
-            logger.exception("Failed to generate name after answer, use query instead")
+            result_dict = json_repair.loads(answer)
+
+        if not isinstance(result_dict, dict):
             answer = query
+        else:
+            output = result_dict.get("Your Output")
+            if isinstance(output, str) and output.strip():
+                answer = output.strip()
+            else:
+                answer = query
+
         name = answer.strip()
 
         if len(name) > 75:

api/core/model_runtime/README.md

@@ -18,34 +18,20 @@ This module provides the interface for invoking and authenticating various model
 
 - Model provider display
 
-  ![image-20231210143654461](./docs/en_US/images/index/image-20231210143654461.png)
-
-  Displays a list of all supported providers, including provider names, icons, supported model types list, predefined model list, configuration method, and credentials form rules, etc. For detailed rule design, see: [Schema](./docs/en_US/schema.md).
+  Displays a list of all supported providers, including provider names, icons, supported model types list, predefined model list, configuration method, and credentials form rules, etc.
 
 - Selectable model list display
 
-  ![image-20231210144229650](./docs/en_US/images/index/image-20231210144229650.png)
-
   After configuring provider/model credentials, the dropdown (application orchestration interface/default model) allows viewing of the available LLM list. Greyed out items represent predefined model lists from providers without configured credentials, facilitating user review of supported models.
 
-  In addition, this list also returns configurable parameter information and rules for LLM, as shown below:
-
-  ![image-20231210144814617](./docs/en_US/images/index/image-20231210144814617.png)
-
-  These parameters are all defined in the backend, allowing different settings for various parameters supported by different models, as detailed in: [Schema](./docs/en_US/schema.md#ParameterRule).
+  In addition, this list also returns configurable parameter information and rules for LLM. These parameters are all defined in the backend, allowing different settings for various parameters supported by different models.
 
 - Provider/model credential authentication
 
-  ![image-20231210151548521](./docs/en_US/images/index/image-20231210151548521.png)
-
-  ![image-20231210151628992](./docs/en_US/images/index/image-20231210151628992.png)
-
-  The provider list returns configuration information for the credentials form, which can be authenticated through Runtime's interface. The first image above is a provider credential DEMO, and the second is a model credential DEMO.
+  The provider list returns configuration information for the credentials form, which can be authenticated through Runtime's interface.
 
 ## Structure
 
-![](./docs/en_US/images/index/image-20231210165243632.png)
-
 Model Runtime is divided into three layers:
 
 - The outermost layer is the factory method
@@ -60,9 +46,6 @@ Model Runtime is divided into three layers:
 
   It offers direct invocation of various model types, predefined model configuration information, getting predefined/remote model lists, model credential authentication methods. Different models provide additional special methods, like LLM's pre-computed tokens method, cost information obtaining method, etc., **allowing horizontal expansion** for different models under the same provider (within supported model types).
 
-## Next Steps
+## Documentation
 
-- Add new provider configuration: [Link](./docs/en_US/provider_scale_out.md)
-- Add new models for existing providers: [Link](./docs/en_US/provider_scale_out.md#AddModel)
-- View YAML configuration rules: [Link](./docs/en_US/schema.md)
-- Implement interface methods: [Link](./docs/en_US/interfaces.md)
+For detailed documentation on how to add new providers or models, please refer to the [Dify documentation](https://docs.dify.ai/).

api/core/model_runtime/README_CN.md

@@ -18,34 +18,20 @@
 
 - 模型供应商展示
 
-  ![image-20231210143654461](./docs/zh_Hans/images/index/image-20231210143654461.png)
-
-​ 展示所有已支持的供应商列表，除了返回供应商名称、图标之外，还提供了支持的模型类型列表，预定义模型列表、配置方式以及配置凭据的表单规则等等，规则设计详见：[Schema](./docs/zh_Hans/schema.md)。
+  展示所有已支持的供应商列表，除了返回供应商名称、图标之外，还提供了支持的模型类型列表，预定义模型列表、配置方式以及配置凭据的表单规则等等。
 
 - 可选择的模型列表展示
 
-  ![image-20231210144229650](./docs/zh_Hans/images/index/image-20231210144229650.png)
+  配置供应商/模型凭据后，可在此下拉（应用编排界面/默认模型）查看可用的 LLM 列表，其中灰色的为未配置凭据供应商的预定义模型列表，方便用户查看已支持的模型。
 
-​ 配置供应商/模型凭据后，可在此下拉（应用编排界面/默认模型）查看可用的 LLM 列表，其中灰色的为未配置凭据供应商的预定义模型列表，方便用户查看已支持的模型。
-
-​ 除此之外，该列表还返回了 LLM 可配置的参数信息和规则，如下图：
-
-​ ![image-20231210144814617](./docs/zh_Hans/images/index/image-20231210144814617.png)
-
-​ 这里的参数均为后端定义，相比之前只有 5 种固定参数，这里可为不同模型设置所支持的各种参数，详见：[Schema](./docs/zh_Hans/schema.md#ParameterRule)。
+  除此之外，该列表还返回了 LLM 可配置的参数信息和规则。这里的参数均为后端定义，相比之前只有 5 种固定参数，这里可为不同模型设置所支持的各种参数。
 
 - 供应商/模型凭据鉴权
 
-  ![image-20231210151548521](./docs/zh_Hans/images/index/image-20231210151548521.png)
-
-![image-20231210151628992](./docs/zh_Hans/images/index/image-20231210151628992.png)
-
-​ 供应商列表返回了凭据表单的配置信息，可通过 Runtime 提供的接口对凭据进行鉴权，上图 1 为供应商凭据 DEMO，上图 2 为模型凭据 DEMO。
+  供应商列表返回了凭据表单的配置信息，可通过 Runtime 提供的接口对凭据进行鉴权。
 
 ## 结构
 
-![](./docs/zh_Hans/images/index/image-20231210165243632.png)
-
 Model Runtime 分三层：
 
 - 最外层为工厂方法
@@ -59,8 +45,7 @@ Model Runtime 分三层：
   对于供应商/模型凭据，有两种情况
 
   - 如 OpenAI 这类中心化供应商，需要定义如**api_key**这类的鉴权凭据
-  - 如[**Xinference**](https://github.com/xorbitsai/inference)这类本地部署的供应商，需要定义如**server_url**这类的地址凭据，有时候还需要定义**model_uid**之类的模型类型凭据，就像下面这样，当在供应商层定义了这些凭据后，就可以在前端页面上直接展示，无需修改前端逻辑。
-    ![Alt text](docs/zh_Hans/images/index/image.png)
+  - 如[**Xinference**](https://github.com/xorbitsai/inference)这类本地部署的供应商，需要定义如**server_url**这类的地址凭据，有时候还需要定义**model_uid**之类的模型类型凭据。当在供应商层定义了这些凭据后，就可以在前端页面上直接展示，无需修改前端逻辑。
 
   当配置好凭据后，就可以通过 DifyRuntime 的外部接口直接获取到对应供应商所需要的**Schema**（凭据表单规则），从而在可以在不修改前端逻辑的情况下，提供新的供应商/模型的支持。
 
@@ -74,20 +59,6 @@ Model Runtime 分三层：
 
   - 模型凭据 (**在供应商层定义**)：这是一类不经常变动，一般在配置好后就不会再变动的参数，如 **api_key**、**server_url** 等。在 DifyRuntime 中，他们的参数名一般为**credentials: dict[str, any]**，Provider 层的 credentials 会直接被传递到这一层，不需要再单独定义。
 
-## 下一步
+## 文档
 
-### [增加新的供应商配置 👈🏻](./docs/zh_Hans/provider_scale_out.md)
-
-当添加后，这里将会出现一个新的供应商
-
-![Alt text](docs/zh_Hans/images/index/image-1.png)
-
-### [为已存在的供应商新增模型 👈🏻](./docs/zh_Hans/provider_scale_out.md#%E5%A2%9E%E5%8A%A0%E6%A8%A1%E5%9E%8B)
-
-当添加后，对应供应商的模型列表中将会出现一个新的预定义模型供用户选择，如 GPT-3.5 GPT-4 ChatGLM3-6b 等，而对于支持自定义模型的供应商，则不需要新增模型。
-
-![Alt text](docs/zh_Hans/images/index/image-2.png)
-
-### [接口的具体实现 👈🏻](./docs/zh_Hans/interfaces.md)
-
-你可以在这里找到你想要查看的接口的具体实现，以及接口的参数和返回值的具体含义。
+有关如何添加新供应商或模型的详细文档，请参阅 [Dify 文档](https://docs.dify.ai/)。

api/core/ops/arize_phoenix_trace/arize_phoenix_trace.py

@@ -6,7 +6,13 @@ from datetime import datetime, timedelta
 from typing import Any, Union, cast
 from urllib.parse import urlparse
 
-from openinference.semconv.trace import OpenInferenceMimeTypeValues, OpenInferenceSpanKindValues, SpanAttributes
+from openinference.semconv.trace import (
+    MessageAttributes,
+    OpenInferenceMimeTypeValues,
+    OpenInferenceSpanKindValues,
+    SpanAttributes,
+    ToolCallAttributes,
+)
 from opentelemetry.exporter.otlp.proto.grpc.trace_exporter import OTLPSpanExporter as GrpcOTLPSpanExporter
 from opentelemetry.exporter.otlp.proto.http.trace_exporter import OTLPSpanExporter as HttpOTLPSpanExporter
 from opentelemetry.sdk import trace as trace_sdk
@@ -95,14 +101,14 @@ def setup_tracer(arize_phoenix_config: ArizeConfig | PhoenixConfig) -> tuple[tra
 
 
 def datetime_to_nanos(dt: datetime | None) -> int:
-    """Convert datetime to nanoseconds since epoch. If None, use current time."""
+    """Convert datetime to nanoseconds since epoch for Arize/Phoenix."""
     if dt is None:
         dt = datetime.now()
     return int(dt.timestamp() * 1_000_000_000)
 
 
 def error_to_string(error: Exception | str | None) -> str:
-    """Convert an error to a string with traceback information."""
+    """Convert an error to a string with traceback information for Arize/Phoenix."""
     error_message = "Empty Stack Trace"
     if error:
         if isinstance(error, Exception):
@@ -114,7 +120,7 @@ def error_to_string(error: Exception | str | None) -> str:
 
 
 def set_span_status(current_span: Span, error: Exception | str | None = None):
-    """Set the status of the current span based on the presence of an error."""
+    """Set the status of the current span based on the presence of an error for Arize/Phoenix."""
     if error:
         error_string = error_to_string(error)
         current_span.set_status(Status(StatusCode.ERROR, error_string))
@@ -138,10 +144,17 @@ def set_span_status(current_span: Span, error: Exception | str | None = None):
 
 
 def safe_json_dumps(obj: Any) -> str:
-    """A convenience wrapper around `json.dumps` that ensures that any object can be safely encoded."""
+    """A convenience wrapper to ensure that any object can be safely encoded for Arize/Phoenix."""
     return json.dumps(obj, default=str, ensure_ascii=False)
 
 
+def wrap_span_metadata(metadata, **kwargs):
+    """Add common metatada to all trace entity types for Arize/Phoenix."""
+    metadata["created_from"] = "Dify"
+    metadata.update(kwargs)
+    return metadata
+
+
 class ArizePhoenixDataTrace(BaseTraceInstance):
     def __init__(
         self,
@@ -183,16 +196,27 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
             raise
 
     def workflow_trace(self, trace_info: WorkflowTraceInfo):
-        workflow_metadata = {
-            "workflow_run_id": trace_info.workflow_run_id or "",
-            "message_id": trace_info.message_id or "",
-            "workflow_app_log_id": trace_info.workflow_app_log_id or "",
-            "status": trace_info.workflow_run_status or "",
-            "status_message": trace_info.error or "",
-            "level": "ERROR" if trace_info.error else "DEFAULT",
-            "total_tokens": trace_info.total_tokens or 0,
-        }
-        workflow_metadata.update(trace_info.metadata)
+        file_list = trace_info.file_list if isinstance(trace_info.file_list, list) else []
+
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.workflow_run_status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="workflow",
+            conversation_id=trace_info.conversation_id or "",
+            workflow_app_log_id=trace_info.workflow_app_log_id or "",
+            workflow_id=trace_info.workflow_id or "",
+            tenant_id=trace_info.tenant_id or "",
+            workflow_run_id=trace_info.workflow_run_id or "",
+            workflow_run_elapsed_time=trace_info.workflow_run_elapsed_time or 0,
+            workflow_run_version=trace_info.workflow_run_version or "",
+            total_tokens=trace_info.total_tokens or 0,
+            file_list=safe_json_dumps(file_list),
+            query=trace_info.query or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id or trace_info.workflow_run_id
         self.ensure_root_span(dify_trace_id)
@@ -201,10 +225,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         workflow_span = self.tracer.start_span(
             name=TraceTaskName.WORKFLOW_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.workflow_run_inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.workflow_run_outputs, ensure_ascii=False),
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(workflow_metadata, ensure_ascii=False),
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.workflow_run_inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.workflow_run_outputs),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
                 SpanAttributes.SESSION_ID: trace_info.conversation_id or "",
             },
             start_time=datetime_to_nanos(trace_info.start_time),
@@ -257,6 +283,7 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
                         "app_id": app_id,
                         "app_name": node_execution.title,
                         "status": node_execution.status,
+                        "status_message": node_execution.error or "",
                         "level": "ERROR" if node_execution.status == "failed" else "DEFAULT",
                     }
                 )
@@ -290,11 +317,11 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
                 node_span = self.tracer.start_span(
                     name=node_execution.node_type,
                     attributes={
+                        SpanAttributes.OPENINFERENCE_SPAN_KIND: span_kind.value,
                         SpanAttributes.INPUT_VALUE: safe_json_dumps(inputs_value),
                         SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
                         SpanAttributes.OUTPUT_VALUE: safe_json_dumps(outputs_value),
                         SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
-                        SpanAttributes.OPENINFERENCE_SPAN_KIND: span_kind.value,
                         SpanAttributes.METADATA: safe_json_dumps(node_metadata),
                         SpanAttributes.SESSION_ID: trace_info.conversation_id or "",
                     },
@@ -339,30 +366,37 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def message_trace(self, trace_info: MessageTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping message trace.")
             return
 
-        file_list = cast(list[str], trace_info.file_list) or []
+        file_list = trace_info.file_list if isinstance(trace_info.file_list, list) else []
         message_file_data: MessageFile | None = trace_info.message_file_data
 
         if message_file_data is not None:
             file_url = f"{self.file_base_url}/{message_file_data.url}" if message_file_data else ""
             file_list.append(file_url)
 
-        message_metadata = {
-            "message_id": trace_info.message_id or "",
-            "conversation_mode": str(trace_info.conversation_mode or ""),
-            "user_id": trace_info.message_data.from_account_id or "",
-            "file_list": json.dumps(file_list),
-            "status": trace_info.message_data.status or "",
-            "status_message": trace_info.error or "",
-            "level": "ERROR" if trace_info.error else "DEFAULT",
-            "total_tokens": trace_info.total_tokens or 0,
-            "prompt_tokens": trace_info.message_tokens or 0,
-            "completion_tokens": trace_info.answer_tokens or 0,
-            "ls_provider": trace_info.message_data.model_provider or "",
-            "ls_model_name": trace_info.message_data.model_id or "",
-        }
-        message_metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="message",
+            conversation_model=trace_info.conversation_model or "",
+            message_tokens=trace_info.message_tokens or 0,
+            answer_tokens=trace_info.answer_tokens or 0,
+            total_tokens=trace_info.total_tokens or 0,
+            conversation_mode=trace_info.conversation_mode or "",
+            gen_ai_server_time_to_first_token=trace_info.gen_ai_server_time_to_first_token or 0,
+            llm_streaming_time_to_generate=trace_info.llm_streaming_time_to_generate or 0,
+            is_streaming_request=trace_info.is_streaming_request or False,
+            user_id=trace_info.message_data.from_account_id or "",
+            file_list=safe_json_dumps(file_list),
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+        )
 
         # Add end user data if available
         if trace_info.message_data.from_end_user_id:
@@ -370,14 +404,16 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
                 db.session.query(EndUser).where(EndUser.id == trace_info.message_data.from_end_user_id).first()
             )
             if end_user_data is not None:
-                message_metadata["end_user_id"] = end_user_data.session_id
+                metadata["end_user_id"] = end_user_data.session_id
 
         attributes = {
-            SpanAttributes.INPUT_VALUE: trace_info.message_data.query,
-            SpanAttributes.OUTPUT_VALUE: trace_info.message_data.answer,
             SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-            SpanAttributes.METADATA: json.dumps(message_metadata, ensure_ascii=False),
-            SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id,
+            SpanAttributes.INPUT_VALUE: trace_info.message_data.query,
+            SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value,
+            SpanAttributes.OUTPUT_VALUE: trace_info.message_data.answer,
+            SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value,
+            SpanAttributes.METADATA: safe_json_dumps(metadata),
+            SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id or "",
         }
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
@@ -393,8 +429,10 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
         try:
             # Convert outputs to string based on type
+            outputs_mime_type = OpenInferenceMimeTypeValues.TEXT.value
             if isinstance(trace_info.outputs, dict | list):
-                outputs_str = json.dumps(trace_info.outputs, ensure_ascii=False)
+                outputs_str = safe_json_dumps(trace_info.outputs)
+                outputs_mime_type = OpenInferenceMimeTypeValues.JSON.value
             elif isinstance(trace_info.outputs, str):
                 outputs_str = trace_info.outputs
             else:
@@ -402,10 +440,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
             llm_attributes = {
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.LLM.value,
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
                 SpanAttributes.OUTPUT_VALUE: outputs_str,
-                SpanAttributes.METADATA: json.dumps(message_metadata, ensure_ascii=False),
-                SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id,
+                SpanAttributes.OUTPUT_MIME_TYPE: outputs_mime_type,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
+                SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id or "",
             }
             llm_attributes.update(self._construct_llm_attributes(trace_info.inputs))
             if trace_info.total_tokens is not None and trace_info.total_tokens > 0:
@@ -449,16 +489,20 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def moderation_trace(self, trace_info: ModerationTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping moderation trace.")
             return
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_name": "moderation",
-            "status": trace_info.message_data.status,
-            "status_message": trace_info.message_data.error or "",
-            "level": "ERROR" if trace_info.message_data.error else "DEFAULT",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.message_data.error or "",
+            level="ERROR" if trace_info.message_data.error else "DEFAULT",
+            trace_entity_type="moderation",
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
@@ -467,18 +511,19 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.MODERATION_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(
+                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value,
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(
                     {
-                        "action": trace_info.action,
                         "flagged": trace_info.flagged,
+                        "action": trace_info.action,
                         "preset_response": trace_info.preset_response,
-                        "inputs": trace_info.inputs,
-                    },
-                    ensure_ascii=False,
+                        "query": trace_info.query,
+                    }
                 ),
-                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
             },
             start_time=datetime_to_nanos(trace_info.start_time),
             context=root_span_context,
@@ -494,22 +539,28 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def suggested_question_trace(self, trace_info: SuggestedQuestionTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping suggested question trace.")
             return
 
         start_time = trace_info.start_time or trace_info.message_data.created_at
         end_time = trace_info.end_time or trace_info.message_data.updated_at
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_name": "suggested_question",
-            "status": trace_info.status,
-            "status_message": trace_info.error or "",
-            "level": "ERROR" if trace_info.error else "DEFAULT",
-            "total_tokens": trace_info.total_tokens,
-            "ls_provider": trace_info.model_provider or "",
-            "ls_model_name": trace_info.model_id or "",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.status or "",
+            status_message=trace_info.status_message or "",
+            level=trace_info.level or "",
+            trace_entity_type="suggested_question",
+            total_tokens=trace_info.total_tokens or 0,
+            from_account_id=trace_info.from_account_id or "",
+            agent_based=trace_info.agent_based or False,
+            from_source=trace_info.from_source or "",
+            model_provider=trace_info.model_provider or "",
+            model_id=trace_info.model_id or "",
+            workflow_run_id=trace_info.workflow_run_id or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
@@ -518,10 +569,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.SUGGESTED_QUESTION_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.suggested_question, ensure_ascii=False),
-                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
+                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value,
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.suggested_question),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
             },
             start_time=datetime_to_nanos(start_time),
             context=root_span_context,
@@ -537,21 +590,23 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def dataset_retrieval_trace(self, trace_info: DatasetRetrievalTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping dataset retrieval trace.")
             return
 
         start_time = trace_info.start_time or trace_info.message_data.created_at
         end_time = trace_info.end_time or trace_info.message_data.updated_at
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_name": "dataset_retrieval",
-            "status": trace_info.message_data.status,
-            "status_message": trace_info.message_data.error or "",
-            "level": "ERROR" if trace_info.message_data.error else "DEFAULT",
-            "ls_provider": trace_info.message_data.model_provider or "",
-            "ls_model_name": trace_info.message_data.model_id or "",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="dataset_retrieval",
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
@@ -560,20 +615,20 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.DATASET_RETRIEVAL_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps({"documents": trace_info.documents}, ensure_ascii=False),
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.RETRIEVER.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
-                "start_time": start_time.isoformat() if start_time else "",
-                "end_time": end_time.isoformat() if end_time else "",
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps({"documents": trace_info.documents}),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
             },
             start_time=datetime_to_nanos(start_time),
             context=root_span_context,
         )
 
         try:
-            if trace_info.message_data.error:
-                set_span_status(span, trace_info.message_data.error)
+            if trace_info.error:
+                set_span_status(span, trace_info.error)
             else:
                 set_span_status(span)
         finally:
@@ -584,30 +639,34 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
             logger.warning("[Arize/Phoenix] Message data is None, skipping tool trace.")
             return
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_config": json.dumps(trace_info.tool_config, ensure_ascii=False),
-        }
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="tool",
+            tool_config=safe_json_dumps(trace_info.tool_config),
+            time_cost=trace_info.time_cost or 0,
+            file_url=trace_info.file_url or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
         root_span_context = self.propagator.extract(carrier=self.carrier)
 
-        tool_params_str = (
-            json.dumps(trace_info.tool_parameters, ensure_ascii=False)
-            if isinstance(trace_info.tool_parameters, dict)
-            else str(trace_info.tool_parameters)
-        )
-
         span = self.tracer.start_span(
             name=trace_info.tool_name,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.tool_inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: trace_info.tool_outputs,
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.tool_inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: trace_info.tool_outputs,
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
                 SpanAttributes.TOOL_NAME: trace_info.tool_name,
-                SpanAttributes.TOOL_PARAMETERS: tool_params_str,
+                SpanAttributes.TOOL_PARAMETERS: safe_json_dumps(trace_info.tool_parameters),
             },
             start_time=datetime_to_nanos(trace_info.start_time),
             context=root_span_context,
@@ -623,16 +682,22 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def generate_name_trace(self, trace_info: GenerateNameTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping generate name trace.")
             return
 
-        metadata = {
-            "project_name": self.project,
-            "message_id": trace_info.message_id,
-            "status": trace_info.message_data.status,
-            "status_message": trace_info.message_data.error or "",
-            "level": "ERROR" if trace_info.message_data.error else "DEFAULT",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.message_data.error or "",
+            level="ERROR" if trace_info.message_data.error else "DEFAULT",
+            trace_entity_type="generate_name",
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+            conversation_id=trace_info.conversation_id or "",
+            tenant_id=trace_info.tenant_id,
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id or trace_info.conversation_id
         self.ensure_root_span(dify_trace_id)
@@ -641,13 +706,13 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.GENERATE_NAME_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.outputs, ensure_ascii=False),
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
-                SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id,
-                "start_time": trace_info.start_time.isoformat() if trace_info.start_time else "",
-                "end_time": trace_info.end_time.isoformat() if trace_info.end_time else "",
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.outputs),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
+                SpanAttributes.SESSION_ID: trace_info.conversation_id or "",
             },
             start_time=datetime_to_nanos(trace_info.start_time),
             context=root_span_context,
@@ -688,32 +753,85 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
             raise ValueError(f"[Arize/Phoenix] API check failed: {str(e)}")
 
     def get_project_url(self):
+        """Build a redirect URL that forwards the user to the correct project for Arize/Phoenix."""
         try:
-            if self.arize_phoenix_config.endpoint == "https://otlp.arize.com":
-                return "https://app.arize.com/"
-            else:
-                return f"{self.arize_phoenix_config.endpoint}/projects/"
+            project_name = self.arize_phoenix_config.project
+            endpoint = self.arize_phoenix_config.endpoint.rstrip("/")
+
+            # Arize
+            if isinstance(self.arize_phoenix_config, ArizeConfig):
+                return f"https://app.arize.com/?redirect_project_name={project_name}"
+
+            # Phoenix
+            return f"{endpoint}/projects/?redirect_project_name={project_name}"
+
         except Exception as e:
-            logger.info("[Arize/Phoenix] Get run url failed: %s", str(e), exc_info=True)
-            raise ValueError(f"[Arize/Phoenix] Get run url failed: {str(e)}")
+            logger.info("[Arize/Phoenix] Failed to construct project URL: %s", str(e), exc_info=True)
+            raise ValueError(f"[Arize/Phoenix] Failed to construct project URL: {str(e)}")
 
     def _construct_llm_attributes(self, prompts: dict | list | str | None) -> dict[str, str]:
-        """Helper method to construct LLM attributes with passed prompts."""
-        attributes = {}
+        """Construct LLM attributes with passed prompts for Arize/Phoenix."""
+        attributes: dict[str, str] = {}
+
+        def set_attribute(path: str, value: object) -> None:
+            """Store an attribute safely as a string."""
+            if value is None:
+                return
+            try:
+                if isinstance(value, (dict, list)):
+                    value = safe_json_dumps(value)
+                attributes[path] = str(value)
+            except Exception:
+                attributes[path] = str(value)
+
+        def set_message_attribute(message_index: int, key: str, value: object) -> None:
+            path = f"{SpanAttributes.LLM_INPUT_MESSAGES}.{message_index}.{key}"
+            set_attribute(path, value)
+
+        def set_tool_call_attributes(message_index: int, tool_index: int, tool_call: dict | object | None) -> None:
+            """Extract and assign tool call details safely."""
+            if not tool_call:
+                return
+
+            def safe_get(obj, key, default=None):
+                if isinstance(obj, dict):
+                    return obj.get(key, default)
+                return getattr(obj, key, default)
+
+            function_obj = safe_get(tool_call, "function", {})
+            function_name = safe_get(function_obj, "name", "")
+            function_args = safe_get(function_obj, "arguments", {})
+            call_id = safe_get(tool_call, "id", "")
+
+            base_path = (
+                f"{SpanAttributes.LLM_INPUT_MESSAGES}."
+                f"{message_index}.{MessageAttributes.MESSAGE_TOOL_CALLS}.{tool_index}"
+            )
+
+            set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_FUNCTION_NAME}", function_name)
+            set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_FUNCTION_ARGUMENTS_JSON}", function_args)
+            set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_ID}", call_id)
+
+        # Handle list of messages
         if isinstance(prompts, list):
-            for i, msg in enumerate(prompts):
-                if isinstance(msg, dict):
-                    attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.{i}.message.content"] = msg.get("text", "")
-                    attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.{i}.message.role"] = msg.get("role", "user")
-                    # todo: handle assistant and tool role messages, as they don't always
-                    # have a text field, but may have a tool_calls field instead
-                    # e.g. 'tool_calls': [{'id': '98af3a29-b066-45a5-b4b1-46c74ddafc58',
-                    # 'type': 'function', 'function': {'name': 'current_time', 'arguments': '{}'}}]}
-        elif isinstance(prompts, dict):
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.content"] = json.dumps(prompts)
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.role"] = "user"
-        elif isinstance(prompts, str):
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.content"] = prompts
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.role"] = "user"
+            for message_index, message in enumerate(prompts):
+                if not isinstance(message, dict):
+                    continue
+
+                role = message.get("role", "user")
+                content = message.get("text") or message.get("content") or ""
+
+                set_message_attribute(message_index, MessageAttributes.MESSAGE_ROLE, role)
+                set_message_attribute(message_index, MessageAttributes.MESSAGE_CONTENT, content)
+
+                tool_calls = message.get("tool_calls") or []
+                if isinstance(tool_calls, list):
+                    for tool_index, tool_call in enumerate(tool_calls):
+                        set_tool_call_attributes(message_index, tool_index, tool_call)
+
+        # Handle single dict or plain string prompt
+        elif isinstance(prompts, (dict, str)):
+            set_message_attribute(0, MessageAttributes.MESSAGE_CONTENT, prompts)
+            set_message_attribute(0, MessageAttributes.MESSAGE_ROLE, "user")
 
         return attributes

api/core/plugin/impl/base.py

@@ -39,7 +39,7 @@ from core.trigger.errors import (
 plugin_daemon_inner_api_baseurl = URL(str(dify_config.PLUGIN_DAEMON_URL))
 _plugin_daemon_timeout_config = cast(
     float | httpx.Timeout | None,
-    getattr(dify_config, "PLUGIN_DAEMON_TIMEOUT", 300.0),
+    getattr(dify_config, "PLUGIN_DAEMON_TIMEOUT", 600.0),
 )
 plugin_daemon_request_timeout: httpx.Timeout | None
 if _plugin_daemon_timeout_config is None:

api/core/rag/datasource/vdb/iris/iris_vector.py

@@ -0,0 +1,407 @@
+"""InterSystems IRIS vector database implementation for Dify.
+
+This module provides vector storage and retrieval using IRIS native VECTOR type
+with HNSW indexing for efficient similarity search.
+"""
+
+from __future__ import annotations
+
+import json
+import logging
+import threading
+import uuid
+from contextlib import contextmanager
+from typing import TYPE_CHECKING, Any
+
+from configs import dify_config
+from configs.middleware.vdb.iris_config import IrisVectorConfig
+from core.rag.datasource.vdb.vector_base import BaseVector
+from core.rag.datasource.vdb.vector_factory import AbstractVectorFactory
+from core.rag.datasource.vdb.vector_type import VectorType
+from core.rag.embedding.embedding_base import Embeddings
+from core.rag.models.document import Document
+from extensions.ext_redis import redis_client
+from models.dataset import Dataset
+
+if TYPE_CHECKING:
+    import iris
+else:
+    try:
+        import iris
+    except ImportError:
+        iris = None  # type: ignore[assignment]
+
+logger = logging.getLogger(__name__)
+
+# Singleton connection pool to minimize IRIS license usage
+_pool_lock = threading.Lock()
+_pool_instance: IrisConnectionPool | None = None
+
+
+def get_iris_pool(config: IrisVectorConfig) -> IrisConnectionPool:
+    """Get or create the global IRIS connection pool (singleton pattern)."""
+    global _pool_instance  # pylint: disable=global-statement
+    with _pool_lock:
+        if _pool_instance is None:
+            logger.info("Initializing IRIS connection pool")
+            _pool_instance = IrisConnectionPool(config)
+        return _pool_instance
+
+
+class IrisConnectionPool:
+    """Thread-safe connection pool for IRIS database."""
+
+    def __init__(self, config: IrisVectorConfig) -> None:
+        self.config = config
+        self._pool: list[Any] = []
+        self._lock = threading.Lock()
+        self._min_size = config.IRIS_MIN_CONNECTION
+        self._max_size = config.IRIS_MAX_CONNECTION
+        self._in_use = 0
+        self._schemas_initialized: set[str] = set()  # Cache for initialized schemas
+        self._initialize_pool()
+
+    def _initialize_pool(self) -> None:
+        for _ in range(self._min_size):
+            self._pool.append(self._create_connection())
+
+    def _create_connection(self) -> Any:
+        return iris.connect(
+            hostname=self.config.IRIS_HOST,
+            port=self.config.IRIS_SUPER_SERVER_PORT,
+            namespace=self.config.IRIS_DATABASE,
+            username=self.config.IRIS_USER,
+            password=self.config.IRIS_PASSWORD,
+        )
+
+    def get_connection(self) -> Any:
+        """Get a connection from pool or create new if available."""
+        with self._lock:
+            if self._pool:
+                conn = self._pool.pop()
+                self._in_use += 1
+                return conn
+            if self._in_use < self._max_size:
+                conn = self._create_connection()
+                self._in_use += 1
+                return conn
+            raise RuntimeError("Connection pool exhausted")
+
+    def return_connection(self, conn: Any) -> None:
+        """Return connection to pool after validating it."""
+        if not conn:
+            return
+
+        # Validate connection health
+        is_valid = False
+        try:
+            cursor = conn.cursor()
+            cursor.execute("SELECT 1")
+            cursor.close()
+            is_valid = True
+        except (OSError, RuntimeError) as e:
+            logger.debug("Connection validation failed: %s", e)
+            try:
+                conn.close()
+            except (OSError, RuntimeError):
+                pass
+
+        with self._lock:
+            self._pool.append(conn if is_valid else self._create_connection())
+            self._in_use -= 1
+
+    def ensure_schema_exists(self, schema: str) -> None:
+        """Ensure schema exists in IRIS database.
+
+        This method is idempotent and thread-safe. It uses a memory cache to avoid
+        redundant database queries for already-verified schemas.
+
+        Args:
+            schema: Schema name to ensure exists
+
+        Raises:
+            Exception: If schema creation fails
+        """
+        # Fast path: check cache first (no lock needed for read-only set lookup)
+        if schema in self._schemas_initialized:
+            return
+
+        # Slow path: acquire lock and check again (double-checked locking)
+        with self._lock:
+            if schema in self._schemas_initialized:
+                return
+
+            # Get a connection to check/create schema
+            conn = self._pool[0] if self._pool else self._create_connection()
+            cursor = conn.cursor()
+            try:
+                # Check if schema exists using INFORMATION_SCHEMA
+                check_sql = """
+                    SELECT COUNT(*) FROM INFORMATION_SCHEMA.SCHEMATA
+                    WHERE SCHEMA_NAME = ?
+                """
+                cursor.execute(check_sql, (schema,))  # Must be tuple or list
+                exists = cursor.fetchone()[0] > 0
+
+                if not exists:
+                    # Schema doesn't exist, create it
+                    cursor.execute(f"CREATE SCHEMA {schema}")
+                    conn.commit()
+                    logger.info("Created schema: %s", schema)
+                else:
+                    logger.debug("Schema already exists: %s", schema)
+
+                # Add to cache to skip future checks
+                self._schemas_initialized.add(schema)
+
+            except Exception as e:
+                conn.rollback()
+                logger.exception("Failed to ensure schema %s exists", schema)
+                raise
+            finally:
+                cursor.close()
+
+    def close_all(self) -> None:
+        """Close all connections (application shutdown only)."""
+        with self._lock:
+            for conn in self._pool:
+                try:
+                    conn.close()
+                except (OSError, RuntimeError):
+                    pass
+            self._pool.clear()
+            self._in_use = 0
+            self._schemas_initialized.clear()
+
+
+class IrisVector(BaseVector):
+    """IRIS vector database implementation using native VECTOR type and HNSW indexing."""
+
+    def __init__(self, collection_name: str, config: IrisVectorConfig) -> None:
+        super().__init__(collection_name)
+        self.config = config
+        self.table_name = f"embedding_{collection_name}".upper()
+        self.schema = config.IRIS_SCHEMA or "dify"
+        self.pool = get_iris_pool(config)
+
+    def get_type(self) -> str:
+        return VectorType.IRIS
+
+    @contextmanager
+    def _get_cursor(self):
+        """Context manager for database cursor with connection pooling."""
+        conn = self.pool.get_connection()
+        cursor = conn.cursor()
+        try:
+            yield cursor
+            conn.commit()
+        except Exception:
+            conn.rollback()
+            raise
+        finally:
+            cursor.close()
+            self.pool.return_connection(conn)
+
+    def create(self, texts: list[Document], embeddings: list[list[float]], **kwargs) -> list[str]:
+        dimension = len(embeddings[0])
+        self._create_collection(dimension)
+        return self.add_texts(texts, embeddings)
+
+    def add_texts(self, documents: list[Document], embeddings: list[list[float]], **_kwargs) -> list[str]:
+        """Add documents with embeddings to the collection."""
+        added_ids = []
+        with self._get_cursor() as cursor:
+            for i, doc in enumerate(documents):
+                doc_id = doc.metadata.get("doc_id", str(uuid.uuid4())) if doc.metadata else str(uuid.uuid4())
+                metadata = json.dumps(doc.metadata) if doc.metadata else "{}"
+                embedding_str = json.dumps(embeddings[i])
+
+                sql = f"INSERT INTO {self.schema}.{self.table_name} (id, text, meta, embedding) VALUES (?, ?, ?, ?)"
+                cursor.execute(sql, (doc_id, doc.page_content, metadata, embedding_str))
+                added_ids.append(doc_id)
+
+        return added_ids
+
+    def text_exists(self, id: str) -> bool:  # pylint: disable=redefined-builtin
+        try:
+            with self._get_cursor() as cursor:
+                sql = f"SELECT 1 FROM {self.schema}.{self.table_name} WHERE id = ?"
+                cursor.execute(sql, (id,))
+                return cursor.fetchone() is not None
+        except (OSError, RuntimeError, ValueError):
+            return False
+
+    def delete_by_ids(self, ids: list[str]) -> None:
+        if not ids:
+            return
+
+        with self._get_cursor() as cursor:
+            placeholders = ",".join(["?" for _ in ids])
+            sql = f"DELETE FROM {self.schema}.{self.table_name} WHERE id IN ({placeholders})"
+            cursor.execute(sql, ids)
+
+    def delete_by_metadata_field(self, key: str, value: str) -> None:
+        """Delete documents by metadata field (JSON LIKE pattern matching)."""
+        with self._get_cursor() as cursor:
+            pattern = f'%"{key}": "{value}"%'
+            sql = f"DELETE FROM {self.schema}.{self.table_name} WHERE meta LIKE ?"
+            cursor.execute(sql, (pattern,))
+
+    def search_by_vector(self, query_vector: list[float], **kwargs: Any) -> list[Document]:
+        """Search similar documents using VECTOR_COSINE with HNSW index."""
+        top_k = kwargs.get("top_k", 4)
+        score_threshold = float(kwargs.get("score_threshold") or 0.0)
+        embedding_str = json.dumps(query_vector)
+
+        with self._get_cursor() as cursor:
+            sql = f"""
+                SELECT TOP {top_k} id, text, meta, VECTOR_COSINE(embedding, ?) as score
+                FROM {self.schema}.{self.table_name}
+                ORDER BY score DESC
+            """
+            cursor.execute(sql, (embedding_str,))
+
+            docs = []
+            for row in cursor.fetchall():
+                if len(row) >= 4:
+                    text, meta_str, score = row[1], row[2], float(row[3])
+                    if score >= score_threshold:
+                        metadata = json.loads(meta_str) if meta_str else {}
+                        metadata["score"] = score
+                        docs.append(Document(page_content=text, metadata=metadata))
+            return docs
+
+    def search_by_full_text(self, query: str, **kwargs: Any) -> list[Document]:
+        """Search documents by full-text using iFind index or fallback to LIKE search."""
+        top_k = kwargs.get("top_k", 5)
+
+        with self._get_cursor() as cursor:
+            if self.config.IRIS_TEXT_INDEX:
+                # Use iFind full-text search with index
+                text_index_name = f"idx_{self.table_name}_text"
+                sql = f"""
+                    SELECT TOP {top_k} id, text, meta
+                    FROM {self.schema}.{self.table_name}
+                    WHERE %ID %FIND search_index({text_index_name}, ?)
+                """
+                cursor.execute(sql, (query,))
+            else:
+                # Fallback to LIKE search (inefficient for large datasets)
+                query_pattern = f"%{query}%"
+                sql = f"""
+                    SELECT TOP {top_k} id, text, meta
+                    FROM {self.schema}.{self.table_name}
+                    WHERE text LIKE ?
+                """
+                cursor.execute(sql, (query_pattern,))
+
+            docs = []
+            for row in cursor.fetchall():
+                if len(row) >= 3:
+                    metadata = json.loads(row[2]) if row[2] else {}
+                    docs.append(Document(page_content=row[1], metadata=metadata))
+
+            if not docs:
+                logger.info("Full-text search for '%s' returned no results", query)
+
+            return docs
+
+    def delete(self) -> None:
+        """Delete the entire collection (drop table - permanent)."""
+        with self._get_cursor() as cursor:
+            sql = f"DROP TABLE {self.schema}.{self.table_name}"
+            cursor.execute(sql)
+
+    def _create_collection(self, dimension: int) -> None:
+        """Create table with VECTOR column and HNSW index.
+
+        Uses Redis lock to prevent concurrent creation attempts across multiple
+        API server instances (api, worker, worker_beat).
+        """
+        cache_key = f"vector_indexing_{self._collection_name}"
+        lock_name = f"{cache_key}_lock"
+
+        with redis_client.lock(lock_name, timeout=20):  # pylint: disable=not-context-manager
+            if redis_client.get(cache_key):
+                return
+
+            # Ensure schema exists (idempotent, cached after first call)
+            self.pool.ensure_schema_exists(self.schema)
+
+            with self._get_cursor() as cursor:
+                # Create table with VECTOR column
+                sql = f"""
+                    CREATE TABLE {self.schema}.{self.table_name} (
+                        id VARCHAR(255) PRIMARY KEY,
+                        text CLOB,
+                        meta CLOB,
+                        embedding VECTOR(DOUBLE, {dimension})
+                    )
+                """
+                logger.info("Creating table: %s.%s", self.schema, self.table_name)
+                cursor.execute(sql)
+
+                # Create HNSW index for vector similarity search
+                index_name = f"idx_{self.table_name}_embedding"
+                sql_index = (
+                    f"CREATE INDEX {index_name} ON {self.schema}.{self.table_name} "
+                    "(embedding) AS HNSW(Distance='Cosine')"
+                )
+                logger.info("Creating HNSW index: %s", index_name)
+                cursor.execute(sql_index)
+                logger.info("HNSW index created successfully: %s", index_name)
+
+                # Create full-text search index if enabled
+                logger.info(
+                    "IRIS_TEXT_INDEX config value: %s (type: %s)",
+                    self.config.IRIS_TEXT_INDEX,
+                    type(self.config.IRIS_TEXT_INDEX),
+                )
+                if self.config.IRIS_TEXT_INDEX:
+                    text_index_name = f"idx_{self.table_name}_text"
+                    language = self.config.IRIS_TEXT_INDEX_LANGUAGE
+                    # Fixed: Removed extra parentheses and corrected syntax
+                    sql_text_index = f"""
+                        CREATE INDEX {text_index_name} ON {self.schema}.{self.table_name} (text)
+                        AS %iFind.Index.Basic
+                        (LANGUAGE = '{language}', LOWER = 1, INDEXOPTION = 0)
+                    """
+                    logger.info("Creating text index: %s with language: %s", text_index_name, language)
+                    logger.info("SQL for text index: %s", sql_text_index)
+                    cursor.execute(sql_text_index)
+                    logger.info("Text index created successfully: %s", text_index_name)
+                else:
+                    logger.warning("Text index creation skipped - IRIS_TEXT_INDEX is disabled")
+
+            redis_client.set(cache_key, 1, ex=3600)
+
+
+class IrisVectorFactory(AbstractVectorFactory):
+    """Factory for creating IrisVector instances."""
+
+    def init_vector(self, dataset: Dataset, attributes: list, embeddings: Embeddings) -> IrisVector:
+        if dataset.index_struct_dict:
+            class_prefix: str = dataset.index_struct_dict["vector_store"]["class_prefix"]
+            collection_name = class_prefix
+        else:
+            dataset_id = dataset.id
+            collection_name = Dataset.gen_collection_name_by_id(dataset_id)
+            index_struct_dict = self.gen_index_struct_dict(VectorType.IRIS, collection_name)
+            dataset.index_struct = json.dumps(index_struct_dict)
+
+        return IrisVector(
+            collection_name=collection_name,
+            config=IrisVectorConfig(
+                IRIS_HOST=dify_config.IRIS_HOST,
+                IRIS_SUPER_SERVER_PORT=dify_config.IRIS_SUPER_SERVER_PORT,
+                IRIS_USER=dify_config.IRIS_USER,
+                IRIS_PASSWORD=dify_config.IRIS_PASSWORD,
+                IRIS_DATABASE=dify_config.IRIS_DATABASE,
+                IRIS_SCHEMA=dify_config.IRIS_SCHEMA,
+                IRIS_CONNECTION_URL=dify_config.IRIS_CONNECTION_URL,
+                IRIS_MIN_CONNECTION=dify_config.IRIS_MIN_CONNECTION,
+                IRIS_MAX_CONNECTION=dify_config.IRIS_MAX_CONNECTION,
+                IRIS_TEXT_INDEX=dify_config.IRIS_TEXT_INDEX,
+                IRIS_TEXT_INDEX_LANGUAGE=dify_config.IRIS_TEXT_INDEX_LANGUAGE,
+            ),
+        )

api/core/rag/datasource/vdb/vector_factory.py

@@ -163,7 +163,7 @@ class Vector:
                 from core.rag.datasource.vdb.lindorm.lindorm_vector import LindormVectorStoreFactory
 
                 return LindormVectorStoreFactory
-            case VectorType.OCEANBASE:
+            case VectorType.OCEANBASE | VectorType.SEEKDB:
                 from core.rag.datasource.vdb.oceanbase.oceanbase_vector import OceanBaseVectorFactory
 
                 return OceanBaseVectorFactory
@@ -187,6 +187,10 @@ class Vector:
                 from core.rag.datasource.vdb.clickzetta.clickzetta_vector import ClickzettaVectorFactory
 
                 return ClickzettaVectorFactory
+            case VectorType.IRIS:
+                from core.rag.datasource.vdb.iris.iris_vector import IrisVectorFactory
+
+                return IrisVectorFactory
             case _:
                 raise ValueError(f"Vector store {vector_type} is not supported.")
 

api/core/rag/datasource/vdb/vector_type.py

@@ -27,8 +27,10 @@ class VectorType(StrEnum):
     UPSTASH = "upstash"
     TIDB_ON_QDRANT = "tidb_on_qdrant"
     OCEANBASE = "oceanbase"
+    SEEKDB = "seekdb"
     OPENGAUSS = "opengauss"
     TABLESTORE = "tablestore"
     HUAWEI_CLOUD = "huawei_cloud"
     MATRIXONE = "matrixone"
     CLICKZETTA = "clickzetta"
+    IRIS = "iris"

api/core/rag/extractor/entity/extract_setting.py

@@ -10,7 +10,7 @@ class NotionInfo(BaseModel):
     """
 
     credential_id: str | None = None
-    notion_workspace_id: str
+    notion_workspace_id: str | None = ""
     notion_obj_id: str
     notion_page_type: str
     document: Document | None = None

api/core/rag/extractor/excel_extractor.py

@@ -1,7 +1,7 @@
 """Abstract interface for document loader implementations."""
 
 import os
-from typing import cast
+from typing import TypedDict
 
 import pandas as pd
 from openpyxl import load_workbook
@@ -10,6 +10,12 @@ from core.rag.extractor.extractor_base import BaseExtractor
 from core.rag.models.document import Document
 
 
+class Candidate(TypedDict):
+    idx: int
+    count: int
+    map: dict[int, str]
+
+
 class ExcelExtractor(BaseExtractor):
     """Load Excel files.
 
@@ -30,32 +36,38 @@ class ExcelExtractor(BaseExtractor):
         file_extension = os.path.splitext(self._file_path)[-1].lower()
 
         if file_extension == ".xlsx":
-            wb = load_workbook(self._file_path, data_only=True)
+            wb = load_workbook(self._file_path, read_only=True, data_only=True)
+            try:
                 for sheet_name in wb.sheetnames:
                     sheet = wb[sheet_name]
-                data = sheet.values
-                cols = next(data, None)
-                if cols is None:
+                    header_row_idx, column_map, max_col_idx = self._find_header_and_columns(sheet)
+                    if not column_map:
+                        continue
+                    start_row = header_row_idx + 1
+                    for row in sheet.iter_rows(min_row=start_row, max_col=max_col_idx, values_only=False):
+                        if all(cell.value is None for cell in row):
                             continue
-                df = pd.DataFrame(data, columns=cols)
-
-                df.dropna(how="all", inplace=True)
-
-                for index, row in df.iterrows():
                         page_content = []
-                    for col_index, (k, v) in enumerate(row.items()):
-                        if pd.notna(v):
-                            cell = sheet.cell(
-                                row=cast(int, index) + 2, column=col_index + 1
-                            )  # +2 to account for header and 1-based index
-                            if cell.hyperlink:
-                                value = f"[{v}]({cell.hyperlink.target})"
-                                page_content.append(f'"{k}":"{value}"')
-                            else:
-                                page_content.append(f'"{k}":"{v}"')
+                        for col_idx, cell in enumerate(row):
+                            value = cell.value
+                            if col_idx in column_map:
+                                col_name = column_map[col_idx]
+                                if hasattr(cell, "hyperlink") and cell.hyperlink:
+                                    target = getattr(cell.hyperlink, "target", None)
+                                    if target:
+                                        value = f"[{value}]({target})"
+                                if value is None:
+                                    value = ""
+                                elif not isinstance(value, str):
+                                    value = str(value)
+                                value = value.strip().replace('"', '\\"')
+                                page_content.append(f'"{col_name}":"{value}"')
+                        if page_content:
                             documents.append(
                                 Document(page_content=";".join(page_content), metadata={"source": self._file_path})
                             )
+            finally:
+                wb.close()
 
         elif file_extension == ".xls":
             excel_file = pd.ExcelFile(self._file_path, engine="xlrd")
@@ -63,9 +75,9 @@ class ExcelExtractor(BaseExtractor):
                 df = excel_file.parse(sheet_name=excel_sheet_name)
                 df.dropna(how="all", inplace=True)
 
-                for _, row in df.iterrows():
+                for _, series_row in df.iterrows():
                     page_content = []
-                    for k, v in row.items():
+                    for k, v in series_row.items():
                         if pd.notna(v):
                             page_content.append(f'"{k}":"{v}"')
                     documents.append(
@@ -75,3 +87,61 @@ class ExcelExtractor(BaseExtractor):
             raise ValueError(f"Unsupported file extension: {file_extension}")
 
         return documents
+
+    def _find_header_and_columns(self, sheet, scan_rows=10) -> tuple[int, dict[int, str], int]:
+        """
+        Scan first N rows to find the most likely header row.
+        Returns:
+            header_row_idx: 1-based index of the header row
+            column_map: Dict mapping 0-based column index to column name
+            max_col_idx: 1-based index of the last valid column (for iter_rows boundary)
+        """
+        # Store potential candidates: (row_index, non_empty_count, column_map)
+        candidates: list[Candidate] = []
+
+        # Limit scan to avoid performance issues on huge files
+        # We iterate manually to control the read scope
+        for current_row_idx, row in enumerate(sheet.iter_rows(min_row=1, max_row=scan_rows, values_only=True), start=1):
+            # Filter out empty cells and build a temp map for this row
+            # col_idx is 0-based
+            row_map = {}
+            for col_idx, cell_value in enumerate(row):
+                if cell_value is not None and str(cell_value).strip():
+                    row_map[col_idx] = str(cell_value).strip().replace('"', '\\"')
+
+            if not row_map:
+                continue
+
+            non_empty_count = len(row_map)
+
+            # Header selection heuristic (implemented):
+            # - Prefer the first row with at least 2 non-empty columns.
+            # - Fallback: choose the row with the most non-empty columns
+            #   (tie-breaker: smaller row index).
+            candidates.append({"idx": current_row_idx, "count": non_empty_count, "map": row_map})
+
+        if not candidates:
+            return 0, {}, 0
+
+        # Choose the best candidate header row.
+
+        best_candidate: Candidate | None = None
+
+        # Strategy: prefer the first row with >= 2 non-empty columns; otherwise fallback.
+
+        for cand in candidates:
+            if cand["count"] >= 2:
+                best_candidate = cand
+                break
+
+        # Fallback: if no row has >= 2 columns, or all have 1, just take the one with max columns
+        if not best_candidate:
+            # Sort by count desc, then index asc
+            candidates.sort(key=lambda x: (-x["count"], x["idx"]))
+            best_candidate = candidates[0]
+
+        # Determine max_col_idx (1-based for openpyxl)
+        # It is the index of the last valid column in our map + 1
+        max_col_idx = max(best_candidate["map"].keys()) + 1
+
+        return best_candidate["idx"], best_candidate["map"], max_col_idx

api/core/rag/extractor/extract_processor.py

@@ -166,7 +166,7 @@ class ExtractProcessor:
         elif extract_setting.datasource_type == DatasourceType.NOTION:
             assert extract_setting.notion_info is not None, "notion_info is required"
             extractor = NotionExtractor(
-                notion_workspace_id=extract_setting.notion_info.notion_workspace_id,
+                notion_workspace_id=extract_setting.notion_info.notion_workspace_id or "",
                 notion_obj_id=extract_setting.notion_info.notion_obj_id,
                 notion_page_type=extract_setting.notion_info.notion_page_type,
                 document_model=extract_setting.notion_info.document,

api/core/rag/extractor/helpers.py

@@ -45,6 +45,6 @@ def detect_file_encodings(file_path: str, timeout: int = 5, sample_size: int = 1
         except concurrent.futures.TimeoutError:
             raise TimeoutError(f"Timeout reached while detecting encoding for {file_path}")
 
-    if all(encoding["encoding"] is None for encoding in encodings):
+    if all(encoding.encoding is None for encoding in encodings):
         raise RuntimeError(f"Could not detect encoding for {file_path}")
-    return [FileEncoding(**enc) for enc in encodings if enc["encoding"] is not None]
+    return [enc for enc in encodings if enc.encoding is not None]

api/core/rag/extractor/word_extractor.py

@@ -84,22 +84,45 @@ class WordExtractor(BaseExtractor):
         image_count = 0
         image_map = {}
 
-        for rel in doc.part.rels.values():
+        for r_id, rel in doc.part.rels.items():
             if "image" in rel.target_ref:
                 image_count += 1
                 if rel.is_external:
                     url = rel.target_ref
+                    if not self._is_valid_url(url):
+                        continue
+                    try:
                         response = ssrf_proxy.get(url)
+                    except Exception as e:
+                        logger.warning("Failed to download image from URL: %s: %s", url, str(e))
+                        continue
                     if response.status_code == 200:
-                        image_ext = mimetypes.guess_extension(response.headers["Content-Type"])
+                        image_ext = mimetypes.guess_extension(response.headers.get("Content-Type", ""))
                         if image_ext is None:
                             continue
                         file_uuid = str(uuid.uuid4())
-                        file_key = "image_files/" + self.tenant_id + "/" + file_uuid + "." + image_ext
+                        file_key = "image_files/" + self.tenant_id + "/" + file_uuid + image_ext
                         mime_type, _ = mimetypes.guess_type(file_key)
                         storage.save(file_key, response.content)
-                    else:
-                        continue
+                        # save file to db
+                        upload_file = UploadFile(
+                            tenant_id=self.tenant_id,
+                            storage_type=dify_config.STORAGE_TYPE,
+                            key=file_key,
+                            name=file_key,
+                            size=0,
+                            extension=str(image_ext),
+                            mime_type=mime_type or "",
+                            created_by=self.user_id,
+                            created_by_role=CreatorUserRole.ACCOUNT,
+                            created_at=naive_utc_now(),
+                            used=True,
+                            used_by=self.user_id,
+                            used_at=naive_utc_now(),
+                        )
+                        db.session.add(upload_file)
+                        # Use r_id as key for external images since target_part is undefined
+                        image_map[r_id] = f"![image]({dify_config.FILES_URL}/files/{upload_file.id}/file-preview)"
                 else:
                     image_ext = rel.target_ref.split(".")[-1]
                     if image_ext is None:
@@ -126,11 +149,12 @@ class WordExtractor(BaseExtractor):
                         used_by=self.user_id,
                         used_at=naive_utc_now(),
                     )
-
                     db.session.add(upload_file)
+                    # Use target_part as key for internal images
+                    image_map[rel.target_part] = (
+                        f"![image]({dify_config.FILES_URL}/files/{upload_file.id}/file-preview)"
+                    )
         db.session.commit()
-                image_map[rel.target_part] = f"![image]({dify_config.FILES_URL}/files/{upload_file.id}/file-preview)"
-
         return image_map
 
     def _table_to_markdown(self, table, image_map):
@@ -186,11 +210,17 @@ class WordExtractor(BaseExtractor):
                     image_id = blip.get("{http://schemas.openxmlformats.org/officeDocument/2006/relationships}embed")
                     if not image_id:
                         continue
-                    image_part = paragraph.part.rels[image_id].target_part
-
+                    rel = paragraph.part.rels.get(image_id)
+                    if rel is None:
+                        continue
+                    # For external images, use image_id as key; for internal, use target_part
+                    if rel.is_external:
+                        if image_id in image_map:
+                            paragraph_content.append(image_map[image_id])
+                    else:
+                        image_part = rel.target_part
                         if image_part in image_map:
-                        image_link = image_map[image_part]
-                        paragraph_content.append(image_link)
+                            paragraph_content.append(image_map[image_part])
             else:
                 paragraph_content.append(run.text)
         return "".join(paragraph_content).strip()
@@ -227,6 +257,18 @@ class WordExtractor(BaseExtractor):
 
         def parse_paragraph(paragraph):
             paragraph_content = []
+
+            def append_image_link(image_id, has_drawing):
+                """Helper to append image link from image_map based on relationship type."""
+                rel = doc.part.rels[image_id]
+                if rel.is_external:
+                    if image_id in image_map and not has_drawing:
+                        paragraph_content.append(image_map[image_id])
+                else:
+                    image_part = rel.target_part
+                    if image_part in image_map and not has_drawing:
+                        paragraph_content.append(image_map[image_part])
+
             for run in paragraph.runs:
                 if hasattr(run.element, "tag") and isinstance(run.element.tag, str) and run.element.tag.endswith("r"):
                     # Process drawing type images
@@ -243,6 +285,14 @@ class WordExtractor(BaseExtractor):
                                 "{http://schemas.openxmlformats.org/officeDocument/2006/relationships}embed"
                             )
                             if embed_id:
+                                rel = doc.part.rels.get(embed_id)
+                                if rel is not None and rel.is_external:
+                                    # External image: use embed_id as key
+                                    if embed_id in image_map:
+                                        has_drawing = True
+                                        paragraph_content.append(image_map[embed_id])
+                                else:
+                                    # Internal image: use target_part as key
                                     image_part = doc.part.related_parts.get(embed_id)
                                     if image_part in image_map:
                                         has_drawing = True
@@ -261,9 +311,7 @@ class WordExtractor(BaseExtractor):
                                 "{http://schemas.openxmlformats.org/officeDocument/2006/relationships}id"
                             )
                             if image_id and image_id in doc.part.rels:
-                                image_part = doc.part.rels[image_id].target_part
-                                if image_part in image_map and not has_drawing:
-                                    paragraph_content.append(image_map[image_part])
+                                append_image_link(image_id, has_drawing)
                         # Find imagedata element in VML
                         image_data = shape.find(".//{urn:schemas-microsoft-com:vml}imagedata")
                         if image_data is not None:
@@ -271,9 +319,7 @@ class WordExtractor(BaseExtractor):
                                 "{http://schemas.openxmlformats.org/officeDocument/2006/relationships}id"
                             )
                             if image_id and image_id in doc.part.rels:
-                                image_part = doc.part.rels[image_id].target_part
-                                if image_part in image_map and not has_drawing:
-                                    paragraph_content.append(image_map[image_part])
+                                append_image_link(image_id, has_drawing)
                 if run.text.strip():
                     paragraph_content.append(run.text.strip())
             return "".join(paragraph_content) if paragraph_content else ""

api/core/rag/index_processor/constant/built_in_field.py

@@ -15,3 +15,4 @@ class MetadataDataSource(StrEnum):
     notion_import = "notion"
     local_file = "file_upload"
     online_document = "online_document"
+    online_drive = "online_drive"

api/core/rag/splitter/fixed_text_splitter.py

@@ -2,6 +2,7 @@
 
 from __future__ import annotations
 
+import codecs
 import re
 from typing import Any
 
@@ -52,7 +53,7 @@ class FixedRecursiveCharacterTextSplitter(EnhanceRecursiveCharacterTextSplitter)
     def __init__(self, fixed_separator: str = "\n\n", separators: list[str] | None = None, **kwargs: Any):
         """Create a new TextSplitter."""
         super().__init__(**kwargs)
-        self._fixed_separator = fixed_separator
+        self._fixed_separator = codecs.decode(fixed_separator, "unicode_escape")
         self._separators = separators or ["\n\n", "\n", "。", ". ", " ", ""]
 
     def split_text(self, text: str) -> list[str]:
@@ -94,7 +95,8 @@ class FixedRecursiveCharacterTextSplitter(EnhanceRecursiveCharacterTextSplitter)
                 splits = re.split(r" +", text)
             else:
                 splits = text.split(separator)
-                splits = [item + separator if i < len(splits) else item for i, item in enumerate(splits)]
+                if self._keep_separator:
+                    splits = [s + separator for s in splits[:-1]] + splits[-1:]
         else:
             splits = list(text)
         if separator == "\n":
@@ -103,7 +105,7 @@ class FixedRecursiveCharacterTextSplitter(EnhanceRecursiveCharacterTextSplitter)
             splits = [s for s in splits if (s not in {"", "\n"})]
         _good_splits = []
         _good_splits_lengths = []  # cache the lengths of the splits
-        _separator = separator if self._keep_separator else ""
+        _separator = "" if self._keep_separator else separator
         s_lens = self._length_function(splits)
         if separator != "":
             for s, s_len in zip(splits, s_lens):

api/core/tools/errors.py

@@ -29,6 +29,10 @@ class ToolApiSchemaError(ValueError):
     pass
 
 
+class ToolSSRFError(ValueError):
+    pass
+
+
 class ToolCredentialPolicyViolationError(ValueError):
     pass
 

api/core/tools/utils/message_transformer.py

@@ -101,6 +101,8 @@ class ToolFileMessageTransformer:
                 meta = message.meta or {}
 
                 mimetype = meta.get("mime_type", "application/octet-stream")
+                if not mimetype:
+                    mimetype = "application/octet-stream"
                 # get filename from meta
                 filename = meta.get("filename", None)
                 # if message is str, encode it to bytes

api/core/tools/utils/parser.py

@@ -425,7 +425,7 @@ class ApiBasedToolSchemaParser:
         except ToolApiSchemaError as e:
             openapi_error = e
 
-        # openai parse error, fallback to swagger
+        # openapi parse error, fallback to swagger
         try:
             converted_swagger = ApiBasedToolSchemaParser.parse_swagger_to_openapi(
                 loaded_content, extra_info=extra_info, warning=warning
@@ -436,7 +436,6 @@ class ApiBasedToolSchemaParser:
             ), schema_type
         except ToolApiSchemaError as e:
             swagger_error = e
-
         # swagger parse error, fallback to openai plugin
         try:
             openapi_plugin = ApiBasedToolSchemaParser.parse_openai_plugin_json_to_tool_bundle(

api/core/workflow/graph_engine/graph_engine.py

@@ -140,6 +140,10 @@ class GraphEngine:
         pause_handler = PauseCommandHandler()
         self._command_processor.register_handler(PauseCommand, pause_handler)
 
+        # === Extensibility ===
+        # Layers allow plugins to extend engine functionality
+        self._layers: list[GraphEngineLayer] = []
+
         # === Worker Pool Setup ===
         # Capture Flask app context for worker threads
         flask_app: Flask | None = None
@@ -158,6 +162,7 @@ class GraphEngine:
             ready_queue=self._ready_queue,
             event_queue=self._event_queue,
             graph=self._graph,
+            layers=self._layers,
             flask_app=flask_app,
             context_vars=context_vars,
             min_workers=self._min_workers,
@@ -196,10 +201,6 @@ class GraphEngine:
             event_emitter=self._event_manager,
         )
 
-        # === Extensibility ===
-        # Layers allow plugins to extend engine functionality
-        self._layers: list[GraphEngineLayer] = []
-
         # === Validation ===
         # Ensure all nodes share the same GraphRuntimeState instance
         self._validate_graph_state_consistency()

api/core/workflow/graph_engine/layers/__init__.py

@@ -8,9 +8,11 @@ with middleware-like components that can observe events and interact with execut
 from .base import GraphEngineLayer
 from .debug_logging import DebugLoggingLayer
 from .execution_limits import ExecutionLimitsLayer
+from .observability import ObservabilityLayer
 
 __all__ = [
     "DebugLoggingLayer",
     "ExecutionLimitsLayer",
     "GraphEngineLayer",
+    "ObservabilityLayer",
 ]

api/core/workflow/graph_engine/layers/base.py

@@ -9,6 +9,7 @@ from abc import ABC, abstractmethod
 
 from core.workflow.graph_engine.protocols.command_channel import CommandChannel
 from core.workflow.graph_events import GraphEngineEvent
+from core.workflow.nodes.base.node import Node
 from core.workflow.runtime import ReadOnlyGraphRuntimeState
 
 
@@ -83,3 +84,29 @@ class GraphEngineLayer(ABC):
             error: The exception that caused execution to fail, or None if successful
         """
         pass
+
+    def on_node_run_start(self, node: Node) -> None:  # noqa: B027
+        """
+        Called immediately before a node begins execution.
+
+        Layers can override to inject behavior (e.g., start spans) prior to node execution.
+        The node's execution ID is available via `node._node_execution_id` and will be
+        consistent with all events emitted by this node execution.
+
+        Args:
+            node: The node instance about to be executed
+        """
+        pass
+
+    def on_node_run_end(self, node: Node, error: Exception | None) -> None:  # noqa: B027
+        """
+        Called after a node finishes execution.
+
+        The node's execution ID is available via `node._node_execution_id` and matches
+        the `id` field in all events emitted by this node execution.
+
+        Args:
+            node: The node instance that just finished execution
+            error: Exception instance if the node failed, otherwise None
+        """
+        pass

api/core/workflow/graph_engine/layers/node_parsers.py

@@ -0,0 +1,61 @@
+"""
+Node-level OpenTelemetry parser interfaces and defaults.
+"""
+
+import json
+from typing import Protocol
+
+from opentelemetry.trace import Span
+from opentelemetry.trace.status import Status, StatusCode
+
+from core.workflow.nodes.base.node import Node
+from core.workflow.nodes.tool.entities import ToolNodeData
+
+
+class NodeOTelParser(Protocol):
+    """Parser interface for node-specific OpenTelemetry enrichment."""
+
+    def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None: ...
+
+
+class DefaultNodeOTelParser:
+    """Fallback parser used when no node-specific parser is registered."""
+
+    def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None:
+        span.set_attribute("node.id", node.id)
+        if node.execution_id:
+            span.set_attribute("node.execution_id", node.execution_id)
+        if hasattr(node, "node_type") and node.node_type:
+            span.set_attribute("node.type", node.node_type.value)
+
+        if error:
+            span.record_exception(error)
+            span.set_status(Status(StatusCode.ERROR, str(error)))
+        else:
+            span.set_status(Status(StatusCode.OK))
+
+
+class ToolNodeOTelParser:
+    """Parser for tool nodes that captures tool-specific metadata."""
+
+    def __init__(self) -> None:
+        self._delegate = DefaultNodeOTelParser()
+
+    def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None:
+        self._delegate.parse(node=node, span=span, error=error)
+
+        tool_data = getattr(node, "_node_data", None)
+        if not isinstance(tool_data, ToolNodeData):
+            return
+
+        span.set_attribute("tool.provider.id", tool_data.provider_id)
+        span.set_attribute("tool.provider.type", tool_data.provider_type.value)
+        span.set_attribute("tool.provider.name", tool_data.provider_name)
+        span.set_attribute("tool.name", tool_data.tool_name)
+        span.set_attribute("tool.label", tool_data.tool_label)
+        if tool_data.plugin_unique_identifier:
+            span.set_attribute("tool.plugin.id", tool_data.plugin_unique_identifier)
+        if tool_data.credential_id:
+            span.set_attribute("tool.credential.id", tool_data.credential_id)
+        if tool_data.tool_configurations:
+            span.set_attribute("tool.config", json.dumps(tool_data.tool_configurations, ensure_ascii=False))

api/core/workflow/graph_engine/layers/observability.py

@@ -0,0 +1,169 @@
+"""
+Observability layer for GraphEngine.
+
+This layer creates OpenTelemetry spans for node execution, enabling distributed
+tracing of workflow execution. It establishes OTel context during node execution
+so that automatic instrumentation (HTTP requests, DB queries, etc.) automatically
+associates with the node span.
+"""
+
+import logging
+from dataclasses import dataclass
+from typing import cast, final
+
+from opentelemetry import context as context_api
+from opentelemetry.trace import Span, SpanKind, Tracer, get_tracer, set_span_in_context
+from typing_extensions import override
+
+from configs import dify_config
+from core.workflow.enums import NodeType
+from core.workflow.graph_engine.layers.base import GraphEngineLayer
+from core.workflow.graph_engine.layers.node_parsers import (
+    DefaultNodeOTelParser,
+    NodeOTelParser,
+    ToolNodeOTelParser,
+)
+from core.workflow.nodes.base.node import Node
+from extensions.otel.runtime import is_instrument_flag_enabled
+
+logger = logging.getLogger(__name__)
+
+
+@dataclass(slots=True)
+class _NodeSpanContext:
+    span: "Span"
+    token: object
+
+
+@final
+class ObservabilityLayer(GraphEngineLayer):
+    """
+    Layer that creates OpenTelemetry spans for node execution.
+
+    This layer:
+    - Creates a span when a node starts execution
+    - Establishes OTel context so automatic instrumentation associates with the span
+    - Sets complete attributes and status when node execution ends
+    """
+
+    def __init__(self) -> None:
+        super().__init__()
+        self._node_contexts: dict[str, _NodeSpanContext] = {}
+        self._parsers: dict[NodeType, NodeOTelParser] = {}
+        self._default_parser: NodeOTelParser = cast(NodeOTelParser, DefaultNodeOTelParser())
+        self._is_disabled: bool = False
+        self._tracer: Tracer | None = None
+        self._build_parser_registry()
+        self._init_tracer()
+
+    def _init_tracer(self) -> None:
+        """Initialize OpenTelemetry tracer in constructor."""
+        if not (dify_config.ENABLE_OTEL or is_instrument_flag_enabled()):
+            self._is_disabled = True
+            return
+
+        try:
+            self._tracer = get_tracer(__name__)
+        except Exception as e:
+            logger.warning("Failed to get OpenTelemetry tracer: %s", e)
+            self._is_disabled = True
+
+    def _build_parser_registry(self) -> None:
+        """Initialize parser registry for node types."""
+        self._parsers = {
+            NodeType.TOOL: ToolNodeOTelParser(),
+        }
+
+    def _get_parser(self, node: Node) -> NodeOTelParser:
+        node_type = getattr(node, "node_type", None)
+        if isinstance(node_type, NodeType):
+            return self._parsers.get(node_type, self._default_parser)
+        return self._default_parser
+
+    @override
+    def on_graph_start(self) -> None:
+        """Called when graph execution starts."""
+        self._node_contexts.clear()
+
+    @override
+    def on_node_run_start(self, node: Node) -> None:
+        """
+        Called when a node starts execution.
+
+        Creates a span and establishes OTel context for automatic instrumentation.
+        """
+        if self._is_disabled:
+            return
+
+        try:
+            if not self._tracer:
+                return
+
+            execution_id = node.execution_id
+            if not execution_id:
+                return
+
+            parent_context = context_api.get_current()
+            span = self._tracer.start_span(
+                f"{node.title}",
+                kind=SpanKind.INTERNAL,
+                context=parent_context,
+            )
+
+            new_context = set_span_in_context(span)
+            token = context_api.attach(new_context)
+
+            self._node_contexts[execution_id] = _NodeSpanContext(span=span, token=token)
+
+        except Exception as e:
+            logger.warning("Failed to create OpenTelemetry span for node %s: %s", node.id, e)
+
+    @override
+    def on_node_run_end(self, node: Node, error: Exception | None) -> None:
+        """
+        Called when a node finishes execution.
+
+        Sets complete attributes, records exceptions, and ends the span.
+        """
+        if self._is_disabled:
+            return
+
+        try:
+            execution_id = node.execution_id
+            if not execution_id:
+                return
+            node_context = self._node_contexts.get(execution_id)
+            if not node_context:
+                return
+
+            span = node_context.span
+            parser = self._get_parser(node)
+            try:
+                parser.parse(node=node, span=span, error=error)
+                span.end()
+            finally:
+                token = node_context.token
+                if token is not None:
+                    try:
+                        context_api.detach(token)
+                    except Exception:
+                        logger.warning("Failed to detach OpenTelemetry token: %s", token)
+                self._node_contexts.pop(execution_id, None)
+
+        except Exception as e:
+            logger.warning("Failed to end OpenTelemetry span for node %s: %s", node.id, e)
+
+    @override
+    def on_event(self, event) -> None:
+        """Not used in this layer."""
+        pass
+
+    @override
+    def on_graph_end(self, error: Exception | None) -> None:
+        """Called when graph execution ends."""
+        if self._node_contexts:
+            logger.warning(
+                "ObservabilityLayer: %d node spans were not properly ended",
+                len(self._node_contexts),
+            )
+            self._node_contexts.clear()

api/core/workflow/graph_engine/worker.py

@@ -9,6 +9,7 @@ import contextvars
 import queue
 import threading
 import time
+from collections.abc import Sequence
 from datetime import datetime
 from typing import final
 from uuid import uuid4
@@ -17,6 +18,7 @@ from flask import Flask
 from typing_extensions import override
 
 from core.workflow.graph import Graph
+from core.workflow.graph_engine.layers.base import GraphEngineLayer
 from core.workflow.graph_events import GraphNodeEventBase, NodeRunFailedEvent
 from core.workflow.nodes.base.node import Node
 from libs.flask_utils import preserve_flask_contexts
@@ -39,6 +41,7 @@ class Worker(threading.Thread):
         ready_queue: ReadyQueue,
         event_queue: queue.Queue[GraphNodeEventBase],
         graph: Graph,
+        layers: Sequence[GraphEngineLayer],
         worker_id: int = 0,
         flask_app: Flask | None = None,
         context_vars: contextvars.Context | None = None,
@@ -50,6 +53,7 @@ class Worker(threading.Thread):
             ready_queue: Ready queue containing node IDs ready for execution
             event_queue: Queue for pushing execution events
             graph: Graph containing nodes to execute
+            layers: Graph engine layers for node execution hooks
             worker_id: Unique identifier for this worker
             flask_app: Optional Flask application for context preservation
             context_vars: Optional context variables to preserve in worker thread
@@ -63,6 +67,7 @@ class Worker(threading.Thread):
         self._context_vars = context_vars
         self._stop_event = threading.Event()
         self._last_task_time = time.time()
+        self._layers = layers if layers is not None else []
 
     def stop(self) -> None:
         """Signal the worker to stop processing."""
@@ -122,20 +127,51 @@ class Worker(threading.Thread):
         Args:
             node: The node instance to execute
         """
-        # Execute the node with preserved context if Flask app is provided
+        node.ensure_execution_id()
+
+        error: Exception | None = None
+
         if self._flask_app and self._context_vars:
             with preserve_flask_contexts(
                 flask_app=self._flask_app,
                 context_vars=self._context_vars,
             ):
-                # Execute the node
+                self._invoke_node_run_start_hooks(node)
+                try:
                     node_events = node.run()
                     for event in node_events:
-                    # Forward event to dispatcher immediately for streaming
                         self._event_queue.put(event)
+                except Exception as exc:
+                    error = exc
+                    raise
+                finally:
+                    self._invoke_node_run_end_hooks(node, error)
         else:
-            # Execute without context preservation
+            self._invoke_node_run_start_hooks(node)
+            try:
                 node_events = node.run()
                 for event in node_events:
-                # Forward event to dispatcher immediately for streaming
                     self._event_queue.put(event)
+            except Exception as exc:
+                error = exc
+                raise
+            finally:
+                self._invoke_node_run_end_hooks(node, error)
+
+    def _invoke_node_run_start_hooks(self, node: Node) -> None:
+        """Invoke on_node_run_start hooks for all layers."""
+        for layer in self._layers:
+            try:
+                layer.on_node_run_start(node)
+            except Exception:
+                # Silently ignore layer errors to prevent disrupting node execution
+                continue
+
+    def _invoke_node_run_end_hooks(self, node: Node, error: Exception | None) -> None:
+        """Invoke on_node_run_end hooks for all layers."""
+        for layer in self._layers:
+            try:
+                layer.on_node_run_end(node, error)
+            except Exception:
+                # Silently ignore layer errors to prevent disrupting node execution
+                continue

api/core/workflow/graph_engine/worker_management/worker_pool.py

@@ -14,6 +14,7 @@ from configs import dify_config
 from core.workflow.graph import Graph
 from core.workflow.graph_events import GraphNodeEventBase
 
+from ..layers.base import GraphEngineLayer
 from ..ready_queue import ReadyQueue
 from ..worker import Worker
 
@@ -39,6 +40,7 @@ class WorkerPool:
         ready_queue: ReadyQueue,
         event_queue: queue.Queue[GraphNodeEventBase],
         graph: Graph,
+        layers: list[GraphEngineLayer],
         flask_app: "Flask | None" = None,
         context_vars: "Context | None" = None,
         min_workers: int | None = None,
@@ -53,6 +55,7 @@ class WorkerPool:
             ready_queue: Ready queue for nodes ready for execution
             event_queue: Queue for worker events
             graph: The workflow graph
+            layers: Graph engine layers for node execution hooks
             flask_app: Optional Flask app for context preservation
             context_vars: Optional context variables
             min_workers: Minimum number of workers
@@ -65,6 +68,7 @@ class WorkerPool:
         self._graph = graph
         self._flask_app = flask_app
         self._context_vars = context_vars
+        self._layers = layers
 
         # Scaling parameters with defaults
         self._min_workers = min_workers or dify_config.GRAPH_ENGINE_MIN_WORKERS
@@ -144,6 +148,7 @@ class WorkerPool:
             ready_queue=self._ready_queue,
             event_queue=self._event_queue,
             graph=self._graph,
+            layers=self._layers,
             worker_id=worker_id,
             flask_app=self._flask_app,
             context_vars=self._context_vars,

api/core/workflow/nodes/base/node.py

@@ -244,6 +244,15 @@ class Node(Generic[NodeDataT]):
     def graph_init_params(self) -> "GraphInitParams":
         return self._graph_init_params
 
+    @property
+    def execution_id(self) -> str:
+        return self._node_execution_id
+
+    def ensure_execution_id(self) -> str:
+        if not self._node_execution_id:
+            self._node_execution_id = str(uuid4())
+        return self._node_execution_id
+
     def _hydrate_node_data(self, data: Mapping[str, Any]) -> NodeDataT:
         return cast(NodeDataT, self._node_data_type.model_validate(data))
 
@@ -256,14 +265,12 @@ class Node(Generic[NodeDataT]):
         raise NotImplementedError
 
     def run(self) -> Generator[GraphNodeEventBase, None, None]:
-        # Generate a single node execution ID to use for all events
-        if not self._node_execution_id:
-            self._node_execution_id = str(uuid4())
+        execution_id = self.ensure_execution_id()
         self._start_at = naive_utc_now()
 
         # Create and push start event with required fields
         start_event = NodeRunStartedEvent(
-            id=self._node_execution_id,
+            id=execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.title,
@@ -321,7 +328,7 @@ class Node(Generic[NodeDataT]):
                 if isinstance(event, NodeEventBase):  # pyright: ignore[reportUnnecessaryIsInstance]
                     yield self._dispatch(event)
                 elif isinstance(event, GraphNodeEventBase) and not event.in_iteration_id and not event.in_loop_id:  # pyright: ignore[reportUnnecessaryIsInstance]
-                    event.id = self._node_execution_id
+                    event.id = self.execution_id
                     yield event
                 else:
                     yield event
@@ -333,7 +340,7 @@ class Node(Generic[NodeDataT]):
                 error_type="WorkflowNodeError",
             )
             yield NodeRunFailedEvent(
-                id=self._node_execution_id,
+                id=self.execution_id,
                 node_id=self._node_id,
                 node_type=self.node_type,
                 start_at=self._start_at,
@@ -512,7 +519,7 @@ class Node(Generic[NodeDataT]):
         match result.status:
             case WorkflowNodeExecutionStatus.FAILED:
                 return NodeRunFailedEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self.id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -521,7 +528,7 @@ class Node(Generic[NodeDataT]):
                 )
             case WorkflowNodeExecutionStatus.SUCCEEDED:
                 return NodeRunSucceededEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self.id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -537,7 +544,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: StreamChunkEvent) -> NodeRunStreamChunkEvent:
         return NodeRunStreamChunkEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             selector=event.selector,
@@ -550,7 +557,7 @@ class Node(Generic[NodeDataT]):
         match event.node_run_result.status:
             case WorkflowNodeExecutionStatus.SUCCEEDED:
                 return NodeRunSucceededEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self._node_id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -558,7 +565,7 @@ class Node(Generic[NodeDataT]):
                 )
             case WorkflowNodeExecutionStatus.FAILED:
                 return NodeRunFailedEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self._node_id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -573,7 +580,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: PauseRequestedEvent) -> NodeRunPauseRequestedEvent:
         return NodeRunPauseRequestedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_run_result=NodeRunResult(status=WorkflowNodeExecutionStatus.PAUSED),
@@ -583,7 +590,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: AgentLogEvent) -> NodeRunAgentLogEvent:
         return NodeRunAgentLogEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             message_id=event.message_id,
@@ -599,7 +606,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopStartedEvent) -> NodeRunLoopStartedEvent:
         return NodeRunLoopStartedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -612,7 +619,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopNextEvent) -> NodeRunLoopNextEvent:
         return NodeRunLoopNextEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -623,7 +630,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopSucceededEvent) -> NodeRunLoopSucceededEvent:
         return NodeRunLoopSucceededEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -637,7 +644,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopFailedEvent) -> NodeRunLoopFailedEvent:
         return NodeRunLoopFailedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -652,7 +659,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationStartedEvent) -> NodeRunIterationStartedEvent:
         return NodeRunIterationStartedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -665,7 +672,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationNextEvent) -> NodeRunIterationNextEvent:
         return NodeRunIterationNextEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -676,7 +683,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationSucceededEvent) -> NodeRunIterationSucceededEvent:
         return NodeRunIterationSucceededEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -690,7 +697,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationFailedEvent) -> NodeRunIterationFailedEvent:
         return NodeRunIterationFailedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -705,7 +712,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: RunRetrieverResourceEvent) -> NodeRunRetrieverResourceEvent:
         return NodeRunRetrieverResourceEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             retriever_resources=event.retriever_resources,

api/core/workflow/nodes/start/start_node.py

@@ -1,3 +1,4 @@
+import json
 from typing import Any
 
 from jsonschema import Draft7Validator, ValidationError
@@ -42,15 +43,25 @@ class StartNode(Node[StartNodeData]):
             if value is None and variable.required:
                 raise ValueError(f"{key} is required in input form")
 
-            if not isinstance(value, dict):
-                raise ValueError(f"{key} must be a JSON object")
-
             schema = variable.json_schema
             if not schema:
                 continue
 
+            if not value:
+                continue
+
             try:
-                Draft7Validator(schema).validate(value)
+                json_schema = json.loads(schema)
+            except json.JSONDecodeError as e:
+                raise ValueError(f"{schema} must be a valid JSON object")
+
+            try:
+                json_value = json.loads(value)
+            except json.JSONDecodeError as e:
+                raise ValueError(f"{value} must be a valid JSON object")
+
+            try:
+                Draft7Validator(json_schema).validate(json_value)
             except ValidationError as e:
                 raise ValueError(f"JSON object for '{key}' does not match schema: {e.message}")
-            node_inputs[key] = value
+            node_inputs[key] = json_value

api/core/workflow/nodes/trigger_webhook/node.py

@@ -1,14 +1,22 @@
+import logging
 from collections.abc import Mapping
 from typing import Any
 
+from core.file import FileTransferMethod
+from core.variables.types import SegmentType
+from core.variables.variables import FileVariable
 from core.workflow.constants import SYSTEM_VARIABLE_NODE_ID
 from core.workflow.entities.workflow_node_execution import WorkflowNodeExecutionStatus
 from core.workflow.enums import NodeExecutionType, NodeType
 from core.workflow.node_events import NodeRunResult
 from core.workflow.nodes.base.node import Node
+from factories import file_factory
+from factories.variable_factory import build_segment_with_type
 
 from .entities import ContentType, WebhookData
 
+logger = logging.getLogger(__name__)
+
 
 class TriggerWebhookNode(Node[WebhookData]):
     node_type = NodeType.TRIGGER_WEBHOOK
@@ -60,6 +68,34 @@ class TriggerWebhookNode(Node[WebhookData]):
             outputs=outputs,
         )
 
+    def generate_file_var(self, param_name: str, file: dict):
+        related_id = file.get("related_id")
+        transfer_method_value = file.get("transfer_method")
+        if transfer_method_value:
+            transfer_method = FileTransferMethod.value_of(transfer_method_value)
+            match transfer_method:
+                case FileTransferMethod.LOCAL_FILE | FileTransferMethod.REMOTE_URL:
+                    file["upload_file_id"] = related_id
+                case FileTransferMethod.TOOL_FILE:
+                    file["tool_file_id"] = related_id
+                case FileTransferMethod.DATASOURCE_FILE:
+                    file["datasource_file_id"] = related_id
+
+            try:
+                file_obj = file_factory.build_from_mapping(
+                    mapping=file,
+                    tenant_id=self.tenant_id,
+                )
+                file_segment = build_segment_with_type(SegmentType.FILE, file_obj)
+                return FileVariable(name=param_name, value=file_segment.value, selector=[self.id, param_name])
+            except ValueError:
+                logger.error(
+                    "Failed to build FileVariable for webhook file parameter %s",
+                    param_name,
+                    exc_info=True,
+                )
+        return None
+
     def _extract_configured_outputs(self, webhook_inputs: dict[str, Any]) -> dict[str, Any]:
         """Extract outputs based on node configuration from webhook inputs."""
         outputs = {}
@@ -107,18 +143,33 @@ class TriggerWebhookNode(Node[WebhookData]):
                 outputs[param_name] = str(webhook_data.get("body", {}).get("raw", ""))
                 continue
             elif self.node_data.content_type == ContentType.BINARY:
-                outputs[param_name] = webhook_data.get("body", {}).get("raw", b"")
+                raw_data: dict = webhook_data.get("body", {}).get("raw", {})
+                file_var = self.generate_file_var(param_name, raw_data)
+                if file_var:
+                    outputs[param_name] = file_var
+                else:
+                    outputs[param_name] = raw_data
                 continue
 
             if param_type == "file":
                 # Get File object (already processed by webhook controller)
-                file_obj = webhook_data.get("files", {}).get(param_name)
-                outputs[param_name] = file_obj
+                files = webhook_data.get("files", {})
+                if files and isinstance(files, dict):
+                    file = files.get(param_name)
+                    if file and isinstance(file, dict):
+                        file_var = self.generate_file_var(param_name, file)
+                        if file_var:
+                            outputs[param_name] = file_var
+                        else:
+                            outputs[param_name] = files
+                    else:
+                        outputs[param_name] = files
+                else:
+                    outputs[param_name] = files
             else:
                 # Get regular body parameter
                 outputs[param_name] = webhook_data.get("body", {}).get(param_name)
 
         # Include raw webhook data for debugging/advanced use
         outputs["_webhook_raw"] = webhook_data
-
         return outputs

api/core/workflow/workflow_entry.py

@@ -14,7 +14,7 @@ from core.workflow.errors import WorkflowNodeRunFailedError
 from core.workflow.graph import Graph
 from core.workflow.graph_engine import GraphEngine
 from core.workflow.graph_engine.command_channels import InMemoryChannel
-from core.workflow.graph_engine.layers import DebugLoggingLayer, ExecutionLimitsLayer
+from core.workflow.graph_engine.layers import DebugLoggingLayer, ExecutionLimitsLayer, ObservabilityLayer
 from core.workflow.graph_engine.protocols.command_channel import CommandChannel
 from core.workflow.graph_events import GraphEngineEvent, GraphNodeEventBase, GraphRunFailedEvent
 from core.workflow.nodes import NodeType
@@ -23,6 +23,7 @@ from core.workflow.nodes.node_mapping import NODE_TYPE_CLASSES_MAPPING
 from core.workflow.runtime import GraphRuntimeState, VariablePool
 from core.workflow.system_variable import SystemVariable
 from core.workflow.variable_loader import DUMMY_VARIABLE_LOADER, VariableLoader, load_into_variable_pool
+from extensions.otel.runtime import is_instrument_flag_enabled
 from factories import file_factory
 from models.enums import UserFrom
 from models.workflow import Workflow
@@ -98,6 +99,10 @@ class WorkflowEntry:
         )
         self.graph_engine.layer(limits_layer)
 
+        # Add observability layer when OTel is enabled
+        if dify_config.ENABLE_OTEL or is_instrument_flag_enabled():
+            self.graph_engine.layer(ObservabilityLayer())
+
     def run(self) -> Generator[GraphEngineEvent, None, None]:
         graph_engine = self.graph_engine
 

api/docker/entrypoint.sh

@@ -34,10 +34,10 @@ if [[ "${MODE}" == "worker" ]]; then
   if [[ -z "${CELERY_QUEUES}" ]]; then
     if [[ "${EDITION}" == "CLOUD" ]]; then
       # Cloud edition: separate queues for dataset and trigger tasks
-      DEFAULT_QUEUES="dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow_professional,workflow_team,workflow_sandbox,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor"
+      DEFAULT_QUEUES="dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow_professional,workflow_team,workflow_sandbox,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor,retention"
     else
       # Community edition (SELF_HOSTED): dataset, pipeline and workflow have separate queues
-      DEFAULT_QUEUES="dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor"
+      DEFAULT_QUEUES="dataset,priority_dataset,priority_pipeline,pipeline,mail,ops_trace,app_deletion,plugin,workflow_storage,conversation,workflow,schedule_poller,schedule_executor,triggered_workflow_dispatcher,trigger_refresh_executor,retention"
     fi
   else
     DEFAULT_QUEUES="${CELERY_QUEUES}"
@@ -69,6 +69,53 @@ if [[ "${MODE}" == "worker" ]]; then
 
 elif [[ "${MODE}" == "beat" ]]; then
   exec celery -A app.celery beat --loglevel ${LOG_LEVEL:-INFO}
+
+elif [[ "${MODE}" == "job" ]]; then
+  # Job mode: Run a one-time Flask command and exit
+  # Pass Flask command and arguments via container args
+  # Example K8s usage:
+  #   args:
+  #   - create-tenant
+  #   - --email
+  #   - admin@example.com
+  #
+  # Example Docker usage:
+  #   docker run -e MODE=job dify-api:latest create-tenant --email admin@example.com
+
+  if [[ $# -eq 0 ]]; then
+    echo "Error: No command specified for job mode."
+    echo ""
+    echo "Usage examples:"
+    echo "  Kubernetes:"
+    echo "    args: [create-tenant, --email, admin@example.com]"
+    echo ""
+    echo "  Docker:"
+    echo "    docker run -e MODE=job dify-api create-tenant --email admin@example.com"
+    echo ""
+    echo "Available commands:"
+    echo "  create-tenant, reset-password, reset-email, upgrade-db,"
+    echo "  vdb-migrate, install-plugins, and more..."
+    echo ""
+    echo "Run 'flask --help' to see all available commands."
+    exit 1
+  fi
+
+  echo "Running Flask job command: flask $*"
+  
+  # Temporarily disable exit on error to capture exit code
+  set +e
+  flask "$@"
+  JOB_EXIT_CODE=$?
+  set -e
+
+  if [[ ${JOB_EXIT_CODE} -eq 0 ]]; then
+    echo "Job completed successfully."
+  else
+    echo "Job failed with exit code ${JOB_EXIT_CODE}."
+  fi
+
+  exit ${JOB_EXIT_CODE}
+
 else
   if [[ "${DEBUG}" == "true" ]]; then
     exec flask run --host=${DIFY_BIND_ADDRESS:-0.0.0.0} --port=${DIFY_PORT:-5001} --debug

api/events/event_handlers/clean_when_dataset_deleted.py

@@ -15,4 +15,5 @@ def handle(sender: Dataset, **kwargs):
         dataset.index_struct,
         dataset.collection_binding_id,
         dataset.doc_form,
+        dataset.pipeline_id,
     )

api/extensions/ext_blueprints.py

@@ -9,11 +9,21 @@ FILES_HEADERS: tuple[str, ...] = (*BASE_CORS_HEADERS, HEADER_NAME_CSRF_TOKEN)
 EXPOSED_HEADERS: tuple[str, ...] = ("X-Version", "X-Env", "X-Trace-Id")
 
 
-def init_app(app: DifyApp):
-    # register blueprint routers
+def _apply_cors_once(bp, /, **cors_kwargs):
+    """Make CORS idempotent so blueprints can be reused across multiple app instances."""
+
+    if getattr(bp, "_dify_cors_applied", False):
+        return
 
     from flask_cors import CORS
 
+    CORS(bp, **cors_kwargs)
+    bp._dify_cors_applied = True
+
+
+def init_app(app: DifyApp):
+    # register blueprint routers
+
     from controllers.console import bp as console_app_bp
     from controllers.files import bp as files_bp
     from controllers.inner_api import bp as inner_api_bp
@@ -22,7 +32,7 @@ def init_app(app: DifyApp):
     from controllers.trigger import bp as trigger_bp
     from controllers.web import bp as web_bp
 
-    CORS(
+    _apply_cors_once(
         service_api_bp,
         allow_headers=list(SERVICE_API_HEADERS),
         methods=["GET", "PUT", "POST", "DELETE", "OPTIONS", "PATCH"],
@@ -30,7 +40,7 @@ def init_app(app: DifyApp):
     )
     app.register_blueprint(service_api_bp)
 
-    CORS(
+    _apply_cors_once(
         web_bp,
         resources={r"/*": {"origins": dify_config.WEB_API_CORS_ALLOW_ORIGINS}},
         supports_credentials=True,
@@ -40,7 +50,7 @@ def init_app(app: DifyApp):
     )
     app.register_blueprint(web_bp)
 
-    CORS(
+    _apply_cors_once(
         console_app_bp,
         resources={r"/*": {"origins": dify_config.CONSOLE_CORS_ALLOW_ORIGINS}},
         supports_credentials=True,
@@ -50,7 +60,7 @@ def init_app(app: DifyApp):
     )
     app.register_blueprint(console_app_bp)
 
-    CORS(
+    _apply_cors_once(
         files_bp,
         allow_headers=list(FILES_HEADERS),
         methods=["GET", "PUT", "POST", "DELETE", "OPTIONS", "PATCH"],
@@ -62,7 +72,7 @@ def init_app(app: DifyApp):
     app.register_blueprint(mcp_bp)
 
     # Register trigger blueprint with CORS for webhook calls
-    CORS(
+    _apply_cors_once(
         trigger_bp,
         allow_headers=["Content-Type", "Authorization", "X-App-Code"],
         methods=["GET", "PUT", "POST", "DELETE", "OPTIONS", "PATCH", "HEAD"],

api/extensions/ext_logstore.py

@@ -0,0 +1,74 @@
+"""
+Logstore extension for Dify application.
+
+This extension initializes the logstore (Aliyun SLS) on application startup,
+creating necessary projects, logstores, and indexes if they don't exist.
+"""
+
+import logging
+import os
+
+from dotenv import load_dotenv
+
+from dify_app import DifyApp
+
+logger = logging.getLogger(__name__)
+
+
+def is_enabled() -> bool:
+    """
+    Check if logstore extension is enabled.
+
+    Returns:
+        True if all required Aliyun SLS environment variables are set, False otherwise
+    """
+    # Load environment variables from .env file
+    load_dotenv()
+
+    required_vars = [
+        "ALIYUN_SLS_ACCESS_KEY_ID",
+        "ALIYUN_SLS_ACCESS_KEY_SECRET",
+        "ALIYUN_SLS_ENDPOINT",
+        "ALIYUN_SLS_REGION",
+        "ALIYUN_SLS_PROJECT_NAME",
+    ]
+
+    all_set = all(os.environ.get(var) for var in required_vars)
+
+    if not all_set:
+        logger.info("Logstore extension disabled: required Aliyun SLS environment variables not set")
+
+    return all_set
+
+
+def init_app(app: DifyApp):
+    """
+    Initialize logstore on application startup.
+
+    This function:
+    1. Creates Aliyun SLS project if it doesn't exist
+    2. Creates logstores (workflow_execution, workflow_node_execution) if they don't exist
+    3. Creates indexes with field configurations based on PostgreSQL table structures
+
+    This operation is idempotent and only executes once during application startup.
+
+    Args:
+        app: The Dify application instance
+    """
+    try:
+        from extensions.logstore.aliyun_logstore import AliyunLogStore
+
+        logger.info("Initializing logstore...")
+
+        # Create logstore client and initialize project/logstores/indexes
+        logstore_client = AliyunLogStore()
+        logstore_client.init_project_logstore()
+
+        # Attach to app for potential later use
+        app.extensions["logstore"] = logstore_client
+
+        logger.info("Logstore initialized successfully")
+    except Exception:
+        logger.exception("Failed to initialize logstore")
+        # Don't raise - allow application to continue even if logstore init fails
+        # This ensures that the application can still run if logstore is misconfigured

api/extensions/ext_session_factory.py

@@ -0,0 +1,7 @@
+from core.db.session_factory import configure_session_factory
+from extensions.ext_database import db
+
+
+def init_app(app):
+    with app.app_context():
+        configure_session_factory(db.engine)

api/extensions/logstore/aliyun_logstore.py

@@ -0,0 +1,890 @@
+import logging
+import os
+import threading
+import time
+from collections.abc import Sequence
+from typing import Any
+
+import sqlalchemy as sa
+from aliyun.log import (  # type: ignore[import-untyped]
+    GetLogsRequest,
+    IndexConfig,
+    IndexKeyConfig,
+    IndexLineConfig,
+    LogClient,
+    LogItem,
+    PutLogsRequest,
+)
+from aliyun.log.auth import AUTH_VERSION_4  # type: ignore[import-untyped]
+from aliyun.log.logexception import LogException  # type: ignore[import-untyped]
+from dotenv import load_dotenv
+from sqlalchemy.orm import DeclarativeBase
+
+from configs import dify_config
+from extensions.logstore.aliyun_logstore_pg import AliyunLogStorePG
+
+logger = logging.getLogger(__name__)
+
+
+class AliyunLogStore:
+    """
+    Singleton class for Aliyun SLS LogStore operations.
+
+    Ensures only one instance exists to prevent multiple PG connection pools.
+    """
+
+    _instance: "AliyunLogStore | None" = None
+    _initialized: bool = False
+
+    # Track delayed PG connection for newly created projects
+    _pg_connection_timer: threading.Timer | None = None
+    _pg_connection_delay: int = 90  # delay seconds
+
+    # Default tokenizer for text/json fields and full-text index
+    # Common delimiters: comma, space, quotes, punctuation, operators, brackets, special chars
+    DEFAULT_TOKEN_LIST = [
+        ",",
+        " ",
+        '"',
+        '"',
+        ";",
+        "=",
+        "(",
+        ")",
+        "[",
+        "]",
+        "{",
+        "}",
+        "?",
+        "@",
+        "&",
+        "<",
+        ">",
+        "/",
+        ":",
+        "\n",
+        "\t",
+    ]
+
+    def __new__(cls) -> "AliyunLogStore":
+        """Implement singleton pattern."""
+        if cls._instance is None:
+            cls._instance = super().__new__(cls)
+        return cls._instance
+
+    project_des = "dify"
+
+    workflow_execution_logstore = "workflow_execution"
+
+    workflow_node_execution_logstore = "workflow_node_execution"
+
+    @staticmethod
+    def _sqlalchemy_type_to_logstore_type(column: Any) -> str:
+        """
+        Map SQLAlchemy column type to Aliyun LogStore index type.
+
+        Args:
+            column: SQLAlchemy column object
+
+        Returns:
+            LogStore index type: 'text', 'long', 'double', or 'json'
+        """
+        column_type = column.type
+
+        # Integer types -> long
+        if isinstance(column_type, (sa.Integer, sa.BigInteger, sa.SmallInteger)):
+            return "long"
+
+        # Float types -> double
+        if isinstance(column_type, (sa.Float, sa.Numeric)):
+            return "double"
+
+        # String and Text types -> text
+        if isinstance(column_type, (sa.String, sa.Text)):
+            return "text"
+
+        # DateTime -> text (stored as ISO format string in logstore)
+        if isinstance(column_type, sa.DateTime):
+            return "text"
+
+        # Boolean -> long (stored as 0/1)
+        if isinstance(column_type, sa.Boolean):
+            return "long"
+
+        # JSON -> json
+        if isinstance(column_type, sa.JSON):
+            return "json"
+
+        # Default to text for unknown types
+        return "text"
+
+    @staticmethod
+    def _generate_index_keys_from_model(model_class: type[DeclarativeBase]) -> dict[str, IndexKeyConfig]:
+        """
+        Automatically generate LogStore field index configuration from SQLAlchemy model.
+
+        This method introspects the SQLAlchemy model's column definitions and creates
+        corresponding LogStore index configurations. When the PG schema is updated via
+        Flask-Migrate, this method will automatically pick up the new fields on next startup.
+
+        Args:
+            model_class: SQLAlchemy model class (e.g., WorkflowRun, WorkflowNodeExecutionModel)
+
+        Returns:
+            Dictionary mapping field names to IndexKeyConfig objects
+        """
+        index_keys = {}
+
+        # Iterate over all mapped columns in the model
+        if hasattr(model_class, "__mapper__"):
+            for column_name, column_property in model_class.__mapper__.columns.items():
+                # Skip relationship properties and other non-column attributes
+                if not hasattr(column_property, "type"):
+                    continue
+
+                # Map SQLAlchemy type to LogStore type
+                logstore_type = AliyunLogStore._sqlalchemy_type_to_logstore_type(column_property)
+
+                # Create index configuration
+                # - text fields: case_insensitive for better search, with tokenizer and Chinese support
+                # - all fields: doc_value=True for analytics
+                if logstore_type == "text":
+                    index_keys[column_name] = IndexKeyConfig(
+                        index_type="text",
+                        case_sensitive=False,
+                        doc_value=True,
+                        token_list=AliyunLogStore.DEFAULT_TOKEN_LIST,
+                        chinese=True,
+                    )
+                else:
+                    index_keys[column_name] = IndexKeyConfig(index_type=logstore_type, doc_value=True)
+
+        # Add log_version field (not in PG model, but used in logstore for versioning)
+        index_keys["log_version"] = IndexKeyConfig(index_type="long", doc_value=True)
+
+        return index_keys
+
+    def __init__(self) -> None:
+        # Skip initialization if already initialized (singleton pattern)
+        if self.__class__._initialized:
+            return
+
+        load_dotenv()
+
+        self.access_key_id: str = os.environ.get("ALIYUN_SLS_ACCESS_KEY_ID", "")
+        self.access_key_secret: str = os.environ.get("ALIYUN_SLS_ACCESS_KEY_SECRET", "")
+        self.endpoint: str = os.environ.get("ALIYUN_SLS_ENDPOINT", "")
+        self.region: str = os.environ.get("ALIYUN_SLS_REGION", "")
+        self.project_name: str = os.environ.get("ALIYUN_SLS_PROJECT_NAME", "")
+        self.logstore_ttl: int = int(os.environ.get("ALIYUN_SLS_LOGSTORE_TTL", 365))
+        self.log_enabled: bool = os.environ.get("SQLALCHEMY_ECHO", "false").lower() == "true"
+        self.pg_mode_enabled: bool = os.environ.get("LOGSTORE_PG_MODE_ENABLED", "true").lower() == "true"
+
+        # Initialize SDK client
+        self.client = LogClient(
+            self.endpoint, self.access_key_id, self.access_key_secret, auth_version=AUTH_VERSION_4, region=self.region
+        )
+
+        # Append Dify identification to the existing user agent
+        original_user_agent = self.client._user_agent  # pyright: ignore[reportPrivateUsage]
+        dify_version = dify_config.project.version
+        enhanced_user_agent = f"Dify,Dify-{dify_version},{original_user_agent}"
+        self.client.set_user_agent(enhanced_user_agent)
+
+        # PG client will be initialized in init_project_logstore
+        self._pg_client: AliyunLogStorePG | None = None
+        self._use_pg_protocol: bool = False
+
+        self.__class__._initialized = True
+
+    @property
+    def supports_pg_protocol(self) -> bool:
+        """Check if PG protocol is supported and enabled."""
+        return self._use_pg_protocol
+
+    def _attempt_pg_connection_init(self) -> bool:
+        """
+        Attempt to initialize PG connection.
+
+        This method tries to establish PG connection and performs necessary checks.
+        It's used both for immediate connection (existing projects) and delayed connection (new projects).
+
+        Returns:
+            True if PG connection was successfully established, False otherwise.
+        """
+        if not self.pg_mode_enabled or not self._pg_client:
+            return False
+
+        try:
+            self._use_pg_protocol = self._pg_client.init_connection()
+            if self._use_pg_protocol:
+                logger.info("Successfully connected to project %s using PG protocol", self.project_name)
+                # Check if scan_index is enabled for all logstores
+                self._check_and_disable_pg_if_scan_index_disabled()
+                return True
+            else:
+                logger.info("PG connection failed for project %s. Will use SDK mode.", self.project_name)
+                return False
+        except Exception as e:
+            logger.warning(
+                "Failed to establish PG connection for project %s: %s. Will use SDK mode.",
+                self.project_name,
+                str(e),
+            )
+            self._use_pg_protocol = False
+            return False
+
+    def _delayed_pg_connection_init(self) -> None:
+        """
+        Delayed initialization of PG connection for newly created projects.
+
+        This method is called by a background timer 3 minutes after project creation.
+        """
+        # Double check conditions in case state changed
+        if self._use_pg_protocol:
+            return
+
+        logger.info(
+            "Attempting delayed PG connection for newly created project %s ...",
+            self.project_name,
+        )
+        self._attempt_pg_connection_init()
+        self.__class__._pg_connection_timer = None
+
+    def init_project_logstore(self):
+        """
+        Initialize project, logstore, index, and PG connection.
+
+        This method should be called once during application startup to ensure
+        all required resources exist and connections are established.
+        """
+        # Step 1: Ensure project and logstore exist
+        project_is_new = False
+        if not self.is_project_exist():
+            self.create_project()
+            project_is_new = True
+
+        self.create_logstore_if_not_exist()
+
+        # Step 2: Initialize PG client and connection (if enabled)
+        if not self.pg_mode_enabled:
+            logger.info("PG mode is disabled. Will use SDK mode.")
+            return
+
+        # Create PG client if not already created
+        if self._pg_client is None:
+            logger.info("Initializing PG client for project %s...", self.project_name)
+            self._pg_client = AliyunLogStorePG(
+                self.access_key_id, self.access_key_secret, self.endpoint, self.project_name
+            )
+
+        # Step 3: Establish PG connection based on project status
+        if project_is_new:
+            # For newly created projects, schedule delayed PG connection
+            self._use_pg_protocol = False
+            logger.info(
+                "Project %s is newly created. Will use SDK mode and schedule PG connection attempt in %d seconds.",
+                self.project_name,
+                self.__class__._pg_connection_delay,
+            )
+            if self.__class__._pg_connection_timer is not None:
+                self.__class__._pg_connection_timer.cancel()
+            self.__class__._pg_connection_timer = threading.Timer(
+                self.__class__._pg_connection_delay,
+                self._delayed_pg_connection_init,
+            )
+            self.__class__._pg_connection_timer.daemon = True  # Don't block app shutdown
+            self.__class__._pg_connection_timer.start()
+        else:
+            # For existing projects, attempt PG connection immediately
+            logger.info("Project %s already exists. Attempting PG connection...", self.project_name)
+            self._attempt_pg_connection_init()
+
+    def _check_and_disable_pg_if_scan_index_disabled(self) -> None:
+        """
+        Check if scan_index is enabled for all logstores.
+        If any logstore has scan_index=false, disable PG protocol.
+
+        This is necessary because PG protocol requires scan_index to be enabled.
+        """
+        logstore_name_list = [
+            AliyunLogStore.workflow_execution_logstore,
+            AliyunLogStore.workflow_node_execution_logstore,
+        ]
+
+        for logstore_name in logstore_name_list:
+            existing_config = self.get_existing_index_config(logstore_name)
+            if existing_config and not existing_config.scan_index:
+                logger.info(
+                    "Logstore %s has scan_index=false, USE SDK mode for read/write operations. "
+                    "PG protocol requires scan_index to be enabled.",
+                    logstore_name,
+                )
+                self._use_pg_protocol = False
+                # Close PG connection if it was initialized
+                if self._pg_client:
+                    self._pg_client.close()
+                    self._pg_client = None
+                return
+
+    def is_project_exist(self) -> bool:
+        try:
+            self.client.get_project(self.project_name)
+            return True
+        except Exception as e:
+            if e.args[0] == "ProjectNotExist":
+                return False
+            else:
+                raise e
+
+    def create_project(self):
+        try:
+            self.client.create_project(self.project_name, AliyunLogStore.project_des)
+            logger.info("Project %s created successfully", self.project_name)
+        except LogException as e:
+            logger.exception(
+                "Failed to create project %s: errorCode=%s, errorMessage=%s, requestId=%s",
+                self.project_name,
+                e.get_error_code(),
+                e.get_error_message(),
+                e.get_request_id(),
+            )
+            raise
+
+    def is_logstore_exist(self, logstore_name: str) -> bool:
+        try:
+            _ = self.client.get_logstore(self.project_name, logstore_name)
+            return True
+        except Exception as e:
+            if e.args[0] == "LogStoreNotExist":
+                return False
+            else:
+                raise e
+
+    def create_logstore_if_not_exist(self) -> None:
+        logstore_name_list = [
+            AliyunLogStore.workflow_execution_logstore,
+            AliyunLogStore.workflow_node_execution_logstore,
+        ]
+
+        for logstore_name in logstore_name_list:
+            if not self.is_logstore_exist(logstore_name):
+                try:
+                    self.client.create_logstore(
+                        project_name=self.project_name, logstore_name=logstore_name, ttl=self.logstore_ttl
+                    )
+                    logger.info("logstore %s created successfully", logstore_name)
+                except LogException as e:
+                    logger.exception(
+                        "Failed to create logstore %s: errorCode=%s, errorMessage=%s, requestId=%s",
+                        logstore_name,
+                        e.get_error_code(),
+                        e.get_error_message(),
+                        e.get_request_id(),
+                    )
+                    raise
+
+            # Ensure index contains all Dify-required fields
+            # This intelligently merges with existing config, preserving custom indexes
+            self.ensure_index_config(logstore_name)
+
+    def is_index_exist(self, logstore_name: str) -> bool:
+        try:
+            _ = self.client.get_index_config(self.project_name, logstore_name)
+            return True
+        except Exception as e:
+            if e.args[0] == "IndexConfigNotExist":
+                return False
+            else:
+                raise e
+
+    def get_existing_index_config(self, logstore_name: str) -> IndexConfig | None:
+        """
+        Get existing index configuration from logstore.
+
+        Args:
+            logstore_name: Name of the logstore
+
+        Returns:
+            IndexConfig object if index exists, None otherwise
+        """
+        try:
+            response = self.client.get_index_config(self.project_name, logstore_name)
+            return response.get_index_config()
+        except Exception as e:
+            if e.args[0] == "IndexConfigNotExist":
+                return None
+            else:
+                logger.exception("Failed to get index config for logstore %s", logstore_name)
+                raise e
+
+    def _get_workflow_execution_index_keys(self) -> dict[str, IndexKeyConfig]:
+        """
+        Get field index configuration for workflow_execution logstore.
+
+        This method automatically generates index configuration from the WorkflowRun SQLAlchemy model.
+        When the PG schema is updated via Flask-Migrate, the index configuration will be automatically
+        updated on next application startup.
+        """
+        from models.workflow import WorkflowRun
+
+        index_keys = self._generate_index_keys_from_model(WorkflowRun)
+
+        # Add custom fields that are in logstore but not in PG model
+        # These fields are added by the repository layer
+        index_keys["error_message"] = IndexKeyConfig(
+            index_type="text",
+            case_sensitive=False,
+            doc_value=True,
+            token_list=self.DEFAULT_TOKEN_LIST,
+            chinese=True,
+        )  # Maps to 'error' in PG
+        index_keys["started_at"] = IndexKeyConfig(
+            index_type="text",
+            case_sensitive=False,
+            doc_value=True,
+            token_list=self.DEFAULT_TOKEN_LIST,
+            chinese=True,
+        )  # Maps to 'created_at' in PG
+
+        logger.info("Generated %d index keys for workflow_execution from WorkflowRun model", len(index_keys))
+        return index_keys
+
+    def _get_workflow_node_execution_index_keys(self) -> dict[str, IndexKeyConfig]:
+        """
+        Get field index configuration for workflow_node_execution logstore.
+
+        This method automatically generates index configuration from the WorkflowNodeExecutionModel.
+        When the PG schema is updated via Flask-Migrate, the index configuration will be automatically
+        updated on next application startup.
+        """
+        from models.workflow import WorkflowNodeExecutionModel
+
+        index_keys = self._generate_index_keys_from_model(WorkflowNodeExecutionModel)
+
+        logger.debug(
+            "Generated %d index keys for workflow_node_execution from WorkflowNodeExecutionModel", len(index_keys)
+        )
+        return index_keys
+
+    def _get_index_config(self, logstore_name: str) -> IndexConfig:
+        """
+        Get index configuration for the specified logstore.
+
+        Args:
+            logstore_name: Name of the logstore
+
+        Returns:
+            IndexConfig object with line and field indexes
+        """
+        # Create full-text index (line config) with tokenizer
+        line_config = IndexLineConfig(token_list=self.DEFAULT_TOKEN_LIST, case_sensitive=False, chinese=True)
+
+        # Get field index configuration based on logstore name
+        field_keys = {}
+        if logstore_name == AliyunLogStore.workflow_execution_logstore:
+            field_keys = self._get_workflow_execution_index_keys()
+        elif logstore_name == AliyunLogStore.workflow_node_execution_logstore:
+            field_keys = self._get_workflow_node_execution_index_keys()
+
+        # key_config_list should be a dict, not a list
+        # Create index config with both line and field indexes
+        return IndexConfig(line_config=line_config, key_config_list=field_keys, scan_index=True)
+
+    def create_index(self, logstore_name: str) -> None:
+        """
+        Create index for the specified logstore with both full-text and field indexes.
+        Field indexes are automatically generated from the corresponding SQLAlchemy model.
+        """
+        index_config = self._get_index_config(logstore_name)
+
+        try:
+            self.client.create_index(self.project_name, logstore_name, index_config)
+            logger.info(
+                "index for %s created successfully with %d field indexes",
+                logstore_name,
+                len(index_config.key_config_list or {}),
+            )
+        except LogException as e:
+            logger.exception(
+                "Failed to create index for logstore %s: errorCode=%s, errorMessage=%s, requestId=%s",
+                logstore_name,
+                e.get_error_code(),
+                e.get_error_message(),
+                e.get_request_id(),
+            )
+            raise
+
+    def _merge_index_configs(
+        self, existing_config: IndexConfig, required_keys: dict[str, IndexKeyConfig], logstore_name: str
+    ) -> tuple[IndexConfig, bool]:
+        """
+        Intelligently merge existing index config with Dify's required field indexes.
+
+        This method:
+        1. Preserves all existing field indexes in logstore (including custom fields)
+        2. Adds missing Dify-required fields
+        3. Updates fields where type doesn't match (with json/text compatibility)
+        4. Corrects case mismatches (e.g., if Dify needs 'status' but logstore has 'Status')
+
+        Type compatibility rules:
+        - json and text types are considered compatible (users can manually choose either)
+        - All other type mismatches will be corrected to match Dify requirements
+
+        Note: Logstore is case-sensitive and doesn't allow duplicate fields with different cases.
+        Case mismatch means: existing field name differs from required name only in case.
+
+        Args:
+            existing_config: Current index configuration from logstore
+            required_keys: Dify's required field index configurations
+            logstore_name: Name of the logstore (for logging)
+
+        Returns:
+            Tuple of (merged_config, needs_update)
+        """
+        # key_config_list is already a dict in the SDK
+        # Make a copy to avoid modifying the original
+        existing_keys = dict(existing_config.key_config_list) if existing_config.key_config_list else {}
+
+        # Track changes
+        needs_update = False
+        case_corrections = []  # Fields that need case correction (e.g., 'Status' -> 'status')
+        missing_fields = []
+        type_mismatches = []
+
+        # First pass: Check for and resolve case mismatches with required fields
+        # Note: Logstore itself doesn't allow duplicate fields with different cases,
+        # so we only need to check if the existing case matches the required case
+        for required_name in required_keys:
+            lower_name = required_name.lower()
+            # Find key that matches case-insensitively but not exactly
+            wrong_case_key = None
+            for existing_key in existing_keys:
+                if existing_key.lower() == lower_name and existing_key != required_name:
+                    wrong_case_key = existing_key
+                    break
+
+            if wrong_case_key:
+                # Field exists but with wrong case (e.g., 'Status' when we need 'status')
+                # Remove the wrong-case key, will be added back with correct case later
+                case_corrections.append((wrong_case_key, required_name))
+                del existing_keys[wrong_case_key]
+                needs_update = True
+
+        # Second pass: Check each required field
+        for required_name, required_config in required_keys.items():
+            # Check for exact match (case-sensitive)
+            if required_name in existing_keys:
+                existing_type = existing_keys[required_name].index_type
+                required_type = required_config.index_type
+
+                # Check if type matches
+                # Special case: json and text are interchangeable for JSON content fields
+                # Allow users to manually configure text instead of json (or vice versa) without forcing updates
+                is_compatible = existing_type == required_type or ({existing_type, required_type} == {"json", "text"})
+
+                if not is_compatible:
+                    type_mismatches.append((required_name, existing_type, required_type))
+                    # Update with correct type
+                    existing_keys[required_name] = required_config
+                    needs_update = True
+                # else: field exists with compatible type, no action needed
+            else:
+                # Field doesn't exist (may have been removed in first pass due to case conflict)
+                missing_fields.append(required_name)
+                existing_keys[required_name] = required_config
+                needs_update = True
+
+        # Log changes
+        if missing_fields:
+            logger.info(
+                "Logstore %s: Adding %d missing Dify-required fields: %s",
+                logstore_name,
+                len(missing_fields),
+                ", ".join(missing_fields[:10]) + ("..." if len(missing_fields) > 10 else ""),
+            )
+
+        if type_mismatches:
+            logger.info(
+                "Logstore %s: Fixing %d type mismatches: %s",
+                logstore_name,
+                len(type_mismatches),
+                ", ".join([f"{name}({old}->{new})" for name, old, new in type_mismatches[:5]])
+                + ("..." if len(type_mismatches) > 5 else ""),
+            )
+
+        if case_corrections:
+            logger.info(
+                "Logstore %s: Correcting %d field name cases: %s",
+                logstore_name,
+                len(case_corrections),
+                ", ".join([f"'{old}' -> '{new}'" for old, new in case_corrections[:5]])
+                + ("..." if len(case_corrections) > 5 else ""),
+            )
+
+        # Create merged config
+        # key_config_list should be a dict, not a list
+        # Preserve the original scan_index value - don't force it to True
+        merged_config = IndexConfig(
+            line_config=existing_config.line_config
+            or IndexLineConfig(token_list=self.DEFAULT_TOKEN_LIST, case_sensitive=False, chinese=True),
+            key_config_list=existing_keys,
+            scan_index=existing_config.scan_index,
+        )
+
+        return merged_config, needs_update
+
+    def ensure_index_config(self, logstore_name: str) -> None:
+        """
+        Ensure index configuration includes all Dify-required fields.
+
+        This method intelligently manages index configuration:
+        1. If index doesn't exist, create it with Dify's required fields
+        2. If index exists:
+           - Check if all Dify-required fields are present
+           - Check if field types match requirements
+           - Only update if fields are missing or types are incorrect
+           - Preserve any additional custom index configurations
+
+        This approach allows users to add their own custom indexes without being overwritten.
+        """
+        # Get Dify's required field indexes
+        required_keys = {}
+        if logstore_name == AliyunLogStore.workflow_execution_logstore:
+            required_keys = self._get_workflow_execution_index_keys()
+        elif logstore_name == AliyunLogStore.workflow_node_execution_logstore:
+            required_keys = self._get_workflow_node_execution_index_keys()
+
+        # Check if index exists
+        existing_config = self.get_existing_index_config(logstore_name)
+
+        if existing_config is None:
+            # Index doesn't exist, create it
+            logger.info(
+                "Logstore %s: Index doesn't exist, creating with %d required fields",
+                logstore_name,
+                len(required_keys),
+            )
+            self.create_index(logstore_name)
+        else:
+            merged_config, needs_update = self._merge_index_configs(existing_config, required_keys, logstore_name)
+
+            if needs_update:
+                logger.info("Logstore %s: Updating index to include Dify-required fields", logstore_name)
+                try:
+                    self.client.update_index(self.project_name, logstore_name, merged_config)
+                    logger.info(
+                        "Logstore %s: Index updated successfully, now has %d total field indexes",
+                        logstore_name,
+                        len(merged_config.key_config_list or {}),
+                    )
+                except LogException as e:
+                    logger.exception(
+                        "Failed to update index for logstore %s: errorCode=%s, errorMessage=%s, requestId=%s",
+                        logstore_name,
+                        e.get_error_code(),
+                        e.get_error_message(),
+                        e.get_request_id(),
+                    )
+                    raise
+            else:
+                logger.info(
+                    "Logstore %s: Index already contains all %d Dify-required fields with correct types, "
+                    "no update needed",
+                    logstore_name,
+                    len(required_keys),
+                )
+
+    def put_log(self, logstore: str, contents: Sequence[tuple[str, str]]) -> None:
+        # Route to PG or SDK based on protocol availability
+        if self._use_pg_protocol and self._pg_client:
+            self._pg_client.put_log(logstore, contents, self.log_enabled)
+        else:
+            log_item = LogItem(contents=contents)
+            request = PutLogsRequest(project=self.project_name, logstore=logstore, logitems=[log_item])
+
+            if self.log_enabled:
+                logger.info(
+                    "[LogStore-SDK] PUT_LOG | logstore=%s | project=%s | items_count=%d",
+                    logstore,
+                    self.project_name,
+                    len(contents),
+                )
+
+            try:
+                self.client.put_logs(request)
+            except LogException as e:
+                logger.exception(
+                    "Failed to put logs to logstore %s: errorCode=%s, errorMessage=%s, requestId=%s",
+                    logstore,
+                    e.get_error_code(),
+                    e.get_error_message(),
+                    e.get_request_id(),
+                )
+                raise
+
+    def get_logs(
+        self,
+        logstore: str,
+        from_time: int,
+        to_time: int,
+        topic: str = "",
+        query: str = "",
+        line: int = 100,
+        offset: int = 0,
+        reverse: bool = True,
+    ) -> list[dict]:
+        request = GetLogsRequest(
+            project=self.project_name,
+            logstore=logstore,
+            fromTime=from_time,
+            toTime=to_time,
+            topic=topic,
+            query=query,
+            line=line,
+            offset=offset,
+            reverse=reverse,
+        )
+
+        # Log query info if SQLALCHEMY_ECHO is enabled
+        if self.log_enabled:
+            logger.info(
+                "[LogStore] GET_LOGS | logstore=%s | project=%s | query=%s | "
+                "from_time=%d | to_time=%d | line=%d | offset=%d | reverse=%s",
+                logstore,
+                self.project_name,
+                query,
+                from_time,
+                to_time,
+                line,
+                offset,
+                reverse,
+            )
+
+        try:
+            response = self.client.get_logs(request)
+            result = []
+            logs = response.get_logs() if response else []
+            for log in logs:
+                result.append(log.get_contents())
+
+            # Log result count if SQLALCHEMY_ECHO is enabled
+            if self.log_enabled:
+                logger.info(
+                    "[LogStore] GET_LOGS RESULT | logstore=%s | returned_count=%d",
+                    logstore,
+                    len(result),
+                )
+
+            return result
+        except LogException as e:
+            logger.exception(
+                "Failed to get logs from logstore %s with query '%s': errorCode=%s, errorMessage=%s, requestId=%s",
+                logstore,
+                query,
+                e.get_error_code(),
+                e.get_error_message(),
+                e.get_request_id(),
+            )
+            raise
+
+    def execute_sql(
+        self,
+        sql: str,
+        logstore: str | None = None,
+        query: str = "*",
+        from_time: int | None = None,
+        to_time: int | None = None,
+        power_sql: bool = False,
+    ) -> list[dict]:
+        """
+        Execute SQL query for aggregation and analysis.
+
+        Args:
+            sql: SQL query string (SELECT statement)
+            logstore: Name of the logstore (required)
+            query: Search/filter query for SDK mode (default: "*" for all logs).
+                   Only used in SDK mode. PG mode ignores this parameter.
+            from_time: Start time (Unix timestamp) - only used in SDK mode
+            to_time: End time (Unix timestamp) - only used in SDK mode
+            power_sql: Whether to use enhanced SQL mode (default: False)
+
+        Returns:
+            List of result rows as dictionaries
+
+        Note:
+            - PG mode: Only executes the SQL directly
+            - SDK mode: Combines query and sql as "query | sql"
+        """
+        # Logstore is required
+        if not logstore:
+            raise ValueError("logstore parameter is required for execute_sql")
+
+        # Route to PG or SDK based on protocol availability
+        if self._use_pg_protocol and self._pg_client:
+            # PG mode: execute SQL directly (ignore query parameter)
+            return self._pg_client.execute_sql(sql, logstore, self.log_enabled)
+        else:
+            # SDK mode: combine query and sql as "query | sql"
+            full_query = f"{query} | {sql}"
+
+            # Provide default time range if not specified
+            if from_time is None:
+                from_time = 0
+
+            if to_time is None:
+                to_time = int(time.time())  # now
+
+            request = GetLogsRequest(
+                project=self.project_name,
+                logstore=logstore,
+                fromTime=from_time,
+                toTime=to_time,
+                query=full_query,
+            )
+
+            # Log query info if SQLALCHEMY_ECHO is enabled
+            if self.log_enabled:
+                logger.info(
+                    "[LogStore-SDK] EXECUTE_SQL | logstore=%s | project=%s | from_time=%d | to_time=%d | full_query=%s",
+                    logstore,
+                    self.project_name,
+                    from_time,
+                    to_time,
+                    query,
+                    sql,
+                )
+
+            try:
+                response = self.client.get_logs(request)
+
+                result = []
+                logs = response.get_logs() if response else []
+                for log in logs:
+                    result.append(log.get_contents())
+
+                # Log result count if SQLALCHEMY_ECHO is enabled
+                if self.log_enabled:
+                    logger.info(
+                        "[LogStore-SDK] EXECUTE_SQL RESULT | logstore=%s | returned_count=%d",
+                        logstore,
+                        len(result),
+                    )
+
+                return result
+            except LogException as e:
+                logger.exception(
+                    "Failed to execute SQL, logstore %s: errorCode=%s, errorMessage=%s, requestId=%s, full_query=%s",
+                    logstore,
+                    e.get_error_code(),
+                    e.get_error_message(),
+                    e.get_request_id(),
+                    full_query,
+                )
+                raise
+
+
+if __name__ == "__main__":
+    aliyun_logstore = AliyunLogStore()
+    # aliyun_logstore.init_project_logstore()
+    aliyun_logstore.put_log(AliyunLogStore.workflow_execution_logstore, [("key1", "value1")])

api/extensions/logstore/aliyun_logstore_pg.py

@@ -0,0 +1,407 @@
+import logging
+import os
+import socket
+import time
+from collections.abc import Sequence
+from contextlib import contextmanager
+from typing import Any
+
+import psycopg2
+import psycopg2.pool
+from psycopg2 import InterfaceError, OperationalError
+
+from configs import dify_config
+
+logger = logging.getLogger(__name__)
+
+
+class AliyunLogStorePG:
+    """
+    PostgreSQL protocol support for Aliyun SLS LogStore.
+
+    Handles PG connection pooling and operations for regions that support PG protocol.
+    """
+
+    def __init__(self, access_key_id: str, access_key_secret: str, endpoint: str, project_name: str):
+        """
+        Initialize PG connection for SLS.
+
+        Args:
+            access_key_id: Aliyun access key ID
+            access_key_secret: Aliyun access key secret
+            endpoint: SLS endpoint
+            project_name: SLS project name
+        """
+        self._access_key_id = access_key_id
+        self._access_key_secret = access_key_secret
+        self._endpoint = endpoint
+        self.project_name = project_name
+        self._pg_pool: psycopg2.pool.SimpleConnectionPool | None = None
+        self._use_pg_protocol = False
+
+    def _check_port_connectivity(self, host: str, port: int, timeout: float = 2.0) -> bool:
+        """
+        Check if a TCP port is reachable using socket connection.
+
+        This provides a fast check before attempting full database connection,
+        preventing long waits when connecting to unsupported regions.
+
+        Args:
+            host: Hostname or IP address
+            port: Port number
+            timeout: Connection timeout in seconds (default: 2.0)
+
+        Returns:
+            True if port is reachable, False otherwise
+        """
+        try:
+            sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+            sock.settimeout(timeout)
+            result = sock.connect_ex((host, port))
+            sock.close()
+            return result == 0
+        except Exception as e:
+            logger.debug("Port connectivity check failed for %s:%d: %s", host, port, str(e))
+            return False
+
+    def init_connection(self) -> bool:
+        """
+        Initialize PostgreSQL connection pool for SLS PG protocol support.
+
+        Attempts to connect to SLS using PostgreSQL protocol. If successful, sets
+        _use_pg_protocol to True and creates a connection pool. If connection fails
+        (region doesn't support PG protocol or other errors), returns False.
+
+        Returns:
+            True if PG protocol is supported and initialized, False otherwise
+        """
+        try:
+            # Extract hostname from endpoint (remove protocol if present)
+            pg_host = self._endpoint.replace("http://", "").replace("https://", "")
+
+            # Get pool configuration
+            pg_max_connections = int(os.environ.get("ALIYUN_SLS_PG_MAX_CONNECTIONS", 10))
+
+            logger.debug(
+                "Check PG protocol connection to SLS: host=%s, project=%s",
+                pg_host,
+                self.project_name,
+            )
+
+            # Fast port connectivity check before attempting full connection
+            # This prevents long waits when connecting to unsupported regions
+            if not self._check_port_connectivity(pg_host, 5432, timeout=1.0):
+                logger.info(
+                    "USE SDK mode for read/write operations, host=%s",
+                    pg_host,
+                )
+                return False
+
+            # Create connection pool
+            self._pg_pool = psycopg2.pool.SimpleConnectionPool(
+                minconn=1,
+                maxconn=pg_max_connections,
+                host=pg_host,
+                port=5432,
+                database=self.project_name,
+                user=self._access_key_id,
+                password=self._access_key_secret,
+                sslmode="require",
+                connect_timeout=5,
+                application_name=f"Dify-{dify_config.project.version}",
+            )
+
+            # Note: Skip test query because SLS PG protocol only supports SELECT/INSERT on actual tables
+            # Connection pool creation success already indicates connectivity
+
+            self._use_pg_protocol = True
+            logger.info(
+                "PG protocol initialized successfully for SLS project=%s. Will use PG for read/write operations.",
+                self.project_name,
+            )
+            return True
+
+        except Exception as e:
+            # PG connection failed - fallback to SDK mode
+            self._use_pg_protocol = False
+            if self._pg_pool:
+                try:
+                    self._pg_pool.closeall()
+                except Exception:
+                    logger.debug("Failed to close PG connection pool during cleanup, ignoring")
+            self._pg_pool = None
+
+            logger.info(
+                "PG protocol connection failed (region may not support PG protocol): %s. "
+                "Falling back to SDK mode for read/write operations.",
+                str(e),
+            )
+            return False
+
+    def _is_connection_valid(self, conn: Any) -> bool:
+        """
+        Check if a connection is still valid.
+
+        Args:
+            conn: psycopg2 connection object
+
+        Returns:
+            True if connection is valid, False otherwise
+        """
+        try:
+            # Check if connection is closed
+            if conn.closed:
+                return False
+
+            # Quick ping test - execute a lightweight query
+            # For SLS PG protocol, we can't use SELECT 1 without FROM,
+            # so we just check the connection status
+            with conn.cursor() as cursor:
+                cursor.execute("SELECT 1")
+                cursor.fetchone()
+            return True
+        except Exception:
+            return False
+
+    @contextmanager
+    def _get_connection(self):
+        """
+        Context manager to get a PostgreSQL connection from the pool.
+
+        Automatically validates and refreshes stale connections.
+
+        Note: Aliyun SLS PG protocol does not support transactions, so we always
+        use autocommit mode.
+
+        Yields:
+            psycopg2 connection object
+
+        Raises:
+            RuntimeError: If PG pool is not initialized
+        """
+        if not self._pg_pool:
+            raise RuntimeError("PG connection pool is not initialized")
+
+        conn = self._pg_pool.getconn()
+        try:
+            # Validate connection and get a fresh one if needed
+            if not self._is_connection_valid(conn):
+                logger.debug("Connection is stale, marking as bad and getting a new one")
+                # Mark connection as bad and get a new one
+                self._pg_pool.putconn(conn, close=True)
+                conn = self._pg_pool.getconn()
+
+            # Aliyun SLS PG protocol does not support transactions, always use autocommit
+            conn.autocommit = True
+            yield conn
+        finally:
+            # Return connection to pool (or close if it's bad)
+            if self._is_connection_valid(conn):
+                self._pg_pool.putconn(conn)
+            else:
+                self._pg_pool.putconn(conn, close=True)
+
+    def close(self) -> None:
+        """Close the PostgreSQL connection pool."""
+        if self._pg_pool:
+            try:
+                self._pg_pool.closeall()
+                logger.info("PG connection pool closed")
+            except Exception:
+                logger.exception("Failed to close PG connection pool")
+
+    def _is_retriable_error(self, error: Exception) -> bool:
+        """
+        Check if an error is retriable (connection-related issues).
+
+        Args:
+            error: Exception to check
+
+        Returns:
+            True if the error is retriable, False otherwise
+        """
+        # Retry on connection-related errors
+        if isinstance(error, (OperationalError, InterfaceError)):
+            return True
+
+        # Check error message for specific connection issues
+        error_msg = str(error).lower()
+        retriable_patterns = [
+            "connection",
+            "timeout",
+            "closed",
+            "broken pipe",
+            "reset by peer",
+            "no route to host",
+            "network",
+        ]
+        return any(pattern in error_msg for pattern in retriable_patterns)
+
+    def put_log(self, logstore: str, contents: Sequence[tuple[str, str]], log_enabled: bool = False) -> None:
+        """
+        Write log to SLS using PostgreSQL protocol with automatic retry.
+
+        Note: SLS PG protocol only supports INSERT (not UPDATE). This uses append-only
+        writes with log_version field for versioning, same as SDK implementation.
+
+        Args:
+            logstore: Name of the logstore table
+            contents: List of (field_name, value) tuples
+            log_enabled: Whether to enable logging
+
+        Raises:
+            psycopg2.Error: If database operation fails after all retries
+        """
+        if not contents:
+            return
+
+        # Extract field names and values from contents
+        fields = [field_name for field_name, _ in contents]
+        values = [value for _, value in contents]
+
+        # Build INSERT statement with literal values
+        # Note: Aliyun SLS PG protocol doesn't support parameterized queries,
+        # so we need to use mogrify to safely create literal values
+        field_list = ", ".join([f'"{field}"' for field in fields])
+
+        if log_enabled:
+            logger.info(
+                "[LogStore-PG] PUT_LOG | logstore=%s | project=%s | items_count=%d",
+                logstore,
+                self.project_name,
+                len(contents),
+            )
+
+        # Retry configuration
+        max_retries = 3
+        retry_delay = 0.1  # Start with 100ms
+
+        for attempt in range(max_retries):
+            try:
+                with self._get_connection() as conn:
+                    with conn.cursor() as cursor:
+                        # Use mogrify to safely convert values to SQL literals
+                        placeholders = ", ".join(["%s"] * len(fields))
+                        values_literal = cursor.mogrify(f"({placeholders})", values).decode("utf-8")
+                        insert_sql = f'INSERT INTO "{logstore}" ({field_list}) VALUES {values_literal}'
+                        cursor.execute(insert_sql)
+                # Success - exit retry loop
+                return
+
+            except psycopg2.Error as e:
+                # Check if error is retriable
+                if not self._is_retriable_error(e):
+                    # Not a retriable error (e.g., data validation error), fail immediately
+                    logger.exception(
+                        "Failed to put logs to logstore %s via PG protocol (non-retriable error)",
+                        logstore,
+                    )
+                    raise
+
+                # Retriable error - log and retry if we have attempts left
+                if attempt < max_retries - 1:
+                    logger.warning(
+                        "Failed to put logs to logstore %s via PG protocol (attempt %d/%d): %s. Retrying...",
+                        logstore,
+                        attempt + 1,
+                        max_retries,
+                        str(e),
+                    )
+                    time.sleep(retry_delay)
+                    retry_delay *= 2  # Exponential backoff
+                else:
+                    # Last attempt failed
+                    logger.exception(
+                        "Failed to put logs to logstore %s via PG protocol after %d attempts",
+                        logstore,
+                        max_retries,
+                    )
+                    raise
+
+    def execute_sql(self, sql: str, logstore: str, log_enabled: bool = False) -> list[dict[str, Any]]:
+        """
+        Execute SQL query using PostgreSQL protocol with automatic retry.
+
+        Args:
+            sql: SQL query string
+            logstore: Name of the logstore (for logging purposes)
+            log_enabled: Whether to enable logging
+
+        Returns:
+            List of result rows as dictionaries
+
+        Raises:
+            psycopg2.Error: If database operation fails after all retries
+        """
+        if log_enabled:
+            logger.info(
+                "[LogStore-PG] EXECUTE_SQL | logstore=%s | project=%s | sql=%s",
+                logstore,
+                self.project_name,
+                sql,
+            )
+
+        # Retry configuration
+        max_retries = 3
+        retry_delay = 0.1  # Start with 100ms
+
+        for attempt in range(max_retries):
+            try:
+                with self._get_connection() as conn:
+                    with conn.cursor() as cursor:
+                        cursor.execute(sql)
+
+                        # Get column names from cursor description
+                        columns = [desc[0] for desc in cursor.description]
+
+                        # Fetch all results and convert to list of dicts
+                        result = []
+                        for row in cursor.fetchall():
+                            row_dict = {}
+                            for col, val in zip(columns, row):
+                                row_dict[col] = "" if val is None else str(val)
+                            result.append(row_dict)
+
+                        if log_enabled:
+                            logger.info(
+                                "[LogStore-PG] EXECUTE_SQL RESULT | logstore=%s | returned_count=%d",
+                                logstore,
+                                len(result),
+                            )
+
+                        return result
+
+            except psycopg2.Error as e:
+                # Check if error is retriable
+                if not self._is_retriable_error(e):
+                    # Not a retriable error (e.g., SQL syntax error), fail immediately
+                    logger.exception(
+                        "Failed to execute SQL query on logstore %s via PG protocol (non-retriable error): sql=%s",
+                        logstore,
+                        sql,
+                    )
+                    raise
+
+                # Retriable error - log and retry if we have attempts left
+                if attempt < max_retries - 1:
+                    logger.warning(
+                        "Failed to execute SQL query on logstore %s via PG protocol (attempt %d/%d): %s. Retrying...",
+                        logstore,
+                        attempt + 1,
+                        max_retries,
+                        str(e),
+                    )
+                    time.sleep(retry_delay)
+                    retry_delay *= 2  # Exponential backoff
+                else:
+                    # Last attempt failed
+                    logger.exception(
+                        "Failed to execute SQL query on logstore %s via PG protocol after %d attempts: sql=%s",
+                        logstore,
+                        max_retries,
+                        sql,
+                    )
+                    raise
+
+        # This line should never be reached due to raise above, but makes type checker happy
+        return []

api/extensions/logstore/repositories/logstore_api_workflow_node_execution_repository.py

@@ -0,0 +1,365 @@
+"""
+LogStore implementation of DifyAPIWorkflowNodeExecutionRepository.
+
+This module provides the LogStore-based implementation for service-layer
+WorkflowNodeExecutionModel operations using Aliyun SLS LogStore.
+"""
+
+import logging
+import time
+from collections.abc import Sequence
+from datetime import datetime
+from typing import Any
+
+from sqlalchemy.orm import sessionmaker
+
+from extensions.logstore.aliyun_logstore import AliyunLogStore
+from models.workflow import WorkflowNodeExecutionModel
+from repositories.api_workflow_node_execution_repository import DifyAPIWorkflowNodeExecutionRepository
+
+logger = logging.getLogger(__name__)
+
+
+def _dict_to_workflow_node_execution_model(data: dict[str, Any]) -> WorkflowNodeExecutionModel:
+    """
+    Convert LogStore result dictionary to WorkflowNodeExecutionModel instance.
+
+    Args:
+        data: Dictionary from LogStore query result
+
+    Returns:
+        WorkflowNodeExecutionModel instance (detached from session)
+
+    Note:
+        The returned model is not attached to any SQLAlchemy session.
+        Relationship fields (like offload_data) are not loaded from LogStore.
+    """
+    logger.debug("_dict_to_workflow_node_execution_model: data keys=%s", list(data.keys())[:5])
+    # Create model instance without session
+    model = WorkflowNodeExecutionModel()
+
+    # Map all required fields with validation
+    # Critical fields - must not be None
+    model.id = data.get("id") or ""
+    model.tenant_id = data.get("tenant_id") or ""
+    model.app_id = data.get("app_id") or ""
+    model.workflow_id = data.get("workflow_id") or ""
+    model.triggered_from = data.get("triggered_from") or ""
+    model.node_id = data.get("node_id") or ""
+    model.node_type = data.get("node_type") or ""
+    model.status = data.get("status") or "running"  # Default status if missing
+    model.title = data.get("title") or ""
+    model.created_by_role = data.get("created_by_role") or ""
+    model.created_by = data.get("created_by") or ""
+
+    # Numeric fields with defaults
+    model.index = int(data.get("index", 0))
+    model.elapsed_time = float(data.get("elapsed_time", 0))
+
+    # Optional fields
+    model.workflow_run_id = data.get("workflow_run_id")
+    model.predecessor_node_id = data.get("predecessor_node_id")
+    model.node_execution_id = data.get("node_execution_id")
+    model.inputs = data.get("inputs")
+    model.process_data = data.get("process_data")
+    model.outputs = data.get("outputs")
+    model.error = data.get("error")
+    model.execution_metadata = data.get("execution_metadata")
+
+    # Handle datetime fields
+    created_at = data.get("created_at")
+    if created_at:
+        if isinstance(created_at, str):
+            model.created_at = datetime.fromisoformat(created_at)
+        elif isinstance(created_at, (int, float)):
+            model.created_at = datetime.fromtimestamp(created_at)
+        else:
+            model.created_at = created_at
+    else:
+        # Provide default created_at if missing
+        model.created_at = datetime.now()
+
+    finished_at = data.get("finished_at")
+    if finished_at:
+        if isinstance(finished_at, str):
+            model.finished_at = datetime.fromisoformat(finished_at)
+        elif isinstance(finished_at, (int, float)):
+            model.finished_at = datetime.fromtimestamp(finished_at)
+        else:
+            model.finished_at = finished_at
+
+    return model
+
+
+class LogstoreAPIWorkflowNodeExecutionRepository(DifyAPIWorkflowNodeExecutionRepository):
+    """
+    LogStore implementation of DifyAPIWorkflowNodeExecutionRepository.
+
+    Provides service-layer database operations for WorkflowNodeExecutionModel
+    using LogStore SQL queries with optimized deduplication strategies.
+    """
+
+    def __init__(self, session_maker: sessionmaker | None = None):
+        """
+        Initialize the repository with LogStore client.
+
+        Args:
+            session_maker: SQLAlchemy sessionmaker (unused, for compatibility with factory pattern)
+        """
+        logger.debug("LogstoreAPIWorkflowNodeExecutionRepository.__init__: initializing")
+        self.logstore_client = AliyunLogStore()
+
+    def get_node_last_execution(
+        self,
+        tenant_id: str,
+        app_id: str,
+        workflow_id: str,
+        node_id: str,
+    ) -> WorkflowNodeExecutionModel | None:
+        """
+        Get the most recent execution for a specific node.
+
+        Uses query syntax to get raw logs and selects the one with max log_version.
+        Returns the most recent execution ordered by created_at.
+        """
+        logger.debug(
+            "get_node_last_execution: tenant_id=%s, app_id=%s, workflow_id=%s, node_id=%s",
+            tenant_id,
+            app_id,
+            workflow_id,
+            node_id,
+        )
+        try:
+            # Check if PG protocol is supported
+            if self.logstore_client.supports_pg_protocol:
+                # Use PG protocol with SQL query (get latest version of each record)
+                sql_query = f"""
+                    SELECT * FROM (
+                        SELECT *, 
+                            ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) as rn
+                        FROM "{AliyunLogStore.workflow_node_execution_logstore}"
+                        WHERE tenant_id = '{tenant_id}' 
+                          AND app_id = '{app_id}' 
+                          AND workflow_id = '{workflow_id}' 
+                          AND node_id = '{node_id}'
+                          AND __time__ > 0
+                    ) AS subquery WHERE rn = 1
+                    LIMIT 100
+                """
+                results = self.logstore_client.execute_sql(
+                    sql=sql_query,
+                    logstore=AliyunLogStore.workflow_node_execution_logstore,
+                )
+            else:
+                # Use SDK with LogStore query syntax
+                query = (
+                    f"tenant_id: {tenant_id} and app_id: {app_id} and workflow_id: {workflow_id} and node_id: {node_id}"
+                )
+                from_time = 0
+                to_time = int(time.time())  # now
+
+                results = self.logstore_client.get_logs(
+                    logstore=AliyunLogStore.workflow_node_execution_logstore,
+                    from_time=from_time,
+                    to_time=to_time,
+                    query=query,
+                    line=100,
+                    reverse=False,
+                )
+
+            if not results:
+                return None
+
+            # For SDK mode, group by id and select the one with max log_version for each group
+            # For PG mode, this is already done by the SQL query
+            if not self.logstore_client.supports_pg_protocol:
+                id_to_results: dict[str, list[dict[str, Any]]] = {}
+                for row in results:
+                    row_id = row.get("id")
+                    if row_id:
+                        if row_id not in id_to_results:
+                            id_to_results[row_id] = []
+                        id_to_results[row_id].append(row)
+
+                # For each id, select the row with max log_version
+                deduplicated_results = []
+                for rows in id_to_results.values():
+                    if len(rows) > 1:
+                        max_row = max(rows, key=lambda x: int(x.get("log_version", 0)))
+                    else:
+                        max_row = rows[0]
+                    deduplicated_results.append(max_row)
+            else:
+                # For PG mode, results are already deduplicated by the SQL query
+                deduplicated_results = results
+
+            # Sort by created_at DESC and return the most recent one
+            deduplicated_results.sort(
+                key=lambda x: x.get("created_at", 0) if isinstance(x.get("created_at"), (int, float)) else 0,
+                reverse=True,
+            )
+
+            if deduplicated_results:
+                return _dict_to_workflow_node_execution_model(deduplicated_results[0])
+
+            return None
+
+        except Exception:
+            logger.exception("Failed to get node last execution from LogStore")
+            raise
+
+    def get_executions_by_workflow_run(
+        self,
+        tenant_id: str,
+        app_id: str,
+        workflow_run_id: str,
+    ) -> Sequence[WorkflowNodeExecutionModel]:
+        """
+        Get all node executions for a specific workflow run.
+
+        Uses query syntax to get raw logs and selects the one with max log_version for each node execution.
+        Ordered by index DESC for trace visualization.
+        """
+        logger.debug(
+            "[LogStore] get_executions_by_workflow_run: tenant_id=%s, app_id=%s, workflow_run_id=%s",
+            tenant_id,
+            app_id,
+            workflow_run_id,
+        )
+        try:
+            # Check if PG protocol is supported
+            if self.logstore_client.supports_pg_protocol:
+                # Use PG protocol with SQL query (get latest version of each record)
+                sql_query = f"""
+                    SELECT * FROM (
+                        SELECT *, 
+                            ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) as rn
+                        FROM "{AliyunLogStore.workflow_node_execution_logstore}"
+                        WHERE tenant_id = '{tenant_id}' 
+                          AND app_id = '{app_id}' 
+                          AND workflow_run_id = '{workflow_run_id}'
+                          AND __time__ > 0
+                    ) AS subquery WHERE rn = 1
+                    LIMIT 1000
+                """
+                results = self.logstore_client.execute_sql(
+                    sql=sql_query,
+                    logstore=AliyunLogStore.workflow_node_execution_logstore,
+                )
+            else:
+                # Use SDK with LogStore query syntax
+                query = f"tenant_id: {tenant_id} and app_id: {app_id} and workflow_run_id: {workflow_run_id}"
+                from_time = 0
+                to_time = int(time.time())  # now
+
+                results = self.logstore_client.get_logs(
+                    logstore=AliyunLogStore.workflow_node_execution_logstore,
+                    from_time=from_time,
+                    to_time=to_time,
+                    query=query,
+                    line=1000,  # Get more results for node executions
+                    reverse=False,
+                )
+
+            if not results:
+                return []
+
+            # For SDK mode, group by id and select the one with max log_version for each group
+            # For PG mode, this is already done by the SQL query
+            models = []
+            if not self.logstore_client.supports_pg_protocol:
+                id_to_results: dict[str, list[dict[str, Any]]] = {}
+                for row in results:
+                    row_id = row.get("id")
+                    if row_id:
+                        if row_id not in id_to_results:
+                            id_to_results[row_id] = []
+                        id_to_results[row_id].append(row)
+
+                # For each id, select the row with max log_version
+                for rows in id_to_results.values():
+                    if len(rows) > 1:
+                        max_row = max(rows, key=lambda x: int(x.get("log_version", 0)))
+                    else:
+                        max_row = rows[0]
+
+                    model = _dict_to_workflow_node_execution_model(max_row)
+                    if model and model.id:  # Ensure model is valid
+                        models.append(model)
+            else:
+                # For PG mode, results are already deduplicated by the SQL query
+                for row in results:
+                    model = _dict_to_workflow_node_execution_model(row)
+                    if model and model.id:  # Ensure model is valid
+                        models.append(model)
+
+            # Sort by index DESC for trace visualization
+            models.sort(key=lambda x: x.index, reverse=True)
+
+            return models
+
+        except Exception:
+            logger.exception("Failed to get executions by workflow run from LogStore")
+            raise
+
+    def get_execution_by_id(
+        self,
+        execution_id: str,
+        tenant_id: str | None = None,
+    ) -> WorkflowNodeExecutionModel | None:
+        """
+        Get a workflow node execution by its ID.
+        Uses query syntax to get raw logs and selects the one with max log_version.
+        """
+        logger.debug("get_execution_by_id: execution_id=%s, tenant_id=%s", execution_id, tenant_id)
+        try:
+            # Check if PG protocol is supported
+            if self.logstore_client.supports_pg_protocol:
+                # Use PG protocol with SQL query (get latest version of record)
+                tenant_filter = f"AND tenant_id = '{tenant_id}'" if tenant_id else ""
+                sql_query = f"""
+                    SELECT * FROM (
+                        SELECT *, 
+                            ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) as rn
+                        FROM "{AliyunLogStore.workflow_node_execution_logstore}"
+                        WHERE id = '{execution_id}' {tenant_filter} AND __time__ > 0
+                    ) AS subquery WHERE rn = 1
+                    LIMIT 1
+                """
+                results = self.logstore_client.execute_sql(
+                    sql=sql_query,
+                    logstore=AliyunLogStore.workflow_node_execution_logstore,
+                )
+            else:
+                # Use SDK with LogStore query syntax
+                if tenant_id:
+                    query = f"id: {execution_id} and tenant_id: {tenant_id}"
+                else:
+                    query = f"id: {execution_id}"
+
+                from_time = 0
+                to_time = int(time.time())  # now
+
+                results = self.logstore_client.get_logs(
+                    logstore=AliyunLogStore.workflow_node_execution_logstore,
+                    from_time=from_time,
+                    to_time=to_time,
+                    query=query,
+                    line=100,
+                    reverse=False,
+                )
+
+            if not results:
+                return None
+
+            # For PG mode, result is already the latest version
+            # For SDK mode, if multiple results, select the one with max log_version
+            if self.logstore_client.supports_pg_protocol or len(results) == 1:
+                return _dict_to_workflow_node_execution_model(results[0])
+            else:
+                max_result = max(results, key=lambda x: int(x.get("log_version", 0)))
+                return _dict_to_workflow_node_execution_model(max_result)
+
+        except Exception:
+            logger.exception("Failed to get execution by ID from LogStore: execution_id=%s", execution_id)
+            raise

api/extensions/logstore/repositories/logstore_api_workflow_run_repository.py

@@ -0,0 +1,757 @@
+"""
+LogStore API WorkflowRun Repository Implementation
+
+This module provides the LogStore-based implementation of the APIWorkflowRunRepository
+protocol. It handles service-layer WorkflowRun database operations using Aliyun SLS LogStore
+with optimized queries for statistics and pagination.
+
+Key Features:
+- LogStore SQL queries for aggregation and statistics
+- Optimized deduplication using finished_at IS NOT NULL filter
+- Window functions only when necessary (running status queries)
+- Multi-tenant data isolation and security
+"""
+
+import logging
+import os
+import time
+from collections.abc import Sequence
+from datetime import datetime
+from typing import Any, cast
+
+from sqlalchemy.orm import sessionmaker
+
+from extensions.logstore.aliyun_logstore import AliyunLogStore
+from libs.infinite_scroll_pagination import InfiniteScrollPagination
+from models.enums import WorkflowRunTriggeredFrom
+from models.workflow import WorkflowRun
+from repositories.api_workflow_run_repository import APIWorkflowRunRepository
+from repositories.types import (
+    AverageInteractionStats,
+    DailyRunsStats,
+    DailyTerminalsStats,
+    DailyTokenCostStats,
+)
+
+logger = logging.getLogger(__name__)
+
+
+def _dict_to_workflow_run(data: dict[str, Any]) -> WorkflowRun:
+    """
+    Convert LogStore result dictionary to WorkflowRun instance.
+
+    Args:
+        data: Dictionary from LogStore query result
+
+    Returns:
+        WorkflowRun instance
+    """
+    logger.debug("_dict_to_workflow_run: data keys=%s", list(data.keys())[:5])
+    # Create model instance without session
+    model = WorkflowRun()
+
+    # Map all required fields with validation
+    # Critical fields - must not be None
+    model.id = data.get("id") or ""
+    model.tenant_id = data.get("tenant_id") or ""
+    model.app_id = data.get("app_id") or ""
+    model.workflow_id = data.get("workflow_id") or ""
+    model.type = data.get("type") or ""
+    model.triggered_from = data.get("triggered_from") or ""
+    model.version = data.get("version") or ""
+    model.status = data.get("status") or "running"  # Default status if missing
+    model.created_by_role = data.get("created_by_role") or ""
+    model.created_by = data.get("created_by") or ""
+
+    # Numeric fields with defaults
+    model.total_tokens = int(data.get("total_tokens", 0))
+    model.total_steps = int(data.get("total_steps", 0))
+    model.exceptions_count = int(data.get("exceptions_count", 0))
+
+    # Optional fields
+    model.graph = data.get("graph")
+    model.inputs = data.get("inputs")
+    model.outputs = data.get("outputs")
+    model.error = data.get("error_message") or data.get("error")
+
+    # Handle datetime fields
+    started_at = data.get("started_at") or data.get("created_at")
+    if started_at:
+        if isinstance(started_at, str):
+            model.created_at = datetime.fromisoformat(started_at)
+        elif isinstance(started_at, (int, float)):
+            model.created_at = datetime.fromtimestamp(started_at)
+        else:
+            model.created_at = started_at
+    else:
+        # Provide default created_at if missing
+        model.created_at = datetime.now()
+
+    finished_at = data.get("finished_at")
+    if finished_at:
+        if isinstance(finished_at, str):
+            model.finished_at = datetime.fromisoformat(finished_at)
+        elif isinstance(finished_at, (int, float)):
+            model.finished_at = datetime.fromtimestamp(finished_at)
+        else:
+            model.finished_at = finished_at
+
+    # Compute elapsed_time from started_at and finished_at
+    # LogStore doesn't store elapsed_time, it's computed in WorkflowExecution domain entity
+    if model.finished_at and model.created_at:
+        model.elapsed_time = (model.finished_at - model.created_at).total_seconds()
+    else:
+        model.elapsed_time = float(data.get("elapsed_time", 0))
+
+    return model
+
+
+class LogstoreAPIWorkflowRunRepository(APIWorkflowRunRepository):
+    """
+    LogStore implementation of APIWorkflowRunRepository.
+
+    Provides service-layer WorkflowRun database operations using LogStore SQL
+    with optimized query strategies:
+    - Use finished_at IS NOT NULL for deduplication (10-100x faster)
+    - Use window functions only when running status is required
+    - Proper time range filtering for LogStore queries
+    """
+
+    def __init__(self, session_maker: sessionmaker | None = None):
+        """
+        Initialize the repository with LogStore client.
+
+        Args:
+            session_maker: SQLAlchemy sessionmaker (unused, for compatibility with factory pattern)
+        """
+        logger.debug("LogstoreAPIWorkflowRunRepository.__init__: initializing")
+        self.logstore_client = AliyunLogStore()
+
+        # Control flag for dual-read (fallback to PostgreSQL when LogStore returns no results)
+        # Set to True to enable fallback for safe migration from PostgreSQL to LogStore
+        # Set to False for new deployments without legacy data in PostgreSQL
+        self._enable_dual_read = os.environ.get("LOGSTORE_DUAL_READ_ENABLED", "true").lower() == "true"
+
+    def get_paginated_workflow_runs(
+        self,
+        tenant_id: str,
+        app_id: str,
+        triggered_from: WorkflowRunTriggeredFrom | Sequence[WorkflowRunTriggeredFrom],
+        limit: int = 20,
+        last_id: str | None = None,
+        status: str | None = None,
+    ) -> InfiniteScrollPagination:
+        """
+        Get paginated workflow runs with filtering.
+
+        Uses window function for deduplication to support both running and finished states.
+
+        Args:
+            tenant_id: Tenant identifier for multi-tenant isolation
+            app_id: Application identifier
+            triggered_from: Filter by trigger source(s)
+            limit: Maximum number of records to return (default: 20)
+            last_id: Cursor for pagination - ID of the last record from previous page
+            status: Optional filter by status
+
+        Returns:
+            InfiniteScrollPagination object
+        """
+        logger.debug(
+            "get_paginated_workflow_runs: tenant_id=%s, app_id=%s, limit=%d, status=%s",
+            tenant_id,
+            app_id,
+            limit,
+            status,
+        )
+        # Convert triggered_from to list if needed
+        if isinstance(triggered_from, WorkflowRunTriggeredFrom):
+            triggered_from_list = [triggered_from]
+        else:
+            triggered_from_list = list(triggered_from)
+
+        # Build triggered_from filter
+        triggered_from_filter = " OR ".join([f"triggered_from='{tf.value}'" for tf in triggered_from_list])
+
+        # Build status filter
+        status_filter = f"AND status='{status}'" if status else ""
+
+        # Build last_id filter for pagination
+        # Note: This is simplified. In production, you'd need to track created_at from last record
+        last_id_filter = ""
+        if last_id:
+            # TODO: Implement proper cursor-based pagination with created_at
+            logger.warning("last_id pagination not fully implemented for LogStore")
+
+        # Use window function to get latest log_version of each workflow run
+        sql = f"""
+            SELECT * FROM (
+                SELECT *, ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) AS rn
+                FROM {AliyunLogStore.workflow_execution_logstore}
+                WHERE tenant_id='{tenant_id}'
+                  AND app_id='{app_id}'
+                  AND ({triggered_from_filter})
+                  {status_filter}
+                  {last_id_filter}
+            ) t
+            WHERE rn = 1
+            ORDER BY created_at DESC
+            LIMIT {limit + 1}
+        """
+
+        try:
+            results = self.logstore_client.execute_sql(
+                sql=sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore, from_time=None, to_time=None
+            )
+
+            # Check if there are more records
+            has_more = len(results) > limit
+            if has_more:
+                results = results[:limit]
+
+            # Convert results to WorkflowRun models
+            workflow_runs = [_dict_to_workflow_run(row) for row in results]
+            return InfiniteScrollPagination(data=workflow_runs, limit=limit, has_more=has_more)
+
+        except Exception:
+            logger.exception("Failed to get paginated workflow runs from LogStore")
+            raise
+
+    def get_workflow_run_by_id(
+        self,
+        tenant_id: str,
+        app_id: str,
+        run_id: str,
+    ) -> WorkflowRun | None:
+        """
+        Get a specific workflow run by ID with tenant and app isolation.
+
+        Uses query syntax to get raw logs and selects the one with max log_version in code.
+        Falls back to PostgreSQL if not found in LogStore (for data consistency during migration).
+        """
+        logger.debug("get_workflow_run_by_id: tenant_id=%s, app_id=%s, run_id=%s", tenant_id, app_id, run_id)
+
+        try:
+            # Check if PG protocol is supported
+            if self.logstore_client.supports_pg_protocol:
+                # Use PG protocol with SQL query (get latest version of record)
+                sql_query = f"""
+                    SELECT * FROM (
+                        SELECT *, 
+                            ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) as rn
+                        FROM "{AliyunLogStore.workflow_execution_logstore}"
+                        WHERE id = '{run_id}' AND tenant_id = '{tenant_id}' AND app_id = '{app_id}' AND __time__ > 0
+                    ) AS subquery WHERE rn = 1
+                    LIMIT 100
+                """
+                results = self.logstore_client.execute_sql(
+                    sql=sql_query,
+                    logstore=AliyunLogStore.workflow_execution_logstore,
+                )
+            else:
+                # Use SDK with LogStore query syntax
+                query = f"id: {run_id} and tenant_id: {tenant_id} and app_id: {app_id}"
+                from_time = 0
+                to_time = int(time.time())  # now
+
+                results = self.logstore_client.get_logs(
+                    logstore=AliyunLogStore.workflow_execution_logstore,
+                    from_time=from_time,
+                    to_time=to_time,
+                    query=query,
+                    line=100,
+                    reverse=False,
+                )
+
+            if not results:
+                # Fallback to PostgreSQL for records created before LogStore migration
+                if self._enable_dual_read:
+                    logger.debug(
+                        "WorkflowRun not found in LogStore, falling back to PostgreSQL: "
+                        "run_id=%s, tenant_id=%s, app_id=%s",
+                        run_id,
+                        tenant_id,
+                        app_id,
+                    )
+                    return self._fallback_get_workflow_run_by_id_with_tenant(run_id, tenant_id, app_id)
+                return None
+
+            # For PG mode, results are already deduplicated by the SQL query
+            # For SDK mode, if multiple results, select the one with max log_version
+            if self.logstore_client.supports_pg_protocol or len(results) == 1:
+                return _dict_to_workflow_run(results[0])
+            else:
+                max_result = max(results, key=lambda x: int(x.get("log_version", 0)))
+                return _dict_to_workflow_run(max_result)
+
+        except Exception:
+            logger.exception("Failed to get workflow run by ID from LogStore: run_id=%s", run_id)
+            # Try PostgreSQL fallback on any error (only if dual-read is enabled)
+            if self._enable_dual_read:
+                try:
+                    return self._fallback_get_workflow_run_by_id_with_tenant(run_id, tenant_id, app_id)
+                except Exception:
+                    logger.exception(
+                        "PostgreSQL fallback also failed: run_id=%s, tenant_id=%s, app_id=%s", run_id, tenant_id, app_id
+                    )
+            raise
+
+    def _fallback_get_workflow_run_by_id_with_tenant(
+        self, run_id: str, tenant_id: str, app_id: str
+    ) -> WorkflowRun | None:
+        """Fallback to PostgreSQL query for records not in LogStore (with tenant isolation)."""
+        from sqlalchemy import select
+        from sqlalchemy.orm import Session
+
+        from extensions.ext_database import db
+
+        with Session(db.engine) as session:
+            stmt = select(WorkflowRun).where(
+                WorkflowRun.id == run_id, WorkflowRun.tenant_id == tenant_id, WorkflowRun.app_id == app_id
+            )
+            return session.scalar(stmt)
+
+    def get_workflow_run_by_id_without_tenant(
+        self,
+        run_id: str,
+    ) -> WorkflowRun | None:
+        """
+        Get a specific workflow run by ID without tenant/app context.
+        Uses query syntax to get raw logs and selects the one with max log_version.
+        Falls back to PostgreSQL if not found in LogStore (controlled by LOGSTORE_DUAL_READ_ENABLED).
+        """
+        logger.debug("get_workflow_run_by_id_without_tenant: run_id=%s", run_id)
+
+        try:
+            # Check if PG protocol is supported
+            if self.logstore_client.supports_pg_protocol:
+                # Use PG protocol with SQL query (get latest version of record)
+                sql_query = f"""
+                    SELECT * FROM (
+                        SELECT *, 
+                            ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) as rn
+                        FROM "{AliyunLogStore.workflow_execution_logstore}"
+                        WHERE id = '{run_id}' AND __time__ > 0
+                    ) AS subquery WHERE rn = 1
+                    LIMIT 100
+                """
+                results = self.logstore_client.execute_sql(
+                    sql=sql_query,
+                    logstore=AliyunLogStore.workflow_execution_logstore,
+                )
+            else:
+                # Use SDK with LogStore query syntax
+                query = f"id: {run_id}"
+                from_time = 0
+                to_time = int(time.time())  # now
+
+                results = self.logstore_client.get_logs(
+                    logstore=AliyunLogStore.workflow_execution_logstore,
+                    from_time=from_time,
+                    to_time=to_time,
+                    query=query,
+                    line=100,
+                    reverse=False,
+                )
+
+            if not results:
+                # Fallback to PostgreSQL for records created before LogStore migration
+                if self._enable_dual_read:
+                    logger.debug("WorkflowRun not found in LogStore, falling back to PostgreSQL: run_id=%s", run_id)
+                    return self._fallback_get_workflow_run_by_id(run_id)
+                return None
+
+            # For PG mode, results are already deduplicated by the SQL query
+            # For SDK mode, if multiple results, select the one with max log_version
+            if self.logstore_client.supports_pg_protocol or len(results) == 1:
+                return _dict_to_workflow_run(results[0])
+            else:
+                max_result = max(results, key=lambda x: int(x.get("log_version", 0)))
+                return _dict_to_workflow_run(max_result)
+
+        except Exception:
+            logger.exception("Failed to get workflow run without tenant: run_id=%s", run_id)
+            # Try PostgreSQL fallback on any error (only if dual-read is enabled)
+            if self._enable_dual_read:
+                try:
+                    return self._fallback_get_workflow_run_by_id(run_id)
+                except Exception:
+                    logger.exception("PostgreSQL fallback also failed: run_id=%s", run_id)
+            raise
+
+    def _fallback_get_workflow_run_by_id(self, run_id: str) -> WorkflowRun | None:
+        """Fallback to PostgreSQL query for records not in LogStore."""
+        from sqlalchemy import select
+        from sqlalchemy.orm import Session
+
+        from extensions.ext_database import db
+
+        with Session(db.engine) as session:
+            stmt = select(WorkflowRun).where(WorkflowRun.id == run_id)
+            return session.scalar(stmt)
+
+    def get_workflow_runs_count(
+        self,
+        tenant_id: str,
+        app_id: str,
+        triggered_from: str,
+        status: str | None = None,
+        time_range: str | None = None,
+    ) -> dict[str, int]:
+        """
+        Get workflow runs count statistics grouped by status.
+
+        Optimization: Use finished_at IS NOT NULL for completed runs (10-50x faster)
+        """
+        logger.debug(
+            "get_workflow_runs_count: tenant_id=%s, app_id=%s, triggered_from=%s, status=%s",
+            tenant_id,
+            app_id,
+            triggered_from,
+            status,
+        )
+        # Build time range filter
+        time_filter = ""
+        if time_range:
+            # TODO: Parse time_range and convert to from_time/to_time
+            logger.warning("time_range filter not implemented")
+
+        # If status is provided, simple count
+        if status:
+            if status == "running":
+                # Running status requires window function
+                sql = f"""
+                    SELECT COUNT(*) as count
+                    FROM (
+                        SELECT *, ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) AS rn
+                        FROM {AliyunLogStore.workflow_execution_logstore}
+                        WHERE tenant_id='{tenant_id}'
+                          AND app_id='{app_id}'
+                          AND triggered_from='{triggered_from}'
+                          AND status='running'
+                          {time_filter}
+                    ) t
+                    WHERE rn = 1
+                """
+            else:
+                # Finished status uses optimized filter
+                sql = f"""
+                    SELECT COUNT(DISTINCT id) as count
+                    FROM {AliyunLogStore.workflow_execution_logstore}
+                    WHERE tenant_id='{tenant_id}'
+                      AND app_id='{app_id}'
+                      AND triggered_from='{triggered_from}'
+                      AND status='{status}'
+                      AND finished_at IS NOT NULL
+                      {time_filter}
+                """
+
+            try:
+                results = self.logstore_client.execute_sql(
+                    sql=sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore
+                )
+                count = results[0]["count"] if results and len(results) > 0 else 0
+
+                return {
+                    "total": count,
+                    "running": count if status == "running" else 0,
+                    "succeeded": count if status == "succeeded" else 0,
+                    "failed": count if status == "failed" else 0,
+                    "stopped": count if status == "stopped" else 0,
+                    "partial-succeeded": count if status == "partial-succeeded" else 0,
+                }
+            except Exception:
+                logger.exception("Failed to get workflow runs count")
+                raise
+
+        # No status filter - get counts grouped by status
+        # Use optimized query for finished runs, separate query for running
+        try:
+            # Count finished runs grouped by status
+            finished_sql = f"""
+                SELECT status, COUNT(DISTINCT id) as count
+                FROM {AliyunLogStore.workflow_execution_logstore}
+                WHERE tenant_id='{tenant_id}'
+                  AND app_id='{app_id}'
+                  AND triggered_from='{triggered_from}'
+                  AND finished_at IS NOT NULL
+                  {time_filter}
+                GROUP BY status
+            """
+
+            # Count running runs
+            running_sql = f"""
+                SELECT COUNT(*) as count
+                FROM (
+                    SELECT *, ROW_NUMBER() OVER (PARTITION BY id ORDER BY log_version DESC) AS rn
+                    FROM {AliyunLogStore.workflow_execution_logstore}
+                    WHERE tenant_id='{tenant_id}'
+                      AND app_id='{app_id}'
+                      AND triggered_from='{triggered_from}'
+                      AND status='running'
+                      {time_filter}
+                ) t
+                WHERE rn = 1
+            """
+
+            finished_results = self.logstore_client.execute_sql(
+                sql=finished_sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore
+            )
+            running_results = self.logstore_client.execute_sql(
+                sql=running_sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore
+            )
+
+            # Build response
+            status_counts = {
+                "running": 0,
+                "succeeded": 0,
+                "failed": 0,
+                "stopped": 0,
+                "partial-succeeded": 0,
+            }
+
+            total = 0
+            for result in finished_results:
+                status_val = result.get("status")
+                count = result.get("count", 0)
+                if status_val in status_counts:
+                    status_counts[status_val] = count
+                    total += count
+
+            # Add running count
+            running_count = running_results[0]["count"] if running_results and len(running_results) > 0 else 0
+            status_counts["running"] = running_count
+            total += running_count
+
+            return {"total": total} | status_counts
+
+        except Exception:
+            logger.exception("Failed to get workflow runs count")
+            raise
+
+    def get_daily_runs_statistics(
+        self,
+        tenant_id: str,
+        app_id: str,
+        triggered_from: str,
+        start_date: datetime | None = None,
+        end_date: datetime | None = None,
+        timezone: str = "UTC",
+    ) -> list[DailyRunsStats]:
+        """
+        Get daily runs statistics using optimized query.
+
+        Optimization: Use finished_at IS NOT NULL + COUNT(DISTINCT id) (20-100x faster)
+        """
+        logger.debug(
+            "get_daily_runs_statistics: tenant_id=%s, app_id=%s, triggered_from=%s", tenant_id, app_id, triggered_from
+        )
+        # Build time range filter
+        time_filter = ""
+        if start_date:
+            time_filter += f" AND __time__ >= to_unixtime(from_iso8601_timestamp('{start_date.isoformat()}'))"
+        if end_date:
+            time_filter += f" AND __time__ < to_unixtime(from_iso8601_timestamp('{end_date.isoformat()}'))"
+
+        # Optimized query: Use finished_at filter to avoid window function
+        sql = f"""
+            SELECT DATE(from_unixtime(__time__)) as date, COUNT(DISTINCT id) as runs
+            FROM {AliyunLogStore.workflow_execution_logstore}
+            WHERE tenant_id='{tenant_id}'
+              AND app_id='{app_id}'
+              AND triggered_from='{triggered_from}'
+              AND finished_at IS NOT NULL
+              {time_filter}
+            GROUP BY date
+            ORDER BY date
+        """
+
+        try:
+            results = self.logstore_client.execute_sql(
+                sql=sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore
+            )
+
+            response_data = []
+            for row in results:
+                response_data.append({"date": str(row.get("date", "")), "runs": row.get("runs", 0)})
+
+            return cast(list[DailyRunsStats], response_data)
+
+        except Exception:
+            logger.exception("Failed to get daily runs statistics")
+            raise
+
+    def get_daily_terminals_statistics(
+        self,
+        tenant_id: str,
+        app_id: str,
+        triggered_from: str,
+        start_date: datetime | None = None,
+        end_date: datetime | None = None,
+        timezone: str = "UTC",
+    ) -> list[DailyTerminalsStats]:
+        """
+        Get daily terminals statistics using optimized query.
+
+        Optimization: Use finished_at IS NOT NULL + COUNT(DISTINCT created_by) (20-100x faster)
+        """
+        logger.debug(
+            "get_daily_terminals_statistics: tenant_id=%s, app_id=%s, triggered_from=%s",
+            tenant_id,
+            app_id,
+            triggered_from,
+        )
+        # Build time range filter
+        time_filter = ""
+        if start_date:
+            time_filter += f" AND __time__ >= to_unixtime(from_iso8601_timestamp('{start_date.isoformat()}'))"
+        if end_date:
+            time_filter += f" AND __time__ < to_unixtime(from_iso8601_timestamp('{end_date.isoformat()}'))"
+
+        sql = f"""
+            SELECT DATE(from_unixtime(__time__)) as date, COUNT(DISTINCT created_by) as terminal_count
+            FROM {AliyunLogStore.workflow_execution_logstore}
+            WHERE tenant_id='{tenant_id}'
+              AND app_id='{app_id}'
+              AND triggered_from='{triggered_from}'
+              AND finished_at IS NOT NULL
+              {time_filter}
+            GROUP BY date
+            ORDER BY date
+        """
+
+        try:
+            results = self.logstore_client.execute_sql(
+                sql=sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore
+            )
+
+            response_data = []
+            for row in results:
+                response_data.append({"date": str(row.get("date", "")), "terminal_count": row.get("terminal_count", 0)})
+
+            return cast(list[DailyTerminalsStats], response_data)
+
+        except Exception:
+            logger.exception("Failed to get daily terminals statistics")
+            raise
+
+    def get_daily_token_cost_statistics(
+        self,
+        tenant_id: str,
+        app_id: str,
+        triggered_from: str,
+        start_date: datetime | None = None,
+        end_date: datetime | None = None,
+        timezone: str = "UTC",
+    ) -> list[DailyTokenCostStats]:
+        """
+        Get daily token cost statistics using optimized query.
+
+        Optimization: Use finished_at IS NOT NULL + SUM(total_tokens) (20-100x faster)
+        """
+        logger.debug(
+            "get_daily_token_cost_statistics: tenant_id=%s, app_id=%s, triggered_from=%s",
+            tenant_id,
+            app_id,
+            triggered_from,
+        )
+        # Build time range filter
+        time_filter = ""
+        if start_date:
+            time_filter += f" AND __time__ >= to_unixtime(from_iso8601_timestamp('{start_date.isoformat()}'))"
+        if end_date:
+            time_filter += f" AND __time__ < to_unixtime(from_iso8601_timestamp('{end_date.isoformat()}'))"
+
+        sql = f"""
+            SELECT DATE(from_unixtime(__time__)) as date, SUM(total_tokens) as token_count
+            FROM {AliyunLogStore.workflow_execution_logstore}
+            WHERE tenant_id='{tenant_id}'
+              AND app_id='{app_id}'
+              AND triggered_from='{triggered_from}'
+              AND finished_at IS NOT NULL
+              {time_filter}
+            GROUP BY date
+            ORDER BY date
+        """
+
+        try:
+            results = self.logstore_client.execute_sql(
+                sql=sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore
+            )
+
+            response_data = []
+            for row in results:
+                response_data.append({"date": str(row.get("date", "")), "token_count": row.get("token_count", 0)})
+
+            return cast(list[DailyTokenCostStats], response_data)
+
+        except Exception:
+            logger.exception("Failed to get daily token cost statistics")
+            raise
+
+    def get_average_app_interaction_statistics(
+        self,
+        tenant_id: str,
+        app_id: str,
+        triggered_from: str,
+        start_date: datetime | None = None,
+        end_date: datetime | None = None,
+        timezone: str = "UTC",
+    ) -> list[AverageInteractionStats]:
+        """
+        Get average app interaction statistics using optimized query.
+
+        Optimization: Use finished_at IS NOT NULL + AVG (20-100x faster)
+        """
+        logger.debug(
+            "get_average_app_interaction_statistics: tenant_id=%s, app_id=%s, triggered_from=%s",
+            tenant_id,
+            app_id,
+            triggered_from,
+        )
+        # Build time range filter
+        time_filter = ""
+        if start_date:
+            time_filter += f" AND __time__ >= to_unixtime(from_iso8601_timestamp('{start_date.isoformat()}'))"
+        if end_date:
+            time_filter += f" AND __time__ < to_unixtime(from_iso8601_timestamp('{end_date.isoformat()}'))"
+
+        sql = f"""
+            SELECT
+                AVG(sub.interactions) AS interactions,
+                sub.date
+            FROM (
+                SELECT
+                    DATE(from_unixtime(__time__)) AS date,
+                    created_by,
+                    COUNT(DISTINCT id) AS interactions
+                FROM {AliyunLogStore.workflow_execution_logstore}
+                WHERE tenant_id='{tenant_id}'
+                  AND app_id='{app_id}'
+                  AND triggered_from='{triggered_from}'
+                  AND finished_at IS NOT NULL
+                  {time_filter}
+                GROUP BY date, created_by
+            ) sub
+            GROUP BY sub.date
+        """
+
+        try:
+            results = self.logstore_client.execute_sql(
+                sql=sql, query="*", logstore=AliyunLogStore.workflow_execution_logstore
+            )
+
+            response_data = []
+            for row in results:
+                response_data.append(
+                    {
+                        "date": str(row.get("date", "")),
+                        "interactions": float(row.get("interactions", 0)),
+                    }
+                )
+
+            return cast(list[AverageInteractionStats], response_data)
+
+        except Exception:
+            logger.exception("Failed to get average app interaction statistics")
+            raise

api/extensions/logstore/repositories/logstore_workflow_execution_repository.py

@@ -0,0 +1,164 @@
+import json
+import logging
+import os
+import time
+from typing import Union
+
+from sqlalchemy.engine import Engine
+from sqlalchemy.orm import sessionmaker
+
+from core.repositories.sqlalchemy_workflow_execution_repository import SQLAlchemyWorkflowExecutionRepository
+from core.workflow.entities import WorkflowExecution
+from core.workflow.repositories.workflow_execution_repository import WorkflowExecutionRepository
+from extensions.logstore.aliyun_logstore import AliyunLogStore
+from libs.helper import extract_tenant_id
+from models import (
+    Account,
+    CreatorUserRole,
+    EndUser,
+)
+from models.enums import WorkflowRunTriggeredFrom
+
+logger = logging.getLogger(__name__)
+
+
+class LogstoreWorkflowExecutionRepository(WorkflowExecutionRepository):
+    def __init__(
+        self,
+        session_factory: sessionmaker | Engine,
+        user: Union[Account, EndUser],
+        app_id: str | None,
+        triggered_from: WorkflowRunTriggeredFrom | None,
+    ):
+        """
+        Initialize the repository with a SQLAlchemy sessionmaker or engine and context information.
+
+        Args:
+            session_factory: SQLAlchemy sessionmaker or engine for creating sessions
+            user: Account or EndUser object containing tenant_id, user ID, and role information
+            app_id: App ID for filtering by application (can be None)
+            triggered_from: Source of the execution trigger (DEBUGGING or APP_RUN)
+        """
+        logger.debug(
+            "LogstoreWorkflowExecutionRepository.__init__: app_id=%s, triggered_from=%s", app_id, triggered_from
+        )
+        # Initialize LogStore client
+        # Note: Project/logstore/index initialization is done at app startup via ext_logstore
+        self.logstore_client = AliyunLogStore()
+
+        # Extract tenant_id from user
+        tenant_id = extract_tenant_id(user)
+        if not tenant_id:
+            raise ValueError("User must have a tenant_id or current_tenant_id")
+        self._tenant_id = tenant_id
+
+        # Store app context
+        self._app_id = app_id
+
+        # Extract user context
+        self._triggered_from = triggered_from
+        self._creator_user_id = user.id
+
+        # Determine user role based on user type
+        self._creator_user_role = CreatorUserRole.ACCOUNT if isinstance(user, Account) else CreatorUserRole.END_USER
+
+        # Initialize SQL repository for dual-write support
+        self.sql_repository = SQLAlchemyWorkflowExecutionRepository(session_factory, user, app_id, triggered_from)
+
+        # Control flag for dual-write (write to both LogStore and SQL database)
+        # Set to True to enable dual-write for safe migration, False to use LogStore only
+        self._enable_dual_write = os.environ.get("LOGSTORE_DUAL_WRITE_ENABLED", "true").lower() == "true"
+
+    def _to_logstore_model(self, domain_model: WorkflowExecution) -> list[tuple[str, str]]:
+        """
+        Convert a domain model to a logstore model (List[Tuple[str, str]]).
+
+        Args:
+            domain_model: The domain model to convert
+
+        Returns:
+            The logstore model as a list of key-value tuples
+        """
+        logger.debug(
+            "_to_logstore_model: id=%s, workflow_id=%s, status=%s",
+            domain_model.id_,
+            domain_model.workflow_id,
+            domain_model.status.value,
+        )
+        # Use values from constructor if provided
+        if not self._triggered_from:
+            raise ValueError("triggered_from is required in repository constructor")
+        if not self._creator_user_id:
+            raise ValueError("created_by is required in repository constructor")
+        if not self._creator_user_role:
+            raise ValueError("created_by_role is required in repository constructor")
+
+        # Generate log_version as nanosecond timestamp for record versioning
+        log_version = str(time.time_ns())
+
+        logstore_model = [
+            ("id", domain_model.id_),
+            ("log_version", log_version),  # Add log_version field for append-only writes
+            ("tenant_id", self._tenant_id),
+            ("app_id", self._app_id or ""),
+            ("workflow_id", domain_model.workflow_id),
+            (
+                "triggered_from",
+                self._triggered_from.value if hasattr(self._triggered_from, "value") else str(self._triggered_from),
+            ),
+            ("type", domain_model.workflow_type.value),
+            ("version", domain_model.workflow_version),
+            ("graph", json.dumps(domain_model.graph, ensure_ascii=False) if domain_model.graph else "{}"),
+            ("inputs", json.dumps(domain_model.inputs, ensure_ascii=False) if domain_model.inputs else "{}"),
+            ("outputs", json.dumps(domain_model.outputs, ensure_ascii=False) if domain_model.outputs else "{}"),
+            ("status", domain_model.status.value),
+            ("error_message", domain_model.error_message or ""),
+            ("total_tokens", str(domain_model.total_tokens)),
+            ("total_steps", str(domain_model.total_steps)),
+            ("exceptions_count", str(domain_model.exceptions_count)),
+            (
+                "created_by_role",
+                self._creator_user_role.value
+                if hasattr(self._creator_user_role, "value")
+                else str(self._creator_user_role),
+            ),
+            ("created_by", self._creator_user_id),
+            ("started_at", domain_model.started_at.isoformat() if domain_model.started_at else ""),
+            ("finished_at", domain_model.finished_at.isoformat() if domain_model.finished_at else ""),
+        ]
+
+        return logstore_model
+
+    def save(self, execution: WorkflowExecution) -> None:
+        """
+        Save or update a WorkflowExecution domain entity to the logstore.
+
+        This method serves as a domain-to-logstore adapter that:
+        1. Converts the domain entity to its logstore representation
+        2. Persists the logstore model using Aliyun SLS
+        3. Maintains proper multi-tenancy by including tenant context during conversion
+        4. Optionally writes to SQL database for dual-write support (controlled by LOGSTORE_DUAL_WRITE_ENABLED)
+
+        Args:
+            execution: The WorkflowExecution domain entity to persist
+        """
+        logger.debug(
+            "save: id=%s, workflow_id=%s, status=%s", execution.id_, execution.workflow_id, execution.status.value
+        )
+        try:
+            logstore_model = self._to_logstore_model(execution)
+            self.logstore_client.put_log(AliyunLogStore.workflow_execution_logstore, logstore_model)
+
+            logger.debug("Saved workflow execution to logstore: id=%s", execution.id_)
+        except Exception:
+            logger.exception("Failed to save workflow execution to logstore: id=%s", execution.id_)
+            raise
+
+        # Dual-write to SQL database if enabled (for safe migration)
+        if self._enable_dual_write:
+            try:
+                self.sql_repository.save(execution)
+                logger.debug("Dual-write: saved workflow execution to SQL database: id=%s", execution.id_)
+            except Exception:
+                logger.exception("Failed to dual-write workflow execution to SQL database: id=%s", execution.id_)
+                # Don't raise - LogStore write succeeded, SQL is just a backup

api/extensions/logstore/repositories/logstore_workflow_node_execution_repository.py

@@ -0,0 +1,366 @@
+"""
+LogStore implementation of the WorkflowNodeExecutionRepository.
+
+This module provides a LogStore-based repository for WorkflowNodeExecution entities,
+using Aliyun SLS LogStore with append-only writes and version control.
+"""
+
+import json
+import logging
+import os
+import time
+from collections.abc import Sequence
+from datetime import datetime
+from typing import Any, Union
+
+from sqlalchemy.engine import Engine
+from sqlalchemy.orm import sessionmaker
+
+from core.model_runtime.utils.encoders import jsonable_encoder
+from core.repositories import SQLAlchemyWorkflowNodeExecutionRepository
+from core.workflow.entities import WorkflowNodeExecution
+from core.workflow.entities.workflow_node_execution import WorkflowNodeExecutionMetadataKey, WorkflowNodeExecutionStatus
+from core.workflow.enums import NodeType
+from core.workflow.repositories.workflow_node_execution_repository import OrderConfig, WorkflowNodeExecutionRepository
+from core.workflow.workflow_type_encoder import WorkflowRuntimeTypeConverter
+from extensions.logstore.aliyun_logstore import AliyunLogStore
+from libs.helper import extract_tenant_id
+from models import (
+    Account,
+    CreatorUserRole,
+    EndUser,
+    WorkflowNodeExecutionTriggeredFrom,
+)
+
+logger = logging.getLogger(__name__)
+
+
+def _dict_to_workflow_node_execution(data: dict[str, Any]) -> WorkflowNodeExecution:
+    """
+    Convert LogStore result dictionary to WorkflowNodeExecution domain model.
+
+    Args:
+        data: Dictionary from LogStore query result
+
+    Returns:
+        WorkflowNodeExecution domain model instance
+    """
+    logger.debug("_dict_to_workflow_node_execution: data keys=%s", list(data.keys())[:5])
+    # Parse JSON fields
+    inputs = json.loads(data.get("inputs", "{}"))
+    process_data = json.loads(data.get("process_data", "{}"))
+    outputs = json.loads(data.get("outputs", "{}"))
+    metadata = json.loads(data.get("execution_metadata", "{}"))
+
+    # Convert metadata to domain enum keys
+    domain_metadata = {}
+    for k, v in metadata.items():
+        try:
+            domain_metadata[WorkflowNodeExecutionMetadataKey(k)] = v
+        except ValueError:
+            # Skip invalid metadata keys
+            continue
+
+    # Convert status to domain enum
+    status = WorkflowNodeExecutionStatus(data.get("status", "running"))
+
+    # Parse datetime fields
+    created_at = datetime.fromisoformat(data.get("created_at", "")) if data.get("created_at") else datetime.now()
+    finished_at = datetime.fromisoformat(data.get("finished_at", "")) if data.get("finished_at") else None
+
+    return WorkflowNodeExecution(
+        id=data.get("id", ""),
+        node_execution_id=data.get("node_execution_id"),
+        workflow_id=data.get("workflow_id", ""),
+        workflow_execution_id=data.get("workflow_run_id"),
+        index=int(data.get("index", 0)),
+        predecessor_node_id=data.get("predecessor_node_id"),
+        node_id=data.get("node_id", ""),
+        node_type=NodeType(data.get("node_type", "start")),
+        title=data.get("title", ""),
+        inputs=inputs,
+        process_data=process_data,
+        outputs=outputs,
+        status=status,
+        error=data.get("error"),
+        elapsed_time=float(data.get("elapsed_time", 0.0)),
+        metadata=domain_metadata,
+        created_at=created_at,
+        finished_at=finished_at,
+    )
+
+
+class LogstoreWorkflowNodeExecutionRepository(WorkflowNodeExecutionRepository):
+    """
+    LogStore implementation of the WorkflowNodeExecutionRepository interface.
+
+    This implementation uses Aliyun SLS LogStore with an append-only write strategy:
+    - Each save() operation appends a new record with a version timestamp
+    - Updates are simulated by writing new records with higher version numbers
+    - Queries retrieve the latest version using finished_at IS NOT NULL filter
+    - Multi-tenancy is maintained through tenant_id filtering
+
+    Version Strategy:
+        version = time.time_ns()  # Nanosecond timestamp for unique ordering
+    """
+
+    def __init__(
+        self,
+        session_factory: sessionmaker | Engine,
+        user: Union[Account, EndUser],
+        app_id: str | None,
+        triggered_from: WorkflowNodeExecutionTriggeredFrom | None,
+    ):
+        """
+        Initialize the repository with a SQLAlchemy sessionmaker or engine and context information.
+
+        Args:
+            session_factory: SQLAlchemy sessionmaker or engine for creating sessions
+            user: Account or EndUser object containing tenant_id, user ID, and role information
+            app_id: App ID for filtering by application (can be None)
+            triggered_from: Source of the execution trigger (SINGLE_STEP or WORKFLOW_RUN)
+        """
+        logger.debug(
+            "LogstoreWorkflowNodeExecutionRepository.__init__: app_id=%s, triggered_from=%s", app_id, triggered_from
+        )
+        # Initialize LogStore client
+        self.logstore_client = AliyunLogStore()
+
+        # Extract tenant_id from user
+        tenant_id = extract_tenant_id(user)
+        if not tenant_id:
+            raise ValueError("User must have a tenant_id or current_tenant_id")
+        self._tenant_id = tenant_id
+
+        # Store app context
+        self._app_id = app_id
+
+        # Extract user context
+        self._triggered_from = triggered_from
+        self._creator_user_id = user.id
+
+        # Determine user role based on user type
+        self._creator_user_role = CreatorUserRole.ACCOUNT if isinstance(user, Account) else CreatorUserRole.END_USER
+
+        # Initialize SQL repository for dual-write support
+        self.sql_repository = SQLAlchemyWorkflowNodeExecutionRepository(session_factory, user, app_id, triggered_from)
+
+        # Control flag for dual-write (write to both LogStore and SQL database)
+        # Set to True to enable dual-write for safe migration, False to use LogStore only
+        self._enable_dual_write = os.environ.get("LOGSTORE_DUAL_WRITE_ENABLED", "true").lower() == "true"
+
+    def _to_logstore_model(self, domain_model: WorkflowNodeExecution) -> Sequence[tuple[str, str]]:
+        logger.debug(
+            "_to_logstore_model: id=%s, node_id=%s, status=%s",
+            domain_model.id,
+            domain_model.node_id,
+            domain_model.status.value,
+        )
+        if not self._triggered_from:
+            raise ValueError("triggered_from is required in repository constructor")
+        if not self._creator_user_id:
+            raise ValueError("created_by is required in repository constructor")
+        if not self._creator_user_role:
+            raise ValueError("created_by_role is required in repository constructor")
+
+        # Generate log_version as nanosecond timestamp for record versioning
+        log_version = str(time.time_ns())
+
+        json_converter = WorkflowRuntimeTypeConverter()
+
+        logstore_model = [
+            ("id", domain_model.id),
+            ("log_version", log_version),  # Add log_version field for append-only writes
+            ("tenant_id", self._tenant_id),
+            ("app_id", self._app_id or ""),
+            ("workflow_id", domain_model.workflow_id),
+            (
+                "triggered_from",
+                self._triggered_from.value if hasattr(self._triggered_from, "value") else str(self._triggered_from),
+            ),
+            ("workflow_run_id", domain_model.workflow_execution_id or ""),
+            ("index", str(domain_model.index)),
+            ("predecessor_node_id", domain_model.predecessor_node_id or ""),
+            ("node_execution_id", domain_model.node_execution_id or ""),
+            ("node_id", domain_model.node_id),
+            ("node_type", domain_model.node_type.value),
+            ("title", domain_model.title),
+            (
+                "inputs",
+                json.dumps(json_converter.to_json_encodable(domain_model.inputs), ensure_ascii=False)
+                if domain_model.inputs
+                else "{}",
+            ),
+            (
+                "process_data",
+                json.dumps(json_converter.to_json_encodable(domain_model.process_data), ensure_ascii=False)
+                if domain_model.process_data
+                else "{}",
+            ),
+            (
+                "outputs",
+                json.dumps(json_converter.to_json_encodable(domain_model.outputs), ensure_ascii=False)
+                if domain_model.outputs
+                else "{}",
+            ),
+            ("status", domain_model.status.value),
+            ("error", domain_model.error or ""),
+            ("elapsed_time", str(domain_model.elapsed_time)),
+            (
+                "execution_metadata",
+                json.dumps(jsonable_encoder(domain_model.metadata), ensure_ascii=False)
+                if domain_model.metadata
+                else "{}",
+            ),
+            ("created_at", domain_model.created_at.isoformat() if domain_model.created_at else ""),
+            ("created_by_role", self._creator_user_role.value),
+            ("created_by", self._creator_user_id),
+            ("finished_at", domain_model.finished_at.isoformat() if domain_model.finished_at else ""),
+        ]
+
+        return logstore_model
+
+    def save(self, execution: WorkflowNodeExecution) -> None:
+        """
+        Save or update a NodeExecution domain entity to LogStore.
+
+        This method serves as a domain-to-logstore adapter that:
+        1. Converts the domain entity to its logstore representation
+        2. Appends a new record with a log_version timestamp
+        3. Maintains proper multi-tenancy by including tenant context during conversion
+        4. Optionally writes to SQL database for dual-write support (controlled by LOGSTORE_DUAL_WRITE_ENABLED)
+
+        Each save operation creates a new record. Updates are simulated by writing
+        new records with higher log_version numbers.
+
+        Args:
+            execution: The NodeExecution domain entity to persist
+        """
+        logger.debug(
+            "save: id=%s, node_execution_id=%s, status=%s",
+            execution.id,
+            execution.node_execution_id,
+            execution.status.value,
+        )
+        try:
+            logstore_model = self._to_logstore_model(execution)
+            self.logstore_client.put_log(AliyunLogStore.workflow_node_execution_logstore, logstore_model)
+
+            logger.debug(
+                "Saved node execution to LogStore: id=%s, node_execution_id=%s, status=%s",
+                execution.id,
+                execution.node_execution_id,
+                execution.status.value,
+            )
+        except Exception:
+            logger.exception(
+                "Failed to save node execution to LogStore: id=%s, node_execution_id=%s",
+                execution.id,
+                execution.node_execution_id,
+            )
+            raise
+
+        # Dual-write to SQL database if enabled (for safe migration)
+        if self._enable_dual_write:
+            try:
+                self.sql_repository.save(execution)
+                logger.debug("Dual-write: saved node execution to SQL database: id=%s", execution.id)
+            except Exception:
+                logger.exception("Failed to dual-write node execution to SQL database: id=%s", execution.id)
+                # Don't raise - LogStore write succeeded, SQL is just a backup
+
+    def save_execution_data(self, execution: WorkflowNodeExecution) -> None:
+        """
+        Save or update the inputs, process_data, or outputs associated with a specific
+        node_execution record.
+
+        For LogStore implementation, this is similar to save() since we always write
+        complete records. We append a new record with updated data fields.
+
+        Args:
+            execution: The NodeExecution instance with data to save
+        """
+        logger.debug("save_execution_data: id=%s, node_execution_id=%s", execution.id, execution.node_execution_id)
+        # In LogStore, we simply write a new complete record with the data
+        # The log_version timestamp will ensure this is treated as the latest version
+        self.save(execution)
+
+    def get_by_workflow_run(
+        self,
+        workflow_run_id: str,
+        order_config: OrderConfig | None = None,
+    ) -> Sequence[WorkflowNodeExecution]:
+        """
+        Retrieve all NodeExecution instances for a specific workflow run.
+        Uses LogStore SQL query with finished_at IS NOT NULL filter for deduplication.
+        This ensures we only get the final version of each node execution.
+        Args:
+            workflow_run_id: The workflow run ID
+            order_config: Optional configuration for ordering results
+                order_config.order_by: List of fields to order by (e.g., ["index", "created_at"])
+                order_config.order_direction: Direction to order ("asc" or "desc")
+
+        Returns:
+            A list of NodeExecution instances
+
+        Note:
+            This method filters by finished_at IS NOT NULL to avoid duplicates from
+            version updates. For complete history including intermediate states,
+            a different query strategy would be needed.
+        """
+        logger.debug("get_by_workflow_run: workflow_run_id=%s, order_config=%s", workflow_run_id, order_config)
+        # Build SQL query with deduplication using finished_at IS NOT NULL
+        # This optimization avoids window functions for common case where we only
+        # want the final state of each node execution
+
+        # Build ORDER BY clause
+        order_clause = ""
+        if order_config and order_config.order_by:
+            order_fields = []
+            for field in order_config.order_by:
+                # Map domain field names to logstore field names if needed
+                field_name = field
+                if order_config.order_direction == "desc":
+                    order_fields.append(f"{field_name} DESC")
+                else:
+                    order_fields.append(f"{field_name} ASC")
+            if order_fields:
+                order_clause = "ORDER BY " + ", ".join(order_fields)
+
+        sql = f"""
+            SELECT *
+            FROM {AliyunLogStore.workflow_node_execution_logstore}
+            WHERE workflow_run_id='{workflow_run_id}'
+              AND tenant_id='{self._tenant_id}'
+              AND finished_at IS NOT NULL
+        """
+
+        if self._app_id:
+            sql += f" AND app_id='{self._app_id}'"
+
+        if order_clause:
+            sql += f" {order_clause}"
+
+        try:
+            # Execute SQL query
+            results = self.logstore_client.execute_sql(
+                sql=sql,
+                query="*",
+                logstore=AliyunLogStore.workflow_node_execution_logstore,
+            )
+
+            # Convert LogStore results to WorkflowNodeExecution domain models
+            executions = []
+            for row in results:
+                try:
+                    execution = _dict_to_workflow_node_execution(row)
+                    executions.append(execution)
+                except Exception as e:
+                    logger.warning("Failed to convert row to WorkflowNodeExecution: %s, row=%s", e, row)
+                    continue
+
+            return executions
+
+        except Exception:
+            logger.exception("Failed to retrieve node executions from LogStore: workflow_run_id=%s", workflow_run_id)
+            raise